Jon Kelbie
12 months ago
38 changed files with 4797 additions and 14 deletions
-
28content/ebook/index.html
-
219themes/nipponalba/static/css/btns.css
-
24themes/nipponalba/static/css/mediaWindow.css
-
802themes/nipponalba/static/css/mobile.css
-
51themes/nipponalba/static/css/normalize.min.css
-
767themes/nipponalba/static/css/pc_tablet.css
-
0themes/nipponalba/static/css/print.css
-
88themes/nipponalba/static/js/PIE.js
-
600themes/nipponalba/static/js/WindowOpen.js
-
9themes/nipponalba/static/js/aws-sdk-2.1.10.min.js
-
9themes/nipponalba/static/js/html5.js
-
8themes/nipponalba/static/js/ie8_css3.js
-
2themes/nipponalba/static/js/jquery-1.8.3.min.js
-
12themes/nipponalba/static/js/jump.js
-
25themes/nipponalba/static/js/main.js
-
9themes/nipponalba/static/js/media.js
-
520themes/nipponalba/static/js/noty/jquery.noty.js
-
34themes/nipponalba/static/js/noty/layouts/bottom.js
-
41themes/nipponalba/static/js/noty/layouts/bottomCenter.js
-
43themes/nipponalba/static/js/noty/layouts/bottomLeft.js
-
43themes/nipponalba/static/js/noty/layouts/bottomRight.js
-
56themes/nipponalba/static/js/noty/layouts/center.js
-
61themes/nipponalba/static/js/noty/layouts/centerLeft.js
-
61themes/nipponalba/static/js/noty/layouts/centerRight.js
-
31themes/nipponalba/static/js/noty/layouts/inline.js
-
34themes/nipponalba/static/js/noty/layouts/top.js
-
41themes/nipponalba/static/js/noty/layouts/topCenter.js
-
43themes/nipponalba/static/js/noty/layouts/topLeft.js
-
43themes/nipponalba/static/js/noty/layouts/topRight.js
-
432themes/nipponalba/static/js/noty/promise.js
-
156themes/nipponalba/static/js/noty/themes/default.js
-
52themes/nipponalba/static/js/pagecode.js
-
172themes/nipponalba/static/js/protector.js
-
5themes/nipponalba/static/js/selectivizr-min.js
-
144themes/nipponalba/static/js/smoothscroll.js
-
68themes/nipponalba/static/js/ua.js
-
56themes/nipponalba/static/js/ua_btn.js
-
22themes/nipponalba/static/js/ua_viewport.js
@ -0,0 +1,219 @@ |
|||
@charset "utf-8"; |
|||
/* CSS Document */ |
|||
.btn_m { |
|||
cursor:pointer; |
|||
display:inline-block; |
|||
/* IE9 SVG, needs conditional override of 'filter' to 'none' */ |
|||
background: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgd2lkdGg9IjEwMCUiIGhlaWdodD0iMTAwJSIgdmlld0JveD0iMCAwIDEgMSIgcHJlc2VydmVBc3BlY3RSYXRpbz0ibm9uZSI+CiAgPGxpbmVhckdyYWRpZW50IGlkPSJncmFkLXVjZ2ctZ2VuZXJhdGVkIiBncmFkaWVudFVuaXRzPSJ1c2VyU3BhY2VPblVzZSIgeDE9IjAlIiB5MT0iMCUiIHgyPSIwJSIgeTI9IjEwMCUiPgogICAgPHN0b3Agb2Zmc2V0PSIwJSIgc3RvcC1jb2xvcj0iI2Y2ZjZmNiIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjEwMCUiIHN0b3AtY29sb3I9IiNkZGUwZTkiIHN0b3Atb3BhY2l0eT0iMSIvPgogIDwvbGluZWFyR3JhZGllbnQ+CiAgPHJlY3QgeD0iMCIgeT0iMCIgd2lkdGg9IjEiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+); |
|||
background: -moz-linear-gradient(top, #F6F6F6 0%, #DDE0E9 100%); /* FF3.6+ */ |
|||
background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#F6F6F6), color-stop(100%,#DDE0E9)); /* Chrome,Safari4+ */ |
|||
background: -webkit-linear-gradient(top, #F6F6F6 0%,#DDE0E9 100%); /* Chrome10+,Safari5.1+ */ |
|||
background: -o-linear-gradient(top, #F6F6F6 0%,#DDE0E9 100%); /* Opera 11.10+ */ |
|||
background: -ms-linear-gradient(top, #F6F6F6 0%,#DDE0E9 100%); /* IE10+ */ |
|||
padding:4px 10px; |
|||
text-shadow:0 1px 1px rgba(255, 255, 255, 0.75); |
|||
color:#333; |
|||
font-size:13px; |
|||
line-height:23px; |
|||
border:solid 1px #a9a9a9; |
|||
border-bottom-color:#bbb; |
|||
-webkit-border-radius:4px; |
|||
-moz-border-radius:4px; |
|||
border-radius:4px; |
|||
-webkit-box-shadow:inset 1px 0px 0 rgba(255, 255, 255, 1), 0 1px 2px rgba(0, 0, 0, 0.05); |
|||
-moz-box-shadow:inset 1px 0px 0 rgba(255, 255, 255, 1), 0 1px 2px rgba(0, 0, 0, 0.05); |
|||
box-shadow:inset 1px 0px 0 rgba(255, 255, 255, 1), 0 1px 2px rgba(0, 0, 0, 0.05); |
|||
-webkit-transition:0.1s linear all; |
|||
-moz-transition:0.1s linear all; |
|||
transition:0.1s linear all; |
|||
background-color:#DDE0E9; |
|||
background-repeat:no-repeat; |
|||
font-size:100%; |
|||
-moz-box-sizing: border-box; /* Firefox */ |
|||
-webkit-box-sizing: border-box; /* Safari 3 */ |
|||
-ms-box-sizing: border-box; /* Internet Explorer 8 */ |
|||
box-sizing: border-box; /* Opera */ |
|||
} |
|||
.btn_danger { |
|||
cursor:pointer; |
|||
display:inline-block; |
|||
/* IE9 SVG, needs conditional override of 'filter' to 'none' */ |
|||
background: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgd2lkdGg9IjEwMCUiIGhlaWdodD0iMTAwJSIgdmlld0JveD0iMCAwIDEgMSIgcHJlc2VydmVBc3BlY3RSYXRpbz0ibm9uZSI+CiAgPGxpbmVhckdyYWRpZW50IGlkPSJncmFkLXVjZ2ctZ2VuZXJhdGVkIiBncmFkaWVudFVuaXRzPSJ1c2VyU3BhY2VPblVzZSIgeDE9IjAlIiB5MT0iMCUiIHgyPSIwJSIgeTI9IjEwMCUiPgogICAgPHN0b3Agb2Zmc2V0PSIwJSIgc3RvcC1jb2xvcj0iI2ZmOTkwMCIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjEwMCUiIHN0b3AtY29sb3I9IiNmOTY0MDEiIHN0b3Atb3BhY2l0eT0iMSIvPgogIDwvbGluZWFyR3JhZGllbnQ+CiAgPHJlY3QgeD0iMCIgeT0iMCIgd2lkdGg9IjEiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+); |
|||
background: -moz-linear-gradient(top, #ff9900 0%, #f96401 100%); /* FF3.6+ */ |
|||
background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#ff9900), color-stop(100%,#f96401)); /* Chrome,Safari4+ */ |
|||
background: -webkit-linear-gradient(top, #ff9900 0%,#f96401 100%); /* Chrome10+,Safari5.1+ */ |
|||
background: -o-linear-gradient(top, #ff9900 0%,#f96401 100%); /* Opera 11.10+ */ |
|||
background: -ms-linear-gradient(top, #ff9900 0%,#f96401 100%); /* IE10+ */ |
|||
background: linear-gradient(to bottom, #ff9900 0%,#f96401 100%); /* W3C */ |
|||
padding:4px 10px; |
|||
text-shadow:0 1px 1px rgba(249,100,1,1); |
|||
color:#fff; |
|||
font-size:13px; |
|||
line-height:23px; |
|||
border:1px solid #FA6D01; |
|||
-webkit-border-radius:4px; |
|||
-moz-border-radius:4px; |
|||
border-radius:4px; |
|||
-webkit-box-shadow: none; |
|||
-moz-box-shadow: none; |
|||
box-shadow: none; |
|||
-webkit-transition:0.1s linear all; |
|||
-moz-transition:0.1s linear all; |
|||
transition:0.1s linear all; |
|||
background-color:#f96401; |
|||
background-repeat:no-repeat; |
|||
font-size:100%; |
|||
-moz-box-sizing: border-box; /* Firefox */ |
|||
-webkit-box-sizing: border-box; /* Safari 3 */ |
|||
-ms-box-sizing: border-box; /* Internet Explorer 8 */ |
|||
box-sizing: border-box; /* Opera */ |
|||
} |
|||
.btn_m:active,.btn_danger:active { |
|||
-webkit-box-shadow:inset 0 3px 7px rgba(0, 0, 0, 0.1), 0 1px 2px rgba(0, 0, 0, 0.05); |
|||
-moz-box-shadow:inset 0 3px 7px rgba(0, 0, 0, 0.1), 0 1px 2px rgba(0, 0, 0, 0.05); |
|||
box-shadow:inset 0 3px 7px rgba(0, 0, 0, 0.1), 0 1px 2px rgba(0, 0, 0, 0.05); |
|||
} |
|||
|
|||
.btn_m:hover,.btn_danger:hover { |
|||
background-position:0px -30px; |
|||
text-decoration:none; |
|||
} |
|||
.lt-ie9 .btn_m:active,.lt-ie9 .btn_danger:active { |
|||
-webkit-box-shadow: none; /* Saf3-4, iOS 4.0.2 - 4.2, Android 2.3+ */ |
|||
-moz-box-shadow: none; /* FF3.5 - 3.6 */ |
|||
box-shadow: none; /* Opera 10.5, IE9, FF4+, Chrome 6+, iOS 5 */ |
|||
} |
|||
|
|||
|
|||
.lt-ie9 .btn_m{ |
|||
background: url(../img/ie8_btn.png) repeat-x top #DDE0E9; |
|||
box-shadow:none; |
|||
position: relative; |
|||
} |
|||
.lt-ie9 .btn_m:hover{ |
|||
background:#DDE0E9; |
|||
} |
|||
.lt-ie9 .btn_m.btn_primary{ |
|||
background: url(../img/ie8_btn_primary.png) repeat-x top #0064cd; |
|||
box-shadow:none; |
|||
position: relative; |
|||
border: solid 1px #0064CD; |
|||
} |
|||
.lt-ie9 .btn_m.btn_secondery{ |
|||
background: url(../img/ie8_btn_secondery.png) repeat-x top #4a4a4a; |
|||
box-shadow:none; |
|||
position: relative; |
|||
border: solid 1px #4a4a4a; |
|||
} |
|||
|
|||
.lt-ie9 .btn_danger{ |
|||
box-shadow:none; |
|||
position: relative; |
|||
} |
|||
.lt-ie9 .btn_danger:hover{ |
|||
background:#f96401; |
|||
} |
|||
|
|||
.btn_m.btn_primary { |
|||
background: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgd2lkdGg9IjEwMCUiIGhlaWdodD0iMTAwJSIgdmlld0JveD0iMCAwIDEgMSIgcHJlc2VydmVBc3BlY3RSYXRpbz0ibm9uZSI+CiAgPGxpbmVhckdyYWRpZW50IGlkPSJncmFkLXVjZ2ctZ2VuZXJhdGVkIiBncmFkaWVudFVuaXRzPSJ1c2VyU3BhY2VPblVzZSIgeDE9IjAlIiB5MT0iMCUiIHgyPSIwJSIgeTI9IjEwMCUiPgogICAgPHN0b3Agb2Zmc2V0PSIxJSIgc3RvcC1jb2xvcj0iIzA0OWNkYiIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjEwMCUiIHN0b3AtY29sb3I9IiMwMDY0Y2QiIHN0b3Atb3BhY2l0eT0iMSIvPgogIDwvbGluZWFyR3JhZGllbnQ+CiAgPHJlY3QgeD0iMCIgeT0iMCIgd2lkdGg9IjEiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+); |
|||
background: -moz-linear-gradient(top, #049CDB 0%, #0064CD 100%); /* FF3.6+ */ |
|||
background: -webkit-gradient(linear, left top, left bottom, color-stop(0%,#049CDB), color-stop(100%,#0064CD)); /* Chrome,Safari4+ */ |
|||
background: -webkit-linear-gradient(top, #049CDB 0%,#0064CD 100%); /* Chrome10+,Safari5.1+ */ |
|||
background: -o-linear-gradient(top, #049CDB 0%,#0064CD 100%); /* Opera 11.10+ */ |
|||
background: -ms-linear-gradient(top, #049CDB 0%,#0064CD 100%); /* IE10+ */ |
|||
background: linear-gradient(#049CDB, #0064CD) no-repeat scroll 0 0 #0064CD; |
|||
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); |
|||
background-repeat: no-repeat; |
|||
background-color: #0064CD; |
|||
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); |
|||
color: #fff; |
|||
box-shadow: none; |
|||
} |
|||
.btn_m.btn_primary:hover { |
|||
background-image:none; |
|||
background-position: 0px -30px; |
|||
background-color: #0064CD; |
|||
} |
|||
.btn_m.btn_secondery { |
|||
background: url(data:image/svg+xml;base64,PD94bWwgdmVyc2lvbj0iMS4wIiA/Pgo8c3ZnIHhtbG5zPSJodHRwOi8vd3d3LnczLm9yZy8yMDAwL3N2ZyIgd2lkdGg9IjEwMCUiIGhlaWdodD0iMTAwJSIgdmlld0JveD0iMCAwIDEgMSIgcHJlc2VydmVBc3BlY3RSYXRpbz0ibm9uZSI+CiAgPGxpbmVhckdyYWRpZW50IGlkPSJncmFkLXVjZ2ctZ2VuZXJhdGVkIiBncmFkaWVudFVuaXRzPSJ1c2VyU3BhY2VPblVzZSIgeDE9IjAlIiB5MT0iMCUiIHgyPSIwJSIgeTI9IjEwMCUiPgogICAgPHN0b3Agb2Zmc2V0PSIxJSIgc3RvcC1jb2xvcj0iIzY0NjQ2NCIgc3RvcC1vcGFjaXR5PSIxIi8+CiAgICA8c3RvcCBvZmZzZXQ9IjEwMCUiIHN0b3AtY29sb3I9IiM0YTRhNGEiIHN0b3Atb3BhY2l0eT0iMSIvPgogIDwvbGluZWFyR3JhZGllbnQ+CiAgPHJlY3QgeD0iMCIgeT0iMCIgd2lkdGg9IjEiIGhlaWdodD0iMSIgZmlsbD0idXJsKCNncmFkLXVjZ2ctZ2VuZXJhdGVkKSIgLz4KPC9zdmc+); |
|||
background: linear-gradient(#646464, #4a4a4a) no-repeat scroll 0 0 #4a4a4a; |
|||
border-color: rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.1) rgba(0, 0, 0, 0.25); |
|||
text-shadow: 0 -1px 0 rgba(0, 0, 0, 0.25); |
|||
background-repeat: no-repeat; |
|||
background-color: #4a4a4a; |
|||
color: #fff; |
|||
box-shadow: none; |
|||
} |
|||
.btn_m.btn_secondery:hover { |
|||
background-position: 0px -30px; |
|||
background-color: #4a4a4a; |
|||
} |
|||
.btn_m.btn_large{ |
|||
padding:10px 10px; |
|||
} |
|||
|
|||
|
|||
/*under ie7*/ |
|||
.lt-ie8 .btn_m{ |
|||
padding-right: 0px; |
|||
padding-left: 0px; |
|||
} |
|||
.lt-ie8 .btn_m:hover{ |
|||
padding-right: 0px; |
|||
padding-left: 0px; |
|||
} |
|||
|
|||
.lt-ie8 .list_details .btn_m{ |
|||
padding-right: 0px; |
|||
padding-left: 0px; |
|||
} |
|||
|
|||
.btn_m:disabled { |
|||
background-image:none; |
|||
filter:alpha(opacity=65); |
|||
-khtml-opacity:0.65; |
|||
-moz-opacity:0.65; |
|||
opacity:0.65; |
|||
cursor:default; |
|||
} |
|||
|
|||
.dropdown_menu { |
|||
background-clip: padding-box; |
|||
background-color: #FFFFFF; |
|||
border-color: rgba(0, 0, 0, 0.2); |
|||
border-radius: 0 0 5px 5px; |
|||
border-style: solid; |
|||
border-width: 1px; |
|||
box-shadow: 0 5px 10px rgba(0, 0, 0, 0.2); |
|||
float: left; |
|||
list-style: none outside none; |
|||
margin: 0; |
|||
max-width: 220px; |
|||
min-width: 160px; |
|||
padding: 4px 0; |
|||
position: absolute; |
|||
right: 0; |
|||
top: 100%; |
|||
z-index: 1000; |
|||
display: none; |
|||
} |
|||
.icon_btn{ |
|||
text-indent: -9999em; |
|||
display: block; |
|||
} |
|||
.icon_btn:hover{ |
|||
background-color: #efefef; |
|||
} |
|||
.icon_btn:active{ |
|||
box-shadow: 1px 1px 5px rgba(0, 0, 0, 0.5) inset; |
|||
} |
|||
|
|||
.current .icon_thumnail,.current .icon_list{ |
|||
background-color: #ccc; |
|||
} |
|||
|
|||
.icon{ |
|||
display: inline-block; |
|||
background-repeat: no-repeat; |
|||
background-position: center center; |
|||
} |
|||
@ -0,0 +1,24 @@ |
|||
* { |
|||
margin: 0px; |
|||
padding: 0px; |
|||
} |
|||
|
|||
html { |
|||
height: 100%; |
|||
} |
|||
|
|||
body { |
|||
width: 100%; |
|||
height: 100%; |
|||
} |
|||
|
|||
#mediaObject { |
|||
width: 100%; |
|||
height: 100%; |
|||
position: relative; |
|||
} |
|||
|
|||
#mediaObject embed, #mediaObject object { |
|||
vertical-align:middle; |
|||
} |
|||
|
|||
@ -0,0 +1,802 @@ |
|||
/* ========================================================================== |
|||
HTML5 Boilerplate styles - h5bp.com (generated via initializr.com) |
|||
========================================================================== */ |
|||
|
|||
html, |
|||
button, |
|||
input, |
|||
select, |
|||
textarea { |
|||
color: #222; |
|||
} |
|||
|
|||
body { |
|||
font-family:"ヒラギノ角ゴ Pro W3","Hiragino Kaku Gothic Pro","Osaka","メイリオ","ＭＳ Ｐゴシック","Helvetica",arial,sans-serif; |
|||
font-size: 1em; |
|||
line-height: 1.4; |
|||
} |
|||
/*テキストを選択した時の色*/ |
|||
::-moz-selection { |
|||
background: #b3d4fc; |
|||
text-shadow: none; |
|||
} |
|||
|
|||
::selection { |
|||
background: #b3d4fc; |
|||
text-shadow: none; |
|||
} |
|||
|
|||
hr { |
|||
display: block; |
|||
margin: 1em 0; |
|||
padding: 0; |
|||
height: 1px; |
|||
border: 0; |
|||
border-top: 1px solid #ccc; |
|||
} |
|||
|
|||
img { |
|||
vertical-align: middle; |
|||
} |
|||
|
|||
fieldset { |
|||
margin: 0; |
|||
padding: 0; |
|||
border: 0; |
|||
} |
|||
|
|||
textarea { |
|||
resize: vertical; |
|||
} |
|||
|
|||
.chromeframe { |
|||
margin: 0.2em 0; |
|||
padding: 0.2em 0; |
|||
background: #ccc; |
|||
color: #000; |
|||
} |
|||
|
|||
|
|||
/* ========================================================================== |
|||
Author's custom styles |
|||
========================================================================== */ |
|||
|
|||
.w10{ width: 10%;} |
|||
.w20{ width: 20%;} |
|||
.w25{ width: 25%;} |
|||
.w30{ width: 30%;} |
|||
.w33{ width: 33%;} |
|||
.w40{ width: 40%;} |
|||
.w50{ width: 50%;} |
|||
.w60{ width: 60%;} |
|||
.w70{ width: 70%;} |
|||
.w80{ width: 80%;} |
|||
.w90{ width: 90%;} |
|||
.w100{ width: 100%;} |
|||
|
|||
img{max-width: 100%; height: auto;} |
|||
|
|||
|
|||
|
|||
|
|||
/* ========================================================================== |
|||
Helper classes |
|||
========================================================================== */ |
|||
|
|||
.ir { |
|||
overflow: hidden; |
|||
border: 0; |
|||
background-color: transparent; |
|||
*text-indent: -9999px; |
|||
} |
|||
|
|||
.ir:before { |
|||
display: block; |
|||
width: 0; |
|||
height: 100%; |
|||
content: ""; |
|||
} |
|||
|
|||
.visuallyhidden { |
|||
position: absolute; |
|||
overflow: hidden; |
|||
clip: rect(0 0 0 0); |
|||
margin: -1px; |
|||
padding: 0; |
|||
width: 1px; |
|||
height: 1px; |
|||
border: 0; |
|||
} |
|||
|
|||
.visuallyhidden.focusable:active, |
|||
.visuallyhidden.focusable:focus { |
|||
position: static; |
|||
overflow: visible; |
|||
clip: auto; |
|||
margin: 0; |
|||
width: auto; |
|||
height: auto; |
|||
} |
|||
|
|||
.invisible { |
|||
visibility: hidden; |
|||
} |
|||
|
|||
.clearfix:before, |
|||
.clearfix:after { |
|||
display: table; |
|||
content: " "; |
|||
} |
|||
|
|||
.clearfix:after { |
|||
clear: both; |
|||
} |
|||
|
|||
.clearfix { |
|||
*zoom: 1; |
|||
} |
|||
|
|||
.flr{ |
|||
float: right; |
|||
|
|||
} |
|||
|
|||
/* ========================================================================== |
|||
Print styles |
|||
========================================================================== */ |
|||
|
|||
@media print { |
|||
* { |
|||
background: transparent !important; |
|||
box-shadow:none !important; |
|||
color: #000 !important; /* Black prints faster: h5bp.com/s */ |
|||
text-shadow: none !important; |
|||
} |
|||
|
|||
a, |
|||
a:visited { |
|||
text-decoration: underline; |
|||
} |
|||
|
|||
a[href]:after { |
|||
content: " (" attr(href) ")"; |
|||
} |
|||
|
|||
abbr[title]:after { |
|||
content: " (" attr(title) ")"; |
|||
} |
|||
|
|||
/* |
|||
* Don't show links for images, or javascript/internal links |
|||
*/ |
|||
|
|||
.ir a:after, |
|||
a[href^="javascript:"]:after, |
|||
a[href^="#"]:after { |
|||
content: ""; |
|||
} |
|||
|
|||
pre, |
|||
blockquote { |
|||
border: 1px solid #999; |
|||
page-break-inside: avoid; |
|||
} |
|||
|
|||
thead { |
|||
display: table-header-group; /* h5bp.com/t */ |
|||
} |
|||
|
|||
tr, |
|||
img { |
|||
page-break-inside: avoid; |
|||
} |
|||
|
|||
img { |
|||
max-width: 100% !important; |
|||
} |
|||
|
|||
@page { |
|||
margin: 0.5cm; |
|||
} |
|||
|
|||
p, |
|||
h2, |
|||
h3 { |
|||
orphans: 3; |
|||
widows: 3; |
|||
} |
|||
|
|||
h2, |
|||
h3 { |
|||
page-break-after: avoid; |
|||
} |
|||
} |
|||
/*utility*/ |
|||
.txt_small{ |
|||
font-size: 85%; |
|||
} |
|||
|
|||
.txt_normal{ |
|||
font-size: 100%; |
|||
} |
|||
|
|||
.txt_large{ |
|||
font-size: 120%; |
|||
} |
|||
.txt_xlarge{ |
|||
font-size: 150%; |
|||
} |
|||
|
|||
.txt_r{ |
|||
text-align: right; |
|||
} |
|||
|
|||
.txt_l{ |
|||
text-align: left; |
|||
} |
|||
|
|||
.txt_c{ |
|||
text-align: center; |
|||
} |
|||
.txt_alert{ |
|||
color: #FF3300; |
|||
} |
|||
.line_150{ |
|||
line-height: 150%; |
|||
} |
|||
.line_180{ |
|||
line-height: 180%; |
|||
} |
|||
.line_200{ |
|||
line-height: 200%; |
|||
} |
|||
.line_250{ |
|||
line-height: 250%; |
|||
} |
|||
.flt{ |
|||
float: left; |
|||
} |
|||
.flr{ |
|||
float: right; |
|||
} |
|||
.mt10{ margin-top: 10px;} |
|||
.mb10{ margin-bottom: 10px;} |
|||
.ml10{ margin-left: 10px;} |
|||
.mr10{ margin-right: 10px;} |
|||
|
|||
/*table settings*/ |
|||
|
|||
table { |
|||
background-color: transparent; |
|||
border-collapse: collapse; |
|||
border-spacing: 0; |
|||
max-width: 100%; |
|||
font-size: 70%; |
|||
} |
|||
.table { |
|||
background: none repeat scroll 0 0 #FFFFFF; |
|||
border-radius: 5px 5px 5px 5px; |
|||
width: 100%; |
|||
} |
|||
.table th, .table td { |
|||
border-top: 1px solid #DDDDDD; |
|||
line-height: 18px; |
|||
padding: 8px; |
|||
text-align: left; |
|||
vertical-align: top; |
|||
} |
|||
.table .highlight{ |
|||
background: #efefef; |
|||
} |
|||
.table th { |
|||
font-weight: bold; |
|||
} |
|||
.table thead th { |
|||
border-bottom: 1px solid #DDDDDD; |
|||
vertical-align: bottom; |
|||
} |
|||
.table thead tr.dcms_table_fold_title th { |
|||
background: none repeat scroll 0 0 #EBEBEB; |
|||
vertical-align: bottom; |
|||
} |
|||
.table colgroup + thead tr:first-child th, .table colgroup + thead tr:first-child td, .table thead:first-child tr:first-child th, .table thead:first-child tr:first-child td { |
|||
border-top: 0 none; |
|||
} |
|||
.table tbody + tbody { |
|||
border-top: 2px solid #DDDDDD; |
|||
} |
|||
.table-condensed th, .table-condensed td { |
|||
padding: 4px 5px; |
|||
} |
|||
.table-bordered { |
|||
-moz-border-bottom-colors: none; |
|||
-moz-border-left-colors: none; |
|||
-moz-border-right-colors: none; |
|||
-moz-border-top-colors: none; |
|||
border-collapse: separate; |
|||
border-color: #DDDDDD #DDDDDD #DDDDDD -moz-use-text-color; |
|||
border-image: none; |
|||
border-radius: 4px 4px 4px 4px; |
|||
border-style: solid solid solid none; |
|||
border-width: 1px 1px 1px 0; |
|||
} |
|||
.table-bordered th, .table-bordered td { |
|||
border-left: 1px solid #DDDDDD; |
|||
} |
|||
.table-bordered thead:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child th, .table-bordered tbody:first-child tr:first-child td { |
|||
border-top: 0 none; |
|||
} |
|||
.table-bordered thead:first-child tr:first-child th:first-child, .table-bordered tbody:first-child tr:first-child td:first-child { |
|||
border-radius: 4px 0 0 0; |
|||
} |
|||
.table-bordered thead:first-child tr:first-child th:last-child, .table-bordered tbody:first-child tr:first-child td:last-child { |
|||
border-radius: 0 4px 0 0; |
|||
} |
|||
.table-bordered thead:last-child tr:last-child th:first-child, .table-bordered tbody:last-child tr:last-child td:first-child { |
|||
border-radius: 0 0 0 4px; |
|||
} |
|||
.table-bordered thead:last-child tr:last-child th:last-child, .table-bordered tbody:last-child tr:last-child td:last-child { |
|||
border-radius: 0 0 4px 0; |
|||
} |
|||
.table-striped tbody tr:nth-child(2n+1) td, .table-striped tbody tr:nth-child(2n+1) th { |
|||
background-color: #F9F9F9; |
|||
} |
|||
|
|||
/*subtitles*/ |
|||
.book_title01{ |
|||
font-size: 100%; |
|||
border-bottom:solid 1px #ccc ; |
|||
font-weight: normal; |
|||
margin-bottom: 10px; |
|||
text-indent: 5px; |
|||
} |
|||
.book_title01 .small_title{ |
|||
font-size: 50%; |
|||
display: block; |
|||
text-indent: 0px; |
|||
margin: 0px 5px; |
|||
color: #666; |
|||
} |
|||
.book_title01 strong{ |
|||
max-height: 7em; |
|||
margin: 0px 5px; |
|||
overflow: hidden; |
|||
display:block; |
|||
text-indent:0px; |
|||
word-wrap: break-word; |
|||
} |
|||
|
|||
.subtitle01{ |
|||
font-size: 160%; |
|||
line-height: 40px; |
|||
border-bottom:solid 1px #ccc ; |
|||
font-weight: normal; |
|||
margin-bottom:0.5em; |
|||
text-indent: 5px; |
|||
position: relative; |
|||
} |
|||
|
|||
.subtitle01_double{ |
|||
border-bottom: 1px solid #CCCCCC; |
|||
font-size: 130%; |
|||
font-weight: normal; |
|||
margin-bottom: 2.5em; |
|||
position: relative; |
|||
text-indent: 0; |
|||
} |
|||
.subtitle02{ |
|||
border-bottom: 1px solid #CCCCCC; |
|||
font-size: 120%; |
|||
font-weight: normal; |
|||
line-height: 40px; |
|||
margin-bottom: 10px; |
|||
} |
|||
.subtitle03{ |
|||
border-bottom: 1px solid #CCCCCC; |
|||
font-size: 100%; |
|||
font-weight: normal; |
|||
line-height: 35px; |
|||
margin-bottom: 10px; |
|||
text-indent: 5px; |
|||
} |
|||
.subtitle04{ |
|||
border-bottom: 1px dashed #CCCCCC; |
|||
font-size: 120%; |
|||
font-weight: bold; |
|||
line-height: 30px; |
|||
margin-bottom: 10px; |
|||
text-indent: 5px; |
|||
} |
|||
|
|||
.bold_title01{ |
|||
font-weight: bold; |
|||
} |
|||
.side_detail_box01{ |
|||
font-size: 50%; |
|||
position: absolute; |
|||
right: 0; |
|||
top: 0px; |
|||
} |
|||
.side_detail_box01 .btn_m{ |
|||
text-indent: 0px; |
|||
padding: 4px 5px; |
|||
width: 35px; |
|||
} |
|||
|
|||
.subtitle{ |
|||
font-size: 85%; |
|||
color: #666; |
|||
margin-left: 5px; |
|||
} |
|||
.switch_view_title{ |
|||
float: left; |
|||
margin-right: 10px; |
|||
} |
|||
|
|||
.copyright_box{ |
|||
font-size: 85%; |
|||
color: #666; |
|||
} |
|||
|
|||
|
|||
/*main_layout*/ |
|||
.wrapper{ |
|||
float: left; |
|||
width: 100%; |
|||
text-align: center; |
|||
} |
|||
.container{ |
|||
width: 100%; |
|||
margin: 0 auto; |
|||
text-align: left; |
|||
border-top:solid #666666 3px; |
|||
} |
|||
.inner { |
|||
margin: 0 5px; |
|||
content: " "; |
|||
} |
|||
.inner:after { |
|||
clear: both; |
|||
} |
|||
|
|||
.inner { |
|||
*zoom: 1; |
|||
} |
|||
|
|||
.title_box01{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-bottom: 10px; |
|||
} |
|||
|
|||
.contents{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-top: 10px; |
|||
min-height: 280px; |
|||
} |
|||
.pagelist .contents{ |
|||
margin-top: 0px; |
|||
} |
|||
|
|||
.section01{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-bottom: 30px; |
|||
} |
|||
|
|||
.photobox01{ |
|||
background: #fff; |
|||
margin: 0px; |
|||
} |
|||
|
|||
.photobox01 img{ |
|||
border: solid 1px #ccc; |
|||
} |
|||
|
|||
.detailbox01{ |
|||
float: left; |
|||
width: 100%; |
|||
} |
|||
|
|||
/*list view*/ |
|||
.listview01{ |
|||
list-style-type: none; |
|||
} |
|||
.listview01 li{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-bottom: 20px; |
|||
} |
|||
.listview01 li img{ |
|||
max-width: 140px; |
|||
} |
|||
.list_thum01{ |
|||
float: left; |
|||
width: 140px; |
|||
line-height: 170px; |
|||
margin-right: 10px; |
|||
margin-bottom: 20px; |
|||
text-align: center; |
|||
} |
|||
|
|||
.list_details{ |
|||
float: left; |
|||
width: 100%; |
|||
} |
|||
.list_details.notice_text{ |
|||
font-size: 70%; |
|||
color:#666; |
|||
text-align: left; |
|||
} |
|||
.list_txt01{ |
|||
margin-left: 150px; |
|||
background: #E5E5E5; |
|||
min-height: 180px; |
|||
position: relative; |
|||
-webkit-box-shadow: 0px 1px 3px rgba(0,0,0,.5); |
|||
-moz-box-shadow: 0px 1px 3px rgba(0,0,0,.5); |
|||
box-shadow: 0px 1px 3px rgba(0,0,0,.5); |
|||
/*background:url("http://subtlepatterns.com/patterns/tiny_grid.png") #FCFCFC;*/ |
|||
background:#DDDDDD; |
|||
position:relative; |
|||
border:1px solid #fff; |
|||
} |
|||
.list_txt01 .inner{ |
|||
min-height: 120px; |
|||
} |
|||
.book_detail .list_txt01 .inner{ |
|||
min-height: 200px; |
|||
} |
|||
|
|||
.list_txt02{ |
|||
width:100%; |
|||
} |
|||
.list_txt03{ |
|||
margin-left: 120px; |
|||
} |
|||
|
|||
.side_contents01{ |
|||
float: left; |
|||
width: 230px; |
|||
} |
|||
.list_details{ |
|||
font-size: 80%; |
|||
text-align: center; |
|||
} |
|||
.list_details .btn_m{ |
|||
padding: 4px 8px; |
|||
float: left; |
|||
width: 100%; |
|||
text-align: left; |
|||
} |
|||
|
|||
.main_contents{ |
|||
float: left; |
|||
width: 100%; |
|||
min-height: 280px; |
|||
} |
|||
|
|||
.app_download_box{ |
|||
background:url("../img/bg_grad01.png") repeat-x top #fff; |
|||
clear: both; |
|||
border: solid 1px #ccc; |
|||
padding: 10px; |
|||
margin:10px 5px 0px; |
|||
border-radius: 5px; |
|||
} |
|||
.app_title{ |
|||
font-size: 80%; |
|||
margin-bottom: 0.8em; |
|||
} |
|||
.app_title img{ |
|||
width:20px; |
|||
height:20px; |
|||
padding-right: 5px; |
|||
} |
|||
|
|||
.ban_holder01{ |
|||
list-style: none; |
|||
|
|||
} |
|||
.ban_holder01 li{ |
|||
list-style: none; |
|||
width: 48%; |
|||
display: inline-block; |
|||
margin-bottom: 5px; |
|||
} |
|||
|
|||
.footer{ |
|||
clear: both; |
|||
float: left; |
|||
width: 100%; |
|||
padding-bottom: 10px; |
|||
background: #000; |
|||
} |
|||
|
|||
.footer_inner{ |
|||
border-top:solid 1px #ccc; |
|||
clear: both; |
|||
font-size: 12px; |
|||
background: #666666; |
|||
} |
|||
|
|||
.footer_inner .copyright{ |
|||
background-color: #000000; |
|||
color: #FFFFFF; |
|||
display: inline; |
|||
float: left; |
|||
margin: 0; |
|||
padding: 2px 5px; |
|||
text-align: right; |
|||
width: 100%; |
|||
-moz-box-sizing: border-box; |
|||
-webkit-box-sizing: border-box; |
|||
} |
|||
|
|||
.switch_view{ |
|||
list-style-type: none; |
|||
} |
|||
|
|||
.small_txt{ |
|||
font-size: 70%; |
|||
} |
|||
/*Book open btns toggle*/ |
|||
.flash_box{ |
|||
display: none; |
|||
} |
|||
.pc .flash_box{ |
|||
display: block; |
|||
} |
|||
|
|||
.pc .flashonly_notice{ |
|||
display: none; |
|||
} |
|||
|
|||
.html5_box{ |
|||
display: block; |
|||
} |
|||
|
|||
.appli_box{ |
|||
display: block; |
|||
} |
|||
|
|||
.detail_text01{ |
|||
padding: 5px; |
|||
margin: 0 5px; |
|||
clear:both; |
|||
background:url("../img/bg_grad01.png") repeat-x top #fff; |
|||
-webkit-border-radius: 5px; /* Saf3-4, iOS 1-3.2, Android <e;1.6 */ |
|||
-moz-border-radius: 5px; /* FF1-3.6 */ |
|||
border-radius: 5px; /* Opera 10.5, IE9, Saf5, Chrome, FF4, iOS 4, Android 2.1+ */ |
|||
|
|||
/* useful if you don't want a bg color from leaking outside the border: */ |
|||
-moz-background-clip: padding; -webkit-background-clip: padding-box; background-clip: padding-box; |
|||
border: solid 1px #ccc; |
|||
} |
|||
|
|||
|
|||
.book_data{ |
|||
float: left; |
|||
width: 150px; |
|||
font-size: 80%; |
|||
color: #888; |
|||
} |
|||
|
|||
.book_data dt{ |
|||
float: left; |
|||
margin-right: 10px; |
|||
margin-left: 5px; |
|||
} |
|||
.book_data dd{ |
|||
float: left; |
|||
margin: 0px; |
|||
} |
|||
|
|||
.pagelist_link{ |
|||
float: right; |
|||
margin: 0px; |
|||
font-size: 80%; |
|||
margin-right: 5px; |
|||
} |
|||
.operating_env{ |
|||
font-size: 75%; |
|||
} |
|||
.operating_env dl{ |
|||
margin-left: 10px; |
|||
} |
|||
|
|||
.breadcrumbs{ |
|||
padding: 5px 5px; |
|||
font-size: 70%; |
|||
margin-bottom: 10px; |
|||
border-bottom: solid 1px #ccc; |
|||
background-color: #efefef; |
|||
} |
|||
|
|||
.pagelist_wrap{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-bottom: 20px; |
|||
} |
|||
.listbox01_left { |
|||
float: left; |
|||
height: auto !important; |
|||
list-style-type: none; |
|||
min-height: 250px; |
|||
padding-bottom: 10px; |
|||
width: 100%; |
|||
margin-top: 20px; |
|||
} |
|||
.listbox01_left li { |
|||
float: left; |
|||
list-style-type: none; |
|||
padding-bottom: 35px; |
|||
text-align: center; |
|||
width: 50%; |
|||
} |
|||
.listbox01_left li img, .listbox01_right li img { |
|||
border: 1px solid #CCCCCC; |
|||
max-width: 85px; |
|||
} |
|||
|
|||
|
|||
.listbox01_right { |
|||
float: left; |
|||
height: auto !important; |
|||
list-style-type: none; |
|||
min-height: 250px; |
|||
padding-bottom: 10px; |
|||
width: 100%; |
|||
margin-top: 20px; |
|||
} |
|||
.listbox01_right li { |
|||
float: right; |
|||
list-style-type: none; |
|||
padding-bottom: 35px; |
|||
text-align: center; |
|||
width: 50%; |
|||
} |
|||
|
|||
|
|||
/*page_list*/ |
|||
.list_pager { |
|||
list-style: none outside none; |
|||
text-align: center; |
|||
font-size: 75%; |
|||
} |
|||
.list_pager li { |
|||
display: inline; |
|||
margin-right: 0.5em; |
|||
} |
|||
a.current { |
|||
font-weight: bold; |
|||
text-decoration: underline; |
|||
} |
|||
|
|||
|
|||
/*mobile_landscape*/ |
|||
|
|||
@media screen and (orientation: portrait) { |
|||
.ban_holder01 li { |
|||
width: 48%; |
|||
} |
|||
.icon.arrow { |
|||
background-image: url("../img/icon_arrow.png"); |
|||
float: left; |
|||
height: 45px; |
|||
margin: 0 10px 0 0; |
|||
width: 6px; |
|||
} |
|||
} |
|||
|
|||
@media screen and (orientation: landscape) { |
|||
.ban_holder01 li { |
|||
width: 32%; |
|||
} |
|||
.listbox01_left li{ |
|||
width: 32%; |
|||
} |
|||
|
|||
} |
|||
|
|||
@ -0,0 +1,51 @@ |
|||
/*! normalize.css v1.0.1 | MIT License | git.io/normalize */ |
|||
article,aside,details,figcaption,figure,footer,header,hgroup,nav,section,summary{display:block} |
|||
audio,canvas,video{display:inline-block;*display:inline;*zoom:1} |
|||
audio:not([controls]){display:none;height:0} |
|||
[hidden]{display:none} |
|||
html{font-size:100%;-webkit-text-size-adjust:100%;-ms-text-size-adjust:100%} |
|||
/*html,button,input,select,textarea{font-family:sans-serif}*/ |
|||
body{margin:0} |
|||
a{ text-decoration: none; color: #0066CC; font-family:'ヒラギノ角ゴ pro W3', "Hiragino KaKu Gothic Pro", Osaka, sans-serif;} |
|||
a:focus{outline:none;} |
|||
a:active,a:hover{outline:0;text-decoration: underline;} |
|||
h1{font-weight:normal;font-size:2em;margin: 0} |
|||
h2{font-weight:normal;font-size:1.5em;margin: 0} |
|||
h3{font-weight:normal;font-size:1.17em;margin: 0} |
|||
h4{font-weight:normal;font-size:1em;margin: 0} |
|||
h5{font-weight:normal;font-size:.83em;margin: 0} |
|||
h6{font-weight:normal;font-size:.75em;margin: 0} |
|||
abbr[title]{border-bottom:1px dotted} |
|||
b,strong{font-weight:bold} |
|||
blockquote{margin:1em 40px} |
|||
dfn{font-style:italic} |
|||
mark{background:#ff0;color:#000} |
|||
p,pre{margin:0.5em 0} |
|||
/*code,kbd,pre,samp{font-family:monospace,serif;_font-family:'courier new',monospace;font-size:1em}*/ |
|||
pre{white-space:pre;white-space:pre-wrap;word-wrap:break-word} |
|||
q{quotes:none} |
|||
q:before,q:after{content:'';content:none} |
|||
small{font-size:80%} |
|||
sub,sup{font-size:75%;line-height:0;position:relative;vertical-align:baseline} |
|||
sup{top:-0.5em} |
|||
sub{bottom:-0.25em} |
|||
dl,menu,ol,ul{margin:0; padding:0; list-style-type: none;list-style-position: inside;} |
|||
dd{margin:0 0 0 40px} |
|||
/*menu,ol,ul{padding:0 0 0 40px}*/ |
|||
nav ul,nav ol{list-style:none;list-style-image:none; list-style-position: inside;} |
|||
img{border:0;-ms-interpolation-mode:bicubic} |
|||
svg:not(:root){overflow:hidden} |
|||
figure{margin:0} |
|||
form{margin:0} |
|||
fieldset{border:1px solid #c0c0c0;margin:0 2px;padding:.35em .625em .75em} |
|||
legend{border:0;padding:0;white-space:normal;*margin-left:-7px} |
|||
button,input,select,textarea{font-size:100%;margin:0;vertical-align:baseline;*vertical-align:middle} |
|||
button,input{line-height:normal} |
|||
button,html input[type="button"],input[type="reset"],input[type="submit"]{-webkit-appearance:button;cursor:pointer;*overflow:visible} |
|||
button[disabled],input[disabled]{cursor:default} |
|||
input[type="checkbox"],input[type="radio"]{box-sizing:border-box;padding:0;*height:13px;*width:13px} |
|||
input[type="search"]{-webkit-appearance:textfield;-moz-box-sizing:content-box;-webkit-box-sizing:content-box;box-sizing:content-box} |
|||
input[type="search"]::-webkit-search-cancel-button,input[type="search"]::-webkit-search-decoration{-webkit-appearance:none} |
|||
button::-moz-focus-inner,input::-moz-focus-inner{border:0;padding:0} |
|||
textarea{overflow:auto;vertical-align:top} |
|||
table{border-collapse:collapse;border-spacing:0} |
|||
@ -0,0 +1,767 @@ |
|||
/* ========================================================================== |
|||
HTML5 Boilerplate styles - h5bp.com (generated via initializr.com) |
|||
========================================================================== */ |
|||
|
|||
html, |
|||
button, |
|||
input, |
|||
select, |
|||
textarea { |
|||
color: #222; |
|||
} |
|||
|
|||
body { |
|||
font-family: "メイリオ", Meiryo, "MS Pゴシック", "Hiragino Kaku Gothic Pro", Osaka, "ＭＳ Ｐゴシック", "MS P Gothic", sans-serif; |
|||
font-size: 1em; |
|||
line-height: 1.4; |
|||
background: url(../img/furley_bg02.png); |
|||
/*background: url(http://subtlepatterns.com/patterns/solid.png);*/ |
|||
|
|||
} |
|||
/*テキストを選択した時の色*/ |
|||
::-moz-selection { |
|||
background: #b3d4fc; |
|||
text-shadow: none; |
|||
} |
|||
|
|||
::selection { |
|||
background: #b3d4fc; |
|||
text-shadow: none; |
|||
} |
|||
|
|||
hr { |
|||
display: block; |
|||
margin: 1em 0; |
|||
padding: 0; |
|||
height: 1px; |
|||
border: 0; |
|||
border-top: 1px solid #ccc; |
|||
} |
|||
|
|||
img { |
|||
vertical-align: middle; |
|||
} |
|||
|
|||
fieldset { |
|||
margin: 0; |
|||
padding: 0; |
|||
border: 0; |
|||
} |
|||
|
|||
textarea { |
|||
resize: vertical; |
|||
} |
|||
|
|||
.chromeframe { |
|||
margin: 0.2em 0; |
|||
padding: 0.2em 0; |
|||
background: #ccc; |
|||
color: #000; |
|||
} |
|||
|
|||
|
|||
/* ========================================================================== |
|||
Author's custom styles |
|||
========================================================================== */ |
|||
|
|||
.w10{ width: 10%;} |
|||
.w20{ width: 20%;} |
|||
.w25{ width: 25%;} |
|||
.w30{ width: 30%;} |
|||
.w33{ width: 33%;} |
|||
.w40{ width: 40%;} |
|||
.w50{ width: 50%;} |
|||
.w60{ width: 60%;} |
|||
.w70{ width: 70%;} |
|||
.w80{ width: 80%;} |
|||
.w90{ width: 90%;} |
|||
.w100{ width: 100%;} |
|||
|
|||
|
|||
/* ========================================================================== |
|||
Helper classes |
|||
========================================================================== */ |
|||
|
|||
.ir { |
|||
overflow: hidden; |
|||
border: 0; |
|||
background-color: transparent; |
|||
*text-indent: -9999px; |
|||
} |
|||
|
|||
.ir:before { |
|||
display: block; |
|||
width: 0; |
|||
height: 100%; |
|||
content: ""; |
|||
} |
|||
|
|||
.visuallyhidden { |
|||
position: absolute; |
|||
overflow: hidden; |
|||
clip: rect(0 0 0 0); |
|||
margin: -1px; |
|||
padding: 0; |
|||
width: 1px; |
|||
height: 1px; |
|||
border: 0; |
|||
} |
|||
|
|||
.visuallyhidden.focusable:active, |
|||
.visuallyhidden.focusable:focus { |
|||
position: static; |
|||
overflow: visible; |
|||
clip: auto; |
|||
margin: 0; |
|||
width: auto; |
|||
height: auto; |
|||
} |
|||
|
|||
.invisible { |
|||
visibility: hidden; |
|||
} |
|||
|
|||
.clearfix:before, |
|||
.clearfix:after { |
|||
display: table; |
|||
content: " "; |
|||
} |
|||
|
|||
.clearfix:after { |
|||
clear: both; |
|||
} |
|||
|
|||
.clearfix { |
|||
*zoom: 1; |
|||
} |
|||
|
|||
/* ========================================================================== |
|||
Print styles |
|||
========================================================================== */ |
|||
|
|||
@media print { |
|||
* { |
|||
background: transparent !important; |
|||
box-shadow:none !important; |
|||
color: #000 !important; /* Black prints faster: h5bp.com/s */ |
|||
text-shadow: none !important; |
|||
} |
|||
|
|||
a, |
|||
a:visited { |
|||
text-decoration: underline; |
|||
} |
|||
|
|||
/*a[href]:after { |
|||
content: " (" attr(href) ")"; |
|||
} |
|||
|
|||
abbr[title]:after { |
|||
content: " (" attr(title) ")"; |
|||
}*/ |
|||
|
|||
/* |
|||
* Don't show links for images, or javascript/internal links |
|||
*/ |
|||
|
|||
/*.ir a:after, |
|||
a[href^="javascript:"]:after, |
|||
a[href^="#"]:after { |
|||
content: ""; |
|||
} |
|||
*/ |
|||
pre, |
|||
blockquote { |
|||
border: 1px solid #999; |
|||
page-break-inside: avoid; |
|||
} |
|||
|
|||
thead { |
|||
display: table-header-group; /* h5bp.com/t */ |
|||
} |
|||
|
|||
tr, |
|||
img { |
|||
page-break-inside: avoid; |
|||
} |
|||
|
|||
img { |
|||
max-width: 100% !important; |
|||
} |
|||
|
|||
@page { |
|||
margin: 0.5cm; |
|||
} |
|||
|
|||
p, |
|||
h2, |
|||
h3 { |
|||
orphans: 3; |
|||
widows: 3; |
|||
} |
|||
|
|||
h2, |
|||
h3 { |
|||
page-break-after: avoid; |
|||
} |
|||
} |
|||
/*utility*/ |
|||
.txt_small{ |
|||
font-size: 85%; |
|||
} |
|||
|
|||
.txt_normal{ |
|||
font-size: 100%; |
|||
} |
|||
|
|||
.txt_large{ |
|||
font-size: 120%; |
|||
} |
|||
.txt_xlarge{ |
|||
font-size: 150%; |
|||
} |
|||
|
|||
.txt_r{ |
|||
text-align: right; |
|||
} |
|||
|
|||
.txt_l{ |
|||
text-align: left; |
|||
} |
|||
|
|||
.txt_c{ |
|||
text-align: center; |
|||
} |
|||
.txt_alert{ |
|||
color: #FF3300; |
|||
} |
|||
.line_150{ |
|||
line-height: 150%; |
|||
} |
|||
.line_180{ |
|||
line-height: 180%; |
|||
} |
|||
.line_200{ |
|||
line-height: 200%; |
|||
} |
|||
.line_250{ |
|||
line-height: 250%; |
|||
} |
|||
.flt{ |
|||
float: left; |
|||
} |
|||
.flr{ |
|||
float: right; |
|||
} |
|||
.mt10{ margin-top: 10px;} |
|||
.mb10{ margin-bottom: 10px;} |
|||
.ml10{ margin-left: 10px;} |
|||
.mr10{ margin-right: 10px;} |
|||
|
|||
.list_details.notice_text{ |
|||
font-size: 70%; |
|||
color:#666; |
|||
text-align: left; |
|||
} |
|||
|
|||
/*Book open btns toggle*/ |
|||
.flash_box{ |
|||
display: none; |
|||
} |
|||
.pc .flash_box{ |
|||
display: block; |
|||
} |
|||
|
|||
.pc .flashonly_notice{ |
|||
display: none; |
|||
} |
|||
|
|||
.html5_box{ |
|||
display: block; |
|||
} |
|||
|
|||
.appli_box{ |
|||
display: block; |
|||
} |
|||
|
|||
/*subtitles*/ |
|||
.book_title01{ |
|||
font-size: 100%; |
|||
border-bottom:solid 1px #ccc ; |
|||
font-weight: normal; |
|||
margin-bottom: 10px; |
|||
text-indent: 5px; |
|||
} |
|||
.book_title01 .small_title{ |
|||
font-size: 60%; |
|||
width: 100%; |
|||
display: block; |
|||
text-indent: 0px; |
|||
color: #666; |
|||
} |
|||
.book_title01 strong{ |
|||
max-height: 7em; |
|||
overflow: hidden; |
|||
display:block; |
|||
text-indent:0px; |
|||
word-wrap: break-word; |
|||
} |
|||
|
|||
|
|||
.copyright_box{ |
|||
font-size: 75%; |
|||
color: #666; |
|||
} |
|||
|
|||
.subtitle01{ |
|||
font-size: 160%; |
|||
line-height: 40px; |
|||
border-bottom:solid 1px #ccc ; |
|||
font-weight: normal; |
|||
margin-bottom:10px; |
|||
position: relative; |
|||
} |
|||
|
|||
.subtitle02{ |
|||
font-size: 120%; |
|||
line-height: 40px; |
|||
border-bottom:solid 1px #ccc ; |
|||
font-weight: normal; |
|||
margin-bottom: 10px; |
|||
} |
|||
.subtitle03{ |
|||
font-size: 100%; |
|||
line-height: 35px; |
|||
border-bottom:solid 1px #ccc ; |
|||
font-weight: normal; |
|||
margin-bottom: 10px; |
|||
} |
|||
.subtitle04{ |
|||
font-size: 100%; |
|||
line-height: 30px; |
|||
color: #666; |
|||
border-bottom:dashed 1px #ccc ; |
|||
font-weight: bold; |
|||
margin-bottom: 10px; |
|||
} |
|||
|
|||
|
|||
.subtitle{ |
|||
font-size: 60%; |
|||
color: #666; |
|||
margin-left: 25px; |
|||
} |
|||
|
|||
/*メインレイアウト*/ |
|||
.wrapper{ |
|||
float: left; |
|||
width: 100%; |
|||
text-align: center; |
|||
padding-top: 20px; |
|||
} |
|||
.container{ |
|||
position: relative; |
|||
width: 980px; |
|||
margin: 0px auto; |
|||
text-align: left; |
|||
border-top:solid #666666 5px; |
|||
background:url("../img/bg_grad01.png") repeat-x top #FCFCFC; |
|||
|
|||
-webkit-box-shadow: 0px 3px 5px rgba(0, 0, 0, .8); /* Saf3-4, iOS 4.0.2 - 4.2, Android 2.3+ */ |
|||
-moz-box-shadow: 0px 3px 5px rgba(0, 0, 0, .8); /* FF3.5 - 3.6 */ |
|||
box-shadow: 0px 3px 5px rgba(0, 0, 0, .8); /* Opera 10.5, IE9, FF4+, Chrome 6+, iOS 5 */ |
|||
} |
|||
|
|||
.header{ |
|||
float: left; |
|||
width: 100%; |
|||
} |
|||
|
|||
.contents{ |
|||
float: left; |
|||
width: 950px; |
|||
margin-top: 15px; |
|||
margin-left: 15px; |
|||
margin-bottom: 5px; |
|||
min-height: 600px; |
|||
} |
|||
.pagelist .contents{ |
|||
margin-top: 0px; |
|||
} |
|||
|
|||
/*IE6 only*/ |
|||
.lt-ie7 .contents{ |
|||
margin-left: 7px; |
|||
} |
|||
|
|||
.section01{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-bottom: 20px; |
|||
} |
|||
|
|||
/*list view*/ |
|||
.listview01{ |
|||
list-style-type: none; |
|||
} |
|||
.listview01 li{ |
|||
float: left; |
|||
width: 100%; |
|||
margin-bottom: 20px; |
|||
} |
|||
.list_thum01{ |
|||
float: left; |
|||
width: 160px; |
|||
margin-right: 10px; |
|||
line-height: 230px; |
|||
text-align: center; |
|||
} |
|||
|
|||
.list_thum02{ |
|||
float: left; |
|||
width: 150px; |
|||
margin-right: 10px; |
|||
} |
|||
.list_details{ |
|||
float: left; |
|||
width: 100%; |
|||
} |
|||
.list_details .btn_m{ |
|||
float: left; |
|||
width: 100%; |
|||
text-align: left; |
|||
} |
|||
|
|||
|
|||
.list_txt{ |
|||
float: right; |
|||
width: 240px; |
|||
margin-left: 130px; |
|||
padding: 10px 10px 0px 10px ; |
|||
min-height: 200px; |
|||
background:#E5E5E5; |
|||
-webkit-border-radius: 5px; /* Saf3-4, iOS 1-3.2, Android <e;1.6 */ |
|||
-moz-border-radius: 5px; /* FF1-3.6 */ |
|||
border-radius: 5px; /* Opera 10.5, IE9, Saf5, Chrome, FF4, iOS 4, Android 2.1+ */ |
|||
|
|||
/* useful if you don't want a bg color from leaking outside the border: */ |
|||
-moz-background-clip: padding; -webkit-background-clip: padding-box; background-clip: padding-box; |
|||
-webkit-box-shadow: 0px 0px 2px rgba(0, 0, 0, .5); /* Saf3-4, iOS 4.0.2 - 4.2, Android 2.3+ */ |
|||
-moz-box-shadow: 0px 0px 2px rgba(0, 0, 0, .5); /* FF3.5 - 3.6 */ |
|||
box-shadow: 0px 0px 2px rgba(0, 0, 0, .5); /* Opera 10.5, IE9, FF4+, Chrome 6+, iOS 5 */ |
|||
} |
|||
|
|||
.list_txt01 { |
|||
float: right; |
|||
width: 240px; |
|||
padding: 10px 10px 0px 10px ; |
|||
min-height: 200px; |
|||
position: relative; |
|||
-webkit-box-shadow: 0px 1px 3px rgba(0,0,0,.5); |
|||
-moz-box-shadow: 0px 1px 3px rgba(0,0,0,.5); |
|||
box-shadow: 0px 1px 3px rgba(0,0,0,.5); |
|||
padding: 10px; |
|||
/*background:url("http://subtlepatterns.com/patterns/tiny_grid.png") #FCFCFC;*/ |
|||
background:#DDDDDD; |
|||
position:relative; |
|||
border:1px solid #fff; |
|||
} |
|||
|
|||
|
|||
.list_txt01 .inner{ |
|||
min-height: 120px; |
|||
} |
|||
|
|||
|
|||
.list_txt02{ |
|||
float: right; |
|||
width: 530px; |
|||
} |
|||
.side_contents01{ |
|||
float: left; |
|||
width: 230px; |
|||
} |
|||
.list_details{ |
|||
font-size: 80%; |
|||
text-align: center; |
|||
} |
|||
|
|||
.list_details .btn01{ |
|||
float: left; |
|||
width: 48%; |
|||
} |
|||
.list_details .btn02{ |
|||
float: right; |
|||
width: 48%; |
|||
} |
|||
.list_details .btn03{ |
|||
float: left; |
|||
width: 100%; |
|||
} |
|||
.list_txt01 .category_list01{ |
|||
min-height: 100px; |
|||
} |
|||
.category_list01{ |
|||
width:100%; |
|||
float: left; |
|||
} |
|||
.category_list01 a{ |
|||
margin: 0px 5px; |
|||
} |
|||
.category_list01 dt{ |
|||
clear: both; |
|||
color: #555; |
|||
float: left; |
|||
font-size: 90%; |
|||
margin-bottom: 15px; |
|||
width: 28%; |
|||
font-weight: bold; |
|||
/*text-shadow: 1px 1px 2px rgba(0, 0, 0, .5); /* FF3.5+, Opera 9+, Saf1+, Chrome, IE10 */*/ |
|||
} |
|||
.category_list01 dd{ |
|||
float: left; |
|||
margin:0px 0px 15px 10px; |
|||
width: 65%; |
|||
} |
|||
.list_detail{ |
|||
clear: both; |
|||
} |
|||
|
|||
.main_contents{ |
|||
float: left; |
|||
width: 100%; |
|||
} |
|||
|
|||
.footer{ |
|||
clear: both; |
|||
float: left; |
|||
width: 100%; |
|||
background: #efefef; |
|||
} |
|||
|
|||
.footer_inner{ |
|||
border-top:solid 1px #ccc; |
|||
clear: both; |
|||
padding: 10px 0px 10px; |
|||
font-size: 12px; |
|||
} |
|||
.footer_inner nav{ |
|||
float: left; |
|||
width: 400px; |
|||
margin: 10px; |
|||
display: inline; |
|||
} |
|||
.footer_inner .copyright{ |
|||
float: right; |
|||
text-align: right; |
|||
width: 400px; |
|||
margin: 10px; |
|||
display: inline; |
|||
} |
|||
|
|||
|
|||
/*resposible*/ |
|||
.breadcrumbs{ |
|||
font-size: 80%; |
|||
margin: 9px 0px; |
|||
} |
|||
.book_detail{ |
|||
float: left; |
|||
margin-bottom: 15px; |
|||
margin-top: 20px; |
|||
width: 100%; |
|||
} |
|||
.pagelist .book_detail{ |
|||
margin-top: 0px; |
|||
|
|||
} |
|||
|
|||
p.photobox01{ |
|||
margin: 0px; |
|||
} |
|||
|
|||
p.photobox01 img{ |
|||
border: solid 1px #ccc; |
|||
} |
|||
|
|||
.app_download_box{ |
|||
background:url("../img/bg_grad01.png") repeat-x top #fff; |
|||
clear: both; |
|||
border: solid 1px #ccc; |
|||
padding: 10px; |
|||
margin-top: 10px; |
|||
border-radius: 5px; |
|||
position: relative; |
|||
} |
|||
.app_title{ |
|||
float: left; |
|||
font-size: 80%; |
|||
line-height: 40px; |
|||
margin-right: 10px; |
|||
width: 280px; |
|||
} |
|||
.app_title img{ |
|||
width:40px; |
|||
height:40px; |
|||
padding-right: 5px; |
|||
} |
|||
|
|||
.ban_holder01{ |
|||
list-style: none; |
|||
float: left; |
|||
width: 630px; |
|||
} |
|||
.ban_holder01 li{ |
|||
list-style: none; |
|||
display: inline-block; |
|||
} |
|||
.lt-ie8 .ban_holder01 li{ |
|||
float: left; |
|||
width: 25%; |
|||
text-align: center; |
|||
} |
|||
.ban_holder01 li img{ |
|||
max-width: 100%; |
|||
height: 40px; |
|||
} |
|||
|
|||
.detail_text01{ |
|||
padding: 10px; |
|||
clear:both; |
|||
background:url("../img/bg_grad01.png") repeat-x top #fff; |
|||
border-radius: 5px; |
|||
/* useful if you don't want a bg color from leaking outside the border: */ |
|||
position: relative; |
|||
border: solid 1px #ccc; |
|||
} |
|||
|
|||
.book_data{ |
|||
float: left; |
|||
width: 100%; |
|||
font-size: 80%; |
|||
color: #888; |
|||
} |
|||
.book_data dl{ |
|||
float: left; |
|||
} |
|||
.book_data dt{ |
|||
float: left; |
|||
margin-right: 20px; |
|||
} |
|||
.book_data dd{ |
|||
float: left; |
|||
margin-right: 20px; |
|||
} |
|||
|
|||
|
|||
.operating_env{ |
|||
font-size: 85%; |
|||
height: 250px; |
|||
overflow-x: hidden; |
|||
overflow-y: scroll; |
|||
padding-right: 12px; |
|||
} |
|||
.operating_env dl{ |
|||
margin-left: 10px; |
|||
color: #777; |
|||
} |
|||
.operating_env dt{ |
|||
color: #555; |
|||
} |
|||
|
|||
|
|||
.title_box01{ |
|||
left: 50%; |
|||
margin-left: -305px; |
|||
position: absolute; |
|||
top: 45px; |
|||
width: 505px; |
|||
} |
|||
|
|||
.operating_env_wrap{ |
|||
float: left; |
|||
width: 48%; |
|||
} |
|||
.copyright_box_wrap{ |
|||
float: right; |
|||
width: 48%; |
|||
} |
|||
|
|||
/*pagelist*/ |
|||
|
|||
a.current { |
|||
font-weight: bold; |
|||
text-decoration: underline; |
|||
} |
|||
|
|||
.pagelist_wrap{ |
|||
float: left; |
|||
width: 100% ; |
|||
margin-bottom: 20px; |
|||
} |
|||
.listbox01_left { |
|||
float: left; |
|||
height: auto !important; |
|||
list-style-type: none; |
|||
min-height: 160px; |
|||
padding-bottom: 10px; |
|||
width: 100%; |
|||
margin-top: 20px; |
|||
} |
|||
.listbox01_left li { |
|||
float: left; |
|||
list-style-type: none; |
|||
padding-bottom: 35px; |
|||
text-align: center; |
|||
width: 12.5%; |
|||
} |
|||
.listbox01_left li img, .listbox01_right li img { |
|||
border: 1px solid #CCCCCC; |
|||
max-width: 97px; |
|||
} |
|||
|
|||
|
|||
.listbox01_right { |
|||
float: left; |
|||
height: auto !important; |
|||
list-style-type: none; |
|||
min-height: 250px; |
|||
padding-bottom: 10px; |
|||
width: 100%; |
|||
margin-top: 20px; |
|||
} |
|||
.listbox01_right li { |
|||
float: right; |
|||
list-style-type: none; |
|||
padding-bottom: 35px; |
|||
text-align: center; |
|||
width: 12.5%; |
|||
} |
|||
|
|||
.list_pager { |
|||
list-style: none outside none; |
|||
text-align: center; |
|||
} |
|||
.list_pager li { |
|||
display: inline; |
|||
margin-right: 0.5em; |
|||
} |
|||
.pagelist_link{ |
|||
clear: both; |
|||
float: left; |
|||
font-size: 80%; |
|||
margin-top: 5px; |
|||
text-align: right; |
|||
width: 100%; |
|||
} |
|||
.small_txt{ |
|||
font-size: 80%; |
|||
} |
|||
|
|||
/*lt IE 9 only*/ |
|||
.lt-ie9 .container.localonly{ |
|||
border-left: solid 1px #ccc; |
|||
border-right: solid 1px #ccc; |
|||
border-bottom: solid 1px #ccc; |
|||
|
|||
} |
|||
@ -0,0 +1,88 @@ |
|||
/* |
|||
PIE: CSS3 rendering for IE |
|||
Version 1.0.0 |
|||
http://css3pie.com
|
|||
Dual-licensed for use under the Apache License Version 2.0 or the General Public License (GPL) Version 2. |
|||
*/ |
|||
(function(){ |
|||
var doc = document;var f=window.PIE; |
|||
if(!f){f=window.PIE={F:"-pie-",nb:"Pie",La:"pie_",Ac:{TD:1,TH:1},cc:{TABLE:1,THEAD:1,TBODY:1,TFOOT:1,TR:1,INPUT:1,TEXTAREA:1,SELECT:1,OPTION:1,IMG:1,HR:1},fc:{A:1,INPUT:1,TEXTAREA:1,SELECT:1,BUTTON:1},Gd:{submit:1,button:1,reset:1},aa:function(){}};try{doc.execCommand("BackgroundImageCache",false,true)}catch(aa){}for(var ba=4,Z=doc.createElement("div"),ca=Z.getElementsByTagName("i"),ga;Z.innerHTML="<!--[if gt IE "+ ++ba+"]><i></i><![endif]--\>",ca[0];);f.O=ba;if(ba===6)f.F=f.F.replace(/^-/,"");f.ja= |
|||
doc.documentMode||f.O;Z.innerHTML='<v:shape adj="1"/>';ga=Z.firstChild;ga.style.behavior="url(#default#VML)";f.zc=typeof ga.adj==="object";(function(){var a,b=0,c={};f.p={Za:function(d){if(!a){a=doc.createDocumentFragment();a.namespaces.add("css3vml","urn:schemas-microsoft-com:vml")}return a.createElement("css3vml:"+d)},Ba:function(d){return d&&d._pieId||(d._pieId="_"+ ++b)},Eb:function(d){var e,g,j,i,h=arguments;e=1;for(g=h.length;e<g;e++){i=h[e];for(j in i)if(i.hasOwnProperty(j))d[j]=i[j]}return d}, |
|||
Rb:function(d,e,g){var j=c[d],i,h;if(j)Object.prototype.toString.call(j)==="[object Array]"?j.push([e,g]):e.call(g,j);else{h=c[d]=[[e,g]];i=new Image;i.onload=function(){j=c[d]={h:i.width,f:i.height};for(var k=0,n=h.length;k<n;k++)h[k][0].call(h[k][1],j);i.onload=null};i.src=d}}}})();f.Na={gc:function(a,b,c,d){function e(){k=j>=90&&j<270?b:0;n=j<180?c:0;m=b-k;p=c-n}function g(){for(;j<0;)j+=360;j%=360}var j=d.sa;d=d.zb;var i,h,k,n,m,p,r,t;if(d){d=d.coords(a,b,c);i=d.x;h=d.y}if(j){j=j.jd();g();e(); |
|||
if(!d){i=k;h=n}d=f.Na.tc(i,h,j,m,p);a=d[0];d=d[1]}else if(d){a=b-i;d=c-h}else{i=h=a=0;d=c}r=a-i;t=d-h;if(j===void 0){j=!r?t<0?90:270:!t?r<0?180:0:-Math.atan2(t,r)/Math.PI*180;g();e()}return{sa:j,xc:i,yc:h,td:a,ud:d,Wd:k,Xd:n,rd:m,sd:p,kd:r,ld:t,rc:f.Na.dc(i,h,a,d)}},tc:function(a,b,c,d,e){if(c===0||c===180)return[d,b];else if(c===90||c===270)return[a,e];else{c=Math.tan(-c*Math.PI/180);a=c*a-b;b=-1/c;d=b*d-e;e=b-c;return[(d-a)/e,(c*d-b*a)/e]}},dc:function(a,b,c,d){a=c-a;b=d-b;return Math.abs(a===0? |
|||
b:b===0?a:Math.sqrt(a*a+b*b))}};f.ea=function(){this.Gb=[];this.oc={}};f.ea.prototype={ba:function(a){var b=f.p.Ba(a),c=this.oc,d=this.Gb;if(!(b in c)){c[b]=d.length;d.push(a)}},Ha:function(a){a=f.p.Ba(a);var b=this.oc;if(a&&a in b){delete this.Gb[b[a]];delete b[a]}},xa:function(){for(var a=this.Gb,b=a.length;b--;)a[b]&&a[b]()}};f.Oa=new f.ea;f.Oa.Rd=function(){var a=this,b;if(!a.Sd){b=doc.documentElement.currentStyle.getAttribute(f.F+"poll-interval")||250;(function c(){a.xa();setTimeout(c,b)})(); |
|||
a.Sd=1}};(function(){function a(){f.L.xa();window.detachEvent("onunload",a);window.PIE=null}f.L=new f.ea;window.attachEvent("onunload",a);f.L.ta=function(b,c,d){b.attachEvent(c,d);this.ba(function(){b.detachEvent(c,d)})}})();f.Qa=new f.ea;f.L.ta(window,"onresize",function(){f.Qa.xa()});(function(){function a(){f.mb.xa()}f.mb=new f.ea;f.L.ta(window,"onscroll",a);f.Qa.ba(a)})();(function(){function a(){c=f.kb.md()}function b(){if(c){for(var d=0,e=c.length;d<e;d++)f.attach(c[d]);c=0}}var c;if(f.ja<9){f.L.ta(window, |
|||
"onbeforeprint",a);f.L.ta(window,"onafterprint",b)}})();f.lb=new f.ea;f.L.ta(doc,"onmouseup",function(){f.lb.xa()});f.he=function(){function a(h){this.Y=h}var b=doc.createElement("length-calc"),c=doc.body||doc.documentElement,d=b.style,e={},g=["mm","cm","in","pt","pc"],j=g.length,i={};d.position="absolute";d.top=d.left="-9999px";for(c.appendChild(b);j--;){d.width="100"+g[j];e[g[j]]=b.offsetWidth/100}c.removeChild(b);d.width="1em";a.prototype={Kb:/(px|em|ex|mm|cm|in|pt|pc|%)$/,ic:function(){var h= |
|||
this.Jd;if(h===void 0)h=this.Jd=parseFloat(this.Y);return h},yb:function(){var h=this.ae;if(!h)h=this.ae=(h=this.Y.match(this.Kb))&&h[0]||"px";return h},a:function(h,k){var n=this.ic(),m=this.yb();switch(m){case "px":return n;case "%":return n*(typeof k==="function"?k():k)/100;case "em":return n*this.xb(h);case "ex":return n*this.xb(h)/2;default:return n*e[m]}},xb:function(h){var k=h.currentStyle.fontSize,n,m;if(k.indexOf("px")>0)return parseFloat(k);else if(h.tagName in f.cc){m=this;n=h.parentNode; |
|||
return f.n(k).a(n,function(){return m.xb(n)})}else{h.appendChild(b);k=b.offsetWidth;b.parentNode===h&&h.removeChild(b);return k}}};f.n=function(h){return i[h]||(i[h]=new a(h))};return a}();f.Ja=function(){function a(e){this.X=e}var b=f.n("50%"),c={top:1,center:1,bottom:1},d={left:1,center:1,right:1};a.prototype={zd:function(){if(!this.ac){var e=this.X,g=e.length,j=f.v,i=j.qa,h=f.n("0");i=i.na;h=["left",h,"top",h];if(g===1){e.push(new j.ob(i,"center"));g++}if(g===2){i&(e[0].k|e[1].k)&&e[0].d in c&& |
|||
e[1].d in d&&e.push(e.shift());if(e[0].k&i)if(e[0].d==="center")h[1]=b;else h[0]=e[0].d;else if(e[0].W())h[1]=f.n(e[0].d);if(e[1].k&i)if(e[1].d==="center")h[3]=b;else h[2]=e[1].d;else if(e[1].W())h[3]=f.n(e[1].d)}this.ac=h}return this.ac},coords:function(e,g,j){var i=this.zd(),h=i[1].a(e,g);e=i[3].a(e,j);return{x:i[0]==="right"?g-h:h,y:i[2]==="bottom"?j-e:e}}};return a}();f.Ka=function(){function a(b,c){this.h=b;this.f=c}a.prototype={a:function(b,c,d,e,g){var j=this.h,i=this.f,h=c/d;e=e/g;if(j=== |
|||
"contain"){j=e>h?c:d*e;i=e>h?c/e:d}else if(j==="cover"){j=e<h?c:d*e;i=e<h?c/e:d}else if(j==="auto"){i=i==="auto"?g:i.a(b,d);j=i*e}else{j=j.a(b,c);i=i==="auto"?j/e:i.a(b,d)}return{h:j,f:i}}};a.Kc=new a("auto","auto");return a}();f.Ec=function(){function a(b){this.Y=b}a.prototype={Kb:/[a-z]+$/i,yb:function(){return this.ad||(this.ad=this.Y.match(this.Kb)[0].toLowerCase())},jd:function(){var b=this.Vc,c;if(b===undefined){b=this.yb();c=parseFloat(this.Y,10);b=this.Vc=b==="deg"?c:b==="rad"?c/Math.PI*180: |
|||
b==="grad"?c/400*360:b==="turn"?c*360:0}return b}};return a}();f.Jc=function(){function a(c){this.Y=c}var b={};a.Qd=/\s*rgba\(\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d{1,3})\s*,\s*(\d+|\d*\.\d+)\s*\)\s*/;a.Fb={aliceblue:"F0F8FF",antiquewhite:"FAEBD7",aqua:"0FF",aquamarine:"7FFFD4",azure:"F0FFFF",beige:"F5F5DC",bisque:"FFE4C4",black:"000",blanchedalmond:"FFEBCD",blue:"00F",blueviolet:"8A2BE2",brown:"A52A2A",burlywood:"DEB887",cadetblue:"5F9EA0",chartreuse:"7FFF00",chocolate:"D2691E",coral:"FF7F50",cornflowerblue:"6495ED", |
|||
cornsilk:"FFF8DC",crimson:"DC143C",cyan:"0FF",darkblue:"00008B",darkcyan:"008B8B",darkgoldenrod:"B8860B",darkgray:"A9A9A9",darkgreen:"006400",darkkhaki:"BDB76B",darkmagenta:"8B008B",darkolivegreen:"556B2F",darkorange:"FF8C00",darkorchid:"9932CC",darkred:"8B0000",darksalmon:"E9967A",darkseagreen:"8FBC8F",darkslateblue:"483D8B",darkslategray:"2F4F4F",darkturquoise:"00CED1",darkviolet:"9400D3",deeppink:"FF1493",deepskyblue:"00BFFF",dimgray:"696969",dodgerblue:"1E90FF",firebrick:"B22222",floralwhite:"FFFAF0", |
|||
forestgreen:"228B22",fuchsia:"F0F",gainsboro:"DCDCDC",ghostwhite:"F8F8FF",gold:"FFD700",goldenrod:"DAA520",gray:"808080",green:"008000",greenyellow:"ADFF2F",honeydew:"F0FFF0",hotpink:"FF69B4",indianred:"CD5C5C",indigo:"4B0082",ivory:"FFFFF0",khaki:"F0E68C",lavender:"E6E6FA",lavenderblush:"FFF0F5",lawngreen:"7CFC00",lemonchiffon:"FFFACD",lightblue:"ADD8E6",lightcoral:"F08080",lightcyan:"E0FFFF",lightgoldenrodyellow:"FAFAD2",lightgreen:"90EE90",lightgrey:"D3D3D3",lightpink:"FFB6C1",lightsalmon:"FFA07A", |
|||
lightseagreen:"20B2AA",lightskyblue:"87CEFA",lightslategray:"789",lightsteelblue:"B0C4DE",lightyellow:"FFFFE0",lime:"0F0",limegreen:"32CD32",linen:"FAF0E6",magenta:"F0F",maroon:"800000",mediumauqamarine:"66CDAA",mediumblue:"0000CD",mediumorchid:"BA55D3",mediumpurple:"9370D8",mediumseagreen:"3CB371",mediumslateblue:"7B68EE",mediumspringgreen:"00FA9A",mediumturquoise:"48D1CC",mediumvioletred:"C71585",midnightblue:"191970",mintcream:"F5FFFA",mistyrose:"FFE4E1",moccasin:"FFE4B5",navajowhite:"FFDEAD", |
|||
navy:"000080",oldlace:"FDF5E6",olive:"808000",olivedrab:"688E23",orange:"FFA500",orangered:"FF4500",orchid:"DA70D6",palegoldenrod:"EEE8AA",palegreen:"98FB98",paleturquoise:"AFEEEE",palevioletred:"D87093",papayawhip:"FFEFD5",peachpuff:"FFDAB9",peru:"CD853F",pink:"FFC0CB",plum:"DDA0DD",powderblue:"B0E0E6",purple:"800080",red:"F00",rosybrown:"BC8F8F",royalblue:"4169E1",saddlebrown:"8B4513",salmon:"FA8072",sandybrown:"F4A460",seagreen:"2E8B57",seashell:"FFF5EE",sienna:"A0522D",silver:"C0C0C0",skyblue:"87CEEB", |
|||
slateblue:"6A5ACD",slategray:"708090",snow:"FFFAFA",springgreen:"00FF7F",steelblue:"4682B4",tan:"D2B48C",teal:"008080",thistle:"D8BFD8",tomato:"FF6347",turquoise:"40E0D0",violet:"EE82EE",wheat:"F5DEB3",white:"FFF",whitesmoke:"F5F5F5",yellow:"FF0",yellowgreen:"9ACD32"};a.prototype={parse:function(){if(!this.Ua){var c=this.Y,d;if(d=c.match(a.Qd)){this.Ua="rgb("+d[1]+","+d[2]+","+d[3]+")";this.Yb=parseFloat(d[4])}else{if((d=c.toLowerCase())in a.Fb)c="#"+a.Fb[d];this.Ua=c;this.Yb=c==="transparent"?0: |
|||
1}}},U:function(c){this.parse();return this.Ua==="currentColor"?c.currentStyle.color:this.Ua},fa:function(){this.parse();return this.Yb}};f.ha=function(c){return b[c]||(b[c]=new a(c))};return a}();f.v=function(){function a(c){this.$a=c;this.ch=0;this.X=[];this.Ga=0}var b=a.qa={Ia:1,Wb:2,z:4,Lc:8,Xb:16,na:32,K:64,oa:128,pa:256,Ra:512,Tc:1024,URL:2048};a.ob=function(c,d){this.k=c;this.d=d};a.ob.prototype={Ca:function(){return this.k&b.K||this.k&b.oa&&this.d==="0"},W:function(){return this.Ca()||this.k& |
|||
b.Ra}};a.prototype={de:/\s/,Kd:/^[\+\-]?(\d*\.)?\d+/,url:/^url\(\s*("([^"]*)"|'([^']*)'|([!#$%&*-~]*))\s*\)/i,nc:/^\-?[_a-z][\w-]*/i,Yd:/^("([^"]*)"|'([^']*)')/,Bd:/^#([\da-f]{6}|[\da-f]{3})/i,be:{px:b.K,em:b.K,ex:b.K,mm:b.K,cm:b.K,"in":b.K,pt:b.K,pc:b.K,deg:b.Ia,rad:b.Ia,grad:b.Ia},fd:{rgb:1,rgba:1,hsl:1,hsla:1},next:function(c){function d(p,r){p=new a.ob(p,r);if(!c){k.X.push(p);k.Ga++}return p}function e(){k.Ga++;return null}var g,j,i,h,k=this;if(this.Ga<this.X.length)return this.X[this.Ga++];for(;this.de.test(this.$a.charAt(this.ch));)this.ch++; |
|||
if(this.ch>=this.$a.length)return e();j=this.ch;g=this.$a.substring(this.ch);i=g.charAt(0);switch(i){case "#":if(h=g.match(this.Bd)){this.ch+=h[0].length;return d(b.z,h[0])}break;case '"':case "'":if(h=g.match(this.Yd)){this.ch+=h[0].length;return d(b.Tc,h[2]||h[3]||"")}break;case "/":case ",":this.ch++;return d(b.pa,i);case "u":if(h=g.match(this.url)){this.ch+=h[0].length;return d(b.URL,h[2]||h[3]||h[4]||"")}}if(h=g.match(this.Kd)){i=h[0];this.ch+=i.length;if(g.charAt(i.length)==="%"){this.ch++; |
|||
return d(b.Ra,i+"%")}if(h=g.substring(i.length).match(this.nc)){i+=h[0];this.ch+=h[0].length;return d(this.be[h[0].toLowerCase()]||b.Lc,i)}return d(b.oa,i)}if(h=g.match(this.nc)){i=h[0];this.ch+=i.length;if(i.toLowerCase()in f.Jc.Fb||i==="currentColor"||i==="transparent")return d(b.z,i);if(g.charAt(i.length)==="("){this.ch++;if(i.toLowerCase()in this.fd){g=function(p){return p&&p.k&b.oa};h=function(p){return p&&p.k&(b.oa|b.Ra)};var n=function(p,r){return p&&p.d===r},m=function(){return k.next(1)}; |
|||
if((i.charAt(0)==="r"?h(m()):g(m()))&&n(m(),",")&&h(m())&&n(m(),",")&&h(m())&&(i==="rgb"||i==="hsa"||n(m(),",")&&g(m()))&&n(m(),")"))return d(b.z,this.$a.substring(j,this.ch));return e()}return d(b.Xb,i)}return d(b.na,i)}this.ch++;return d(b.Wb,i)},D:function(){return this.X[this.Ga-- -2]},all:function(){for(;this.next(););return this.X},ma:function(c,d){for(var e=[],g,j;g=this.next();){if(c(g)){j=true;this.D();break}e.push(g)}return d&&!j?null:e}};return a}();var ha=function(a){this.e=a};ha.prototype= |
|||
{Z:0,Od:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.x!==b.x||a.y!==b.y)},Td:function(){var a=this.qb,b;return!a||(b=this.o())&&(a.h!==b.h||a.f!==b.f)},hc:function(){var a=this.e,b=a.getBoundingClientRect(),c=f.ja===9,d=f.O===7,e=b.right-b.left;return{x:b.left,y:b.top,h:c||d?a.offsetWidth:e,f:c||d?a.offsetHeight:b.bottom-b.top,Hd:d&&e?a.offsetWidth/e:1}},o:function(){return this.Z?this.Va||(this.Va=this.hc()):this.hc()},Ad:function(){return!!this.qb},cb:function(){++this.Z},hb:function(){if(!--this.Z){if(this.Va)this.qb= |
|||
this.Va;this.Va=null}}};(function(){function a(b){var c=f.p.Ba(b);return function(){if(this.Z){var d=this.$b||(this.$b={});return c in d?d[c]:(d[c]=b.call(this))}else return b.call(this)}}f.B={Z:0,ka:function(b){function c(d){this.e=d;this.Zb=this.ia()}f.p.Eb(c.prototype,f.B,b);c.$c={};return c},j:function(){var b=this.ia(),c=this.constructor.$c;return b?b in c?c[b]:(c[b]=this.la(b)):null},ia:a(function(){var b=this.e,c=this.constructor,d=b.style;b=b.currentStyle;var e=this.wa,g=this.Fa,j=c.Yc||(c.Yc= |
|||
f.F+e);c=c.Zc||(c.Zc=f.nb+g.charAt(0).toUpperCase()+g.substring(1));return d[c]||b.getAttribute(j)||d[g]||b.getAttribute(e)}),i:a(function(){return!!this.j()}),H:a(function(){var b=this.ia(),c=b!==this.Zb;this.Zb=b;return c}),va:a,cb:function(){++this.Z},hb:function(){--this.Z||delete this.$b}}})();f.Sb=f.B.ka({wa:f.F+"background",Fa:f.nb+"Background",cd:{scroll:1,fixed:1,local:1},fb:{"repeat-x":1,"repeat-y":1,repeat:1,"no-repeat":1},sc:{"padding-box":1,"border-box":1,"content-box":1},Pd:{top:1,right:1, |
|||
bottom:1,left:1,center:1},Ud:{contain:1,cover:1},eb:{Ma:"backgroundClip",z:"backgroundColor",da:"backgroundImage",Pa:"backgroundOrigin",S:"backgroundPosition",T:"backgroundRepeat",Sa:"backgroundSize"},la:function(a){function b(s){return s&&s.W()||s.k&k&&s.d in t}function c(s){return s&&(s.W()&&f.n(s.d)||s.d==="auto"&&"auto")}var d=this.e.currentStyle,e,g,j,i=f.v.qa,h=i.pa,k=i.na,n=i.z,m,p,r=0,t=this.Pd,v,l,q={M:[]};if(this.wb()){e=new f.v(a);for(j={};g=e.next();){m=g.k;p=g.d;if(!j.P&&m&i.Xb&&p=== |
|||
"linear-gradient"){v={ca:[],P:p};for(l={};g=e.next();){m=g.k;p=g.d;if(m&i.Wb&&p===")"){l.color&&v.ca.push(l);v.ca.length>1&&f.p.Eb(j,v);break}if(m&n){if(v.sa||v.zb){g=e.D();if(g.k!==h)break;e.next()}l={color:f.ha(p)};g=e.next();if(g.W())l.db=f.n(g.d);else e.D()}else if(m&i.Ia&&!v.sa&&!l.color&&!v.ca.length)v.sa=new f.Ec(g.d);else if(b(g)&&!v.zb&&!l.color&&!v.ca.length){e.D();v.zb=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&h&&p===","){if(l.color){v.ca.push(l);l={}}}else break}}else if(!j.P&& |
|||
m&i.URL){j.Ab=p;j.P="image"}else if(b(g)&&!j.$){e.D();j.$=new f.Ja(e.ma(function(s){return!b(s)},false))}else if(m&k)if(p in this.fb&&!j.bb)j.bb=p;else if(p in this.sc&&!j.Wa){j.Wa=p;if((g=e.next())&&g.k&k&&g.d in this.sc)j.ub=g.d;else{j.ub=p;e.D()}}else if(p in this.cd&&!j.bc)j.bc=p;else return null;else if(m&n&&!q.color)q.color=f.ha(p);else if(m&h&&p==="/"&&!j.Xa&&j.$){g=e.next();if(g.k&k&&g.d in this.Ud)j.Xa=new f.Ka(g.d);else if(g=c(g)){m=c(e.next());if(!m){m=g;e.D()}j.Xa=new f.Ka(g,m)}else return null}else if(m& |
|||
h&&p===","&&j.P){j.Hb=a.substring(r,e.ch-1);r=e.ch;q.M.push(j);j={}}else return null}if(j.P){j.Hb=a.substring(r);q.M.push(j)}}else this.Bc(f.ja<9?function(){var s=this.eb,o=d[s.S+"X"],u=d[s.S+"Y"],x=d[s.da],y=d[s.z];if(y!=="transparent")q.color=f.ha(y);if(x!=="none")q.M=[{P:"image",Ab:(new f.v(x)).next().d,bb:d[s.T],$:new f.Ja((new f.v(o+" "+u)).all())}]}:function(){var s=this.eb,o=/\s*,\s*/,u=d[s.da].split(o),x=d[s.z],y,z,B,E,D,C;if(x!=="transparent")q.color=f.ha(x);if((E=u.length)&&u[0]!=="none"){x= |
|||
d[s.T].split(o);y=d[s.S].split(o);z=d[s.Pa].split(o);B=d[s.Ma].split(o);s=d[s.Sa].split(o);q.M=[];for(o=0;o<E;o++)if((D=u[o])&&D!=="none"){C=s[o].split(" ");q.M.push({Hb:D+" "+x[o]+" "+y[o]+" / "+s[o]+" "+z[o]+" "+B[o],P:"image",Ab:(new f.v(D)).next().d,bb:x[o],$:new f.Ja((new f.v(y[o])).all()),Wa:z[o],ub:B[o],Xa:new f.Ka(C[0],C[1])})}}});return q.color||q.M[0]?q:null},Bc:function(a){var b=f.ja>8,c=this.eb,d=this.e.runtimeStyle,e=d[c.da],g=d[c.z],j=d[c.T],i,h,k,n;if(e)d[c.da]="";if(g)d[c.z]="";if(j)d[c.T]= |
|||
"";if(b){i=d[c.Ma];h=d[c.Pa];n=d[c.S];k=d[c.Sa];if(i)d[c.Ma]="";if(h)d[c.Pa]="";if(n)d[c.S]="";if(k)d[c.Sa]=""}a=a.call(this);if(e)d[c.da]=e;if(g)d[c.z]=g;if(j)d[c.T]=j;if(b){if(i)d[c.Ma]=i;if(h)d[c.Pa]=h;if(n)d[c.S]=n;if(k)d[c.Sa]=k}return a},ia:f.B.va(function(){return this.wb()||this.Bc(function(){var a=this.e.currentStyle,b=this.eb;return a[b.z]+" "+a[b.da]+" "+a[b.T]+" "+a[b.S+"X"]+" "+a[b.S+"Y"]})}),wb:f.B.va(function(){var a=this.e;return a.style[this.Fa]||a.currentStyle.getAttribute(this.wa)}), |
|||
qc:function(){var a=0;if(f.O<7){a=this.e;a=""+(a.style[f.nb+"PngFix"]||a.currentStyle.getAttribute(f.F+"png-fix"))==="true"}return a},i:f.B.va(function(){return(this.wb()||this.qc())&&!!this.j()})});f.Vb=f.B.ka({wc:["Top","Right","Bottom","Left"],Id:{thin:"1px",medium:"3px",thick:"5px"},la:function(){var a={},b={},c={},d=false,e=true,g=true,j=true;this.Cc(function(){for(var i=this.e.currentStyle,h=0,k,n,m,p,r,t,v;h<4;h++){m=this.wc[h];v=m.charAt(0).toLowerCase();k=b[v]=i["border"+m+"Style"];n=i["border"+ |
|||
m+"Color"];m=i["border"+m+"Width"];if(h>0){if(k!==p)g=false;if(n!==r)e=false;if(m!==t)j=false}p=k;r=n;t=m;c[v]=f.ha(n);m=a[v]=f.n(b[v]==="none"?"0":this.Id[m]||m);if(m.a(this.e)>0)d=true}});return d?{J:a,Zd:b,gd:c,ee:j,hd:e,$d:g}:null},ia:f.B.va(function(){var a=this.e,b=a.currentStyle,c;a.tagName in f.Ac&&a.offsetParent.currentStyle.borderCollapse==="collapse"||this.Cc(function(){c=b.borderWidth+"|"+b.borderStyle+"|"+b.borderColor});return c}),Cc:function(a){var b=this.e.runtimeStyle,c=b.borderWidth, |
|||
d=b.borderColor;if(c)b.borderWidth="";if(d)b.borderColor="";a=a.call(this);if(c)b.borderWidth=c;if(d)b.borderColor=d;return a}});(function(){f.jb=f.B.ka({wa:"border-radius",Fa:"borderRadius",la:function(b){var c=null,d,e,g,j,i=false;if(b){e=new f.v(b);var h=function(){for(var k=[],n;(g=e.next())&&g.W();){j=f.n(g.d);n=j.ic();if(n<0)return null;if(n>0)i=true;k.push(j)}return k.length>0&&k.length<5?{tl:k[0],tr:k[1]||k[0],br:k[2]||k[0],bl:k[3]||k[1]||k[0]}:null};if(b=h()){if(g){if(g.k&f.v.qa.pa&&g.d=== |
|||
"/")d=h()}else d=b;if(i&&b&&d)c={x:b,y:d}}}return c}});var a=f.n("0");a={tl:a,tr:a,br:a,bl:a};f.jb.Dc={x:a,y:a}})();f.Ub=f.B.ka({wa:"border-image",Fa:"borderImage",fb:{stretch:1,round:1,repeat:1,space:1},la:function(a){var b=null,c,d,e,g,j,i,h=0,k=f.v.qa,n=k.na,m=k.oa,p=k.Ra;if(a){c=new f.v(a);b={};for(var r=function(l){return l&&l.k&k.pa&&l.d==="/"},t=function(l){return l&&l.k&n&&l.d==="fill"},v=function(){g=c.ma(function(l){return!(l.k&(m|p))});if(t(c.next())&&!b.fill)b.fill=true;else c.D();if(r(c.next())){h++; |
|||
j=c.ma(function(l){return!l.W()&&!(l.k&n&&l.d==="auto")});if(r(c.next())){h++;i=c.ma(function(l){return!l.Ca()})}}else c.D()};a=c.next();){d=a.k;e=a.d;if(d&(m|p)&&!g){c.D();v()}else if(t(a)&&!b.fill){b.fill=true;v()}else if(d&n&&this.fb[e]&&!b.repeat){b.repeat={f:e};if(a=c.next())if(a.k&n&&this.fb[a.d])b.repeat.Ob=a.d;else c.D()}else if(d&k.URL&&!b.src)b.src=e;else return null}if(!b.src||!g||g.length<1||g.length>4||j&&j.length>4||h===1&&j.length<1||i&&i.length>4||h===2&&i.length<1)return null;if(!b.repeat)b.repeat= |
|||
{f:"stretch"};if(!b.repeat.Ob)b.repeat.Ob=b.repeat.f;a=function(l,q){return{t:q(l[0]),r:q(l[1]||l[0]),b:q(l[2]||l[0]),l:q(l[3]||l[1]||l[0])}};b.slice=a(g,function(l){return f.n(l.k&m?l.d+"px":l.d)});if(j&&j[0])b.J=a(j,function(l){return l.W()?f.n(l.d):l.d});if(i&&i[0])b.Da=a(i,function(l){return l.Ca()?f.n(l.d):l.d})}return b}});f.Ic=f.B.ka({wa:"box-shadow",Fa:"boxShadow",la:function(a){var b,c=f.n,d=f.v.qa,e;if(a){e=new f.v(a);b={Da:[],Bb:[]};for(a=function(){for(var g,j,i,h,k,n;g=e.next();){i=g.d; |
|||
j=g.k;if(j&d.pa&&i===",")break;else if(g.Ca()&&!k){e.D();k=e.ma(function(m){return!m.Ca()})}else if(j&d.z&&!h)h=i;else if(j&d.na&&i==="inset"&&!n)n=true;else return false}g=k&&k.length;if(g>1&&g<5){(n?b.Bb:b.Da).push({fe:c(k[0].d),ge:c(k[1].d),blur:c(k[2]?k[2].d:"0"),Vd:c(k[3]?k[3].d:"0"),color:f.ha(h||"currentColor")});return true}return false};a(););}return b&&(b.Bb.length||b.Da.length)?b:null}});f.Uc=f.B.ka({ia:f.B.va(function(){var a=this.e.currentStyle;return a.visibility+"|"+a.display}),la:function(){var a= |
|||
this.e,b=a.runtimeStyle;a=a.currentStyle;var c=b.visibility,d;b.visibility="";d=a.visibility;b.visibility=c;return{ce:d!=="hidden",nd:a.display!=="none"}},i:function(){return false}});f.u={R:function(a){function b(c,d,e,g){this.e=c;this.s=d;this.g=e;this.parent=g}f.p.Eb(b.prototype,f.u,a);return b},Cb:false,Q:function(){return false},Ea:f.aa,Lb:function(){this.m();this.i()&&this.V()},ib:function(){this.Cb=true},Mb:function(){this.i()?this.V():this.m()},sb:function(a,b){this.vc(a);for(var c=this.ra|| |
|||
(this.ra=[]),d=a+1,e=c.length,g;d<e;d++)if(g=c[d])break;c[a]=b;this.I().insertBefore(b,g||null)},za:function(a){var b=this.ra;return b&&b[a]||null},vc:function(a){var b=this.za(a),c=this.Ta;if(b&&c){c.removeChild(b);this.ra[a]=null}},Aa:function(a,b,c,d){var e=this.rb||(this.rb={}),g=e[a];if(!g){g=e[a]=f.p.Za("shape");if(b)g.appendChild(g[b]=f.p.Za(b));if(d){c=this.za(d);if(!c){this.sb(d,doc.createElement("group"+d));c=this.za(d)}}c.appendChild(g);a=g.style;a.position="absolute";a.left=a.top=0;a.behavior= |
|||
"url(#default#VML)"}return g},vb:function(a){var b=this.rb,c=b&&b[a];if(c){c.parentNode.removeChild(c);delete b[a]}return!!c},kc:function(a){var b=this.e,c=this.s.o(),d=c.h,e=c.f,g,j,i,h,k,n;c=a.x.tl.a(b,d);g=a.y.tl.a(b,e);j=a.x.tr.a(b,d);i=a.y.tr.a(b,e);h=a.x.br.a(b,d);k=a.y.br.a(b,e);n=a.x.bl.a(b,d);a=a.y.bl.a(b,e);d=Math.min(d/(c+j),e/(i+k),d/(n+h),e/(g+a));if(d<1){c*=d;g*=d;j*=d;i*=d;h*=d;k*=d;n*=d;a*=d}return{x:{tl:c,tr:j,br:h,bl:n},y:{tl:g,tr:i,br:k,bl:a}}},ya:function(a,b,c){b=b||1;var d,e, |
|||
g=this.s.o();e=g.h*b;g=g.f*b;var j=this.g.G,i=Math.floor,h=Math.ceil,k=a?a.Jb*b:0,n=a?a.Ib*b:0,m=a?a.tb*b:0;a=a?a.Db*b:0;var p,r,t,v,l;if(c||j.i()){d=this.kc(c||j.j());c=d.x.tl*b;j=d.y.tl*b;p=d.x.tr*b;r=d.y.tr*b;t=d.x.br*b;v=d.y.br*b;l=d.x.bl*b;b=d.y.bl*b;e="m"+i(a)+","+i(j)+"qy"+i(c)+","+i(k)+"l"+h(e-p)+","+i(k)+"qx"+h(e-n)+","+i(r)+"l"+h(e-n)+","+h(g-v)+"qy"+h(e-t)+","+h(g-m)+"l"+i(l)+","+h(g-m)+"qx"+i(a)+","+h(g-b)+" x e"}else e="m"+i(a)+","+i(k)+"l"+h(e-n)+","+i(k)+"l"+h(e-n)+","+h(g-m)+"l"+i(a)+ |
|||
","+h(g-m)+"xe";return e},I:function(){var a=this.parent.za(this.N),b;if(!a){a=doc.createElement(this.Ya);b=a.style;b.position="absolute";b.top=b.left=0;this.parent.sb(this.N,a)}return a},mc:function(){var a=this.e,b=a.currentStyle,c=a.runtimeStyle,d=a.tagName,e=f.O===6,g;if(e&&(d in f.cc||d==="FIELDSET")||d==="BUTTON"||d==="INPUT"&&a.type in f.Gd){c.borderWidth="";d=this.g.w.wc;for(g=d.length;g--;){e=d[g];c["padding"+e]="";c["padding"+e]=f.n(b["padding"+e]).a(a)+f.n(b["border"+e+"Width"]).a(a)+(f.O!== |
|||
8&&g%2?1:0)}c.borderWidth=0}else if(e){if(a.childNodes.length!==1||a.firstChild.tagName!=="ie6-mask"){b=doc.createElement("ie6-mask");d=b.style;d.visibility="visible";for(d.zoom=1;d=a.firstChild;)b.appendChild(d);a.appendChild(b);c.visibility="hidden"}}else c.borderColor="transparent"},ie:function(){},m:function(){this.parent.vc(this.N);delete this.rb;delete this.ra}};f.Rc=f.u.R({i:function(){var a=this.ed;for(var b in a)if(a.hasOwnProperty(b)&&a[b].i())return true;return false},Q:function(){return this.g.Pb.H()}, |
|||
ib:function(){if(this.i()){var a=this.jc(),b=a,c;a=a.currentStyle;var d=a.position,e=this.I().style,g=0,j=0;j=this.s.o();var i=j.Hd;if(d==="fixed"&&f.O>6){g=j.x*i;j=j.y*i;b=d}else{do b=b.offsetParent;while(b&&b.currentStyle.position==="static");if(b){c=b.getBoundingClientRect();b=b.currentStyle;g=(j.x-c.left)*i-(parseFloat(b.borderLeftWidth)||0);j=(j.y-c.top)*i-(parseFloat(b.borderTopWidth)||0)}else{b=doc.documentElement;g=(j.x+b.scrollLeft-b.clientLeft)*i;j=(j.y+b.scrollTop-b.clientTop)*i}b="absolute"}e.position= |
|||
b;e.left=g;e.top=j;e.zIndex=d==="static"?-1:a.zIndex;this.Cb=true}},Mb:f.aa,Nb:function(){var a=this.g.Pb.j();this.I().style.display=a.ce&&a.nd?"":"none"},Lb:function(){this.i()?this.Nb():this.m()},jc:function(){var a=this.e;return a.tagName in f.Ac?a.offsetParent:a},I:function(){var a=this.Ta,b;if(!a){b=this.jc();a=this.Ta=doc.createElement("css3-container");a.style.direction="ltr";this.Nb();b.parentNode.insertBefore(a,b)}return a},ab:f.aa,m:function(){var a=this.Ta,b;if(a&&(b=a.parentNode))b.removeChild(a); |
|||
delete this.Ta;delete this.ra}});f.Fc=f.u.R({N:2,Ya:"background",Q:function(){var a=this.g;return a.C.H()||a.G.H()},i:function(){var a=this.g;return a.q.i()||a.G.i()||a.C.i()||a.ga.i()&&a.ga.j().Bb},V:function(){var a=this.s.o();if(a.h&&a.f){this.od();this.pd()}},od:function(){var a=this.g.C.j(),b=this.s.o(),c=this.e,d=a&&a.color,e,g;if(d&&d.fa()>0){this.lc();a=this.Aa("bgColor","fill",this.I(),1);e=b.h;b=b.f;a.stroked=false;a.coordsize=e*2+","+b*2;a.coordorigin="1,1";a.path=this.ya(null,2);g=a.style; |
|||
g.width=e;g.height=b;a.fill.color=d.U(c);c=d.fa();if(c<1)a.fill.opacity=c}else this.vb("bgColor")},pd:function(){var a=this.g.C.j(),b=this.s.o();a=a&&a.M;var c,d,e,g,j;if(a){this.lc();d=b.h;e=b.f;for(j=a.length;j--;){b=a[j];c=this.Aa("bgImage"+j,"fill",this.I(),2);c.stroked=false;c.fill.type="tile";c.fillcolor="none";c.coordsize=d*2+","+e*2;c.coordorigin="1,1";c.path=this.ya(0,2);g=c.style;g.width=d;g.height=e;if(b.P==="linear-gradient")this.bd(c,b);else{c.fill.src=b.Ab;this.Nd(c,j)}}}for(j=a?a.length: |
|||
0;this.vb("bgImage"+j++););},Nd:function(a,b){var c=this;f.p.Rb(a.fill.src,function(d){var e=c.e,g=c.s.o(),j=g.h;g=g.f;if(j&&g){var i=a.fill,h=c.g,k=h.w.j(),n=k&&k.J;k=n?n.t.a(e):0;var m=n?n.r.a(e):0,p=n?n.b.a(e):0;n=n?n.l.a(e):0;h=h.C.j().M[b];e=h.$?h.$.coords(e,j-d.h-n-m,g-d.f-k-p):{x:0,y:0};h=h.bb;p=m=0;var r=j+1,t=g+1,v=f.O===8?0:1;n=Math.round(e.x)+n+0.5;k=Math.round(e.y)+k+0.5;i.position=n/j+","+k/g;i.size.x=1;i.size=d.h+"px,"+d.f+"px";if(h&&h!=="repeat"){if(h==="repeat-x"||h==="no-repeat"){m= |
|||
k+1;t=k+d.f+v}if(h==="repeat-y"||h==="no-repeat"){p=n+1;r=n+d.h+v}a.style.clip="rect("+m+"px,"+r+"px,"+t+"px,"+p+"px)"}}})},bd:function(a,b){var c=this.e,d=this.s.o(),e=d.h,g=d.f;a=a.fill;d=b.ca;var j=d.length,i=Math.PI,h=f.Na,k=h.tc,n=h.dc;b=h.gc(c,e,g,b);h=b.sa;var m=b.xc,p=b.yc,r=b.Wd,t=b.Xd,v=b.rd,l=b.sd,q=b.kd,s=b.ld;b=b.rc;e=h%90?Math.atan2(q*e/g,s)/i*180:h+90;e+=180;e%=360;v=k(r,t,h,v,l);g=n(r,t,v[0],v[1]);i=[];v=k(m,p,h,r,t);n=n(m,p,v[0],v[1])/g*100;k=[];for(h=0;h<j;h++)k.push(d[h].db?d[h].db.a(c, |
|||
b):h===0?0:h===j-1?b:null);for(h=1;h<j;h++){if(k[h]===null){m=k[h-1];b=h;do p=k[++b];while(p===null);k[h]=m+(p-m)/(b-h+1)}k[h]=Math.max(k[h],k[h-1])}for(h=0;h<j;h++)i.push(n+k[h]/g*100+"% "+d[h].color.U(c));a.angle=e;a.type="gradient";a.method="sigma";a.color=d[0].color.U(c);a.color2=d[j-1].color.U(c);if(a.colors)a.colors.value=i.join(",");else a.colors=i.join(",")},lc:function(){var a=this.e.runtimeStyle;a.backgroundImage="url(about:blank)";a.backgroundColor="transparent"},m:function(){f.u.m.call(this); |
|||
var a=this.e.runtimeStyle;a.backgroundImage=a.backgroundColor=""}});f.Gc=f.u.R({N:4,Ya:"border",Q:function(){var a=this.g;return a.w.H()||a.G.H()},i:function(){var a=this.g;return a.G.i()&&!a.q.i()&&a.w.i()},V:function(){var a=this.e,b=this.g.w.j(),c=this.s.o(),d=c.h;c=c.f;var e,g,j,i,h;if(b){this.mc();b=this.wd(2);i=0;for(h=b.length;i<h;i++){j=b[i];e=this.Aa("borderPiece"+i,j.stroke?"stroke":"fill",this.I());e.coordsize=d*2+","+c*2;e.coordorigin="1,1";e.path=j.path;g=e.style;g.width=d;g.height=c; |
|||
e.filled=!!j.fill;e.stroked=!!j.stroke;if(j.stroke){e=e.stroke;e.weight=j.Qb+"px";e.color=j.color.U(a);e.dashstyle=j.stroke==="dashed"?"2 2":j.stroke==="dotted"?"1 1":"solid";e.linestyle=j.stroke==="double"&&j.Qb>2?"ThinThin":"Single"}else e.fill.color=j.fill.U(a)}for(;this.vb("borderPiece"+i++););}},wd:function(a){var b=this.e,c,d,e,g=this.g.w,j=[],i,h,k,n,m=Math.round,p,r,t;if(g.i()){c=g.j();g=c.J;r=c.Zd;t=c.gd;if(c.ee&&c.$d&&c.hd){if(t.t.fa()>0){c=g.t.a(b);k=c/2;j.push({path:this.ya({Jb:k,Ib:k, |
|||
tb:k,Db:k},a),stroke:r.t,color:t.t,Qb:c})}}else{a=a||1;c=this.s.o();d=c.h;e=c.f;c=m(g.t.a(b));k=m(g.r.a(b));n=m(g.b.a(b));b=m(g.l.a(b));var v={t:c,r:k,b:n,l:b};b=this.g.G;if(b.i())p=this.kc(b.j());i=Math.floor;h=Math.ceil;var l=function(o,u){return p?p[o][u]:0},q=function(o,u,x,y,z,B){var E=l("x",o),D=l("y",o),C=o.charAt(1)==="r";o=o.charAt(0)==="b";return E>0&&D>0?(B?"al":"ae")+(C?h(d-E):i(E))*a+","+(o?h(e-D):i(D))*a+","+(i(E)-u)*a+","+(i(D)-x)*a+","+y*65535+","+2949075*(z?1:-1):(B?"m":"l")+(C?d- |
|||
u:u)*a+","+(o?e-x:x)*a},s=function(o,u,x,y){var z=o==="t"?i(l("x","tl"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+i(l("y","tr"))*a:o==="b"?h(d-l("x","br"))*a+","+i(e-u)*a:i(u)*a+","+h(e-l("y","bl"))*a;o=o==="t"?h(d-l("x","tr"))*a+","+h(u)*a:o==="r"?h(d-u)*a+","+h(e-l("y","br"))*a:o==="b"?i(l("x","bl"))*a+","+i(e-u)*a:i(u)*a+","+i(l("y","tl"))*a;return x?(y?"m"+o:"")+"l"+z:(y?"m"+z:"")+"l"+o};b=function(o,u,x,y,z,B){var E=o==="l"||o==="r",D=v[o],C,F;if(D>0&&r[o]!=="none"&&t[o].fa()>0){C=v[E?o:u];u=v[E?u: |
|||
o];F=v[E?o:x];x=v[E?x:o];if(r[o]==="dashed"||r[o]==="dotted"){j.push({path:q(y,C,u,B+45,0,1)+q(y,0,0,B,1,0),fill:t[o]});j.push({path:s(o,D/2,0,1),stroke:r[o],Qb:D,color:t[o]});j.push({path:q(z,F,x,B,0,1)+q(z,0,0,B-45,1,0),fill:t[o]})}else j.push({path:q(y,C,u,B+45,0,1)+s(o,D,0,0)+q(z,F,x,B,0,0)+(r[o]==="double"&&D>2?q(z,F-i(F/3),x-i(x/3),B-45,1,0)+s(o,h(D/3*2),1,0)+q(y,C-i(C/3),u-i(u/3),B,1,0)+"x "+q(y,i(C/3),i(u/3),B+45,0,1)+s(o,i(D/3),1,0)+q(z,i(F/3),i(x/3),B,0,0):"")+q(z,0,0,B-45,1,0)+s(o,0,1, |
|||
0)+q(y,0,0,B,1,0),fill:t[o]})}};b("t","l","r","tl","tr",90);b("r","t","b","tr","br",0);b("b","r","l","br","bl",-90);b("l","b","t","bl","tl",-180)}}return j},m:function(){if(this.ec||!this.g.q.i())this.e.runtimeStyle.borderColor="";f.u.m.call(this)}});f.Tb=f.u.R({N:5,Md:["t","tr","r","br","b","bl","l","tl","c"],Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){this.I();var a=this.g.q.j(),b=this.g.w.j(),c=this.s.o(),d=this.e,e=this.uc;f.p.Rb(a.src,function(g){function j(s, |
|||
o,u,x,y){s=e[s].style;var z=Math.max;s.width=z(o,0);s.height=z(u,0);s.left=x;s.top=y}function i(s,o,u){for(var x=0,y=s.length;x<y;x++)e[s[x]].imagedata[o]=u}var h=c.h,k=c.f,n=f.n("0"),m=a.J||(b?b.J:{t:n,r:n,b:n,l:n});n=m.t.a(d);var p=m.r.a(d),r=m.b.a(d);m=m.l.a(d);var t=a.slice,v=t.t.a(d),l=t.r.a(d),q=t.b.a(d);t=t.l.a(d);j("tl",m,n,0,0);j("t",h-m-p,n,m,0);j("tr",p,n,h-p,0);j("r",p,k-n-r,h-p,n);j("br",p,r,h-p,k-r);j("b",h-m-p,r,m,k-r);j("bl",m,r,0,k-r);j("l",m,k-n-r,0,n);j("c",h-m-p,k-n-r,m,n);i(["tl", |
|||
"t","tr"],"cropBottom",(g.f-v)/g.f);i(["tl","l","bl"],"cropRight",(g.h-t)/g.h);i(["bl","b","br"],"cropTop",(g.f-q)/g.f);i(["tr","r","br"],"cropLeft",(g.h-l)/g.h);i(["l","r","c"],"cropTop",v/g.f);i(["l","r","c"],"cropBottom",q/g.f);i(["t","b","c"],"cropLeft",t/g.h);i(["t","b","c"],"cropRight",l/g.h);e.c.style.display=a.fill?"":"none"},this)},I:function(){var a=this.parent.za(this.N),b,c,d,e=this.Md,g=e.length;if(!a){a=doc.createElement("border-image");b=a.style;b.position="absolute";this.uc={};for(d= |
|||
0;d<g;d++){c=this.uc[e[d]]=f.p.Za("rect");c.appendChild(f.p.Za("imagedata"));b=c.style;b.behavior="url(#default#VML)";b.position="absolute";b.top=b.left=0;c.imagedata.src=this.g.q.j().src;c.stroked=false;c.filled=false;a.appendChild(c)}this.parent.sb(this.N,a)}return a},Ea:function(){if(this.i()){var a=this.e,b=a.runtimeStyle,c=this.g.q.j().J;b.borderStyle="solid";if(c){b.borderTopWidth=c.t.a(a)+"px";b.borderRightWidth=c.r.a(a)+"px";b.borderBottomWidth=c.b.a(a)+"px";b.borderLeftWidth=c.l.a(a)+"px"}this.mc()}}, |
|||
m:function(){var a=this.e.runtimeStyle;a.borderStyle="";if(this.ec||!this.g.w.i())a.borderColor=a.borderWidth="";f.u.m.call(this)}});f.Hc=f.u.R({N:1,Ya:"outset-box-shadow",Q:function(){var a=this.g;return a.ga.H()||a.G.H()},i:function(){var a=this.g.ga;return a.i()&&a.j().Da[0]},V:function(){function a(C,F,O,H,M,P,I){C=b.Aa("shadow"+C+F,"fill",d,j-C);F=C.fill;C.coordsize=n*2+","+m*2;C.coordorigin="1,1";C.stroked=false;C.filled=true;F.color=M.U(c);if(P){F.type="gradienttitle";F.color2=F.color;F.opacity= |
|||
0}C.path=I;l=C.style;l.left=O;l.top=H;l.width=n;l.height=m;return C}var b=this,c=this.e,d=this.I(),e=this.g,g=e.ga.j().Da;e=e.G.j();var j=g.length,i=j,h,k=this.s.o(),n=k.h,m=k.f;k=f.O===8?1:0;for(var p=["tl","tr","br","bl"],r,t,v,l,q,s,o,u,x,y,z,B,E,D;i--;){t=g[i];q=t.fe.a(c);s=t.ge.a(c);h=t.Vd.a(c);o=t.blur.a(c);t=t.color;u=-h-o;if(!e&&o)e=f.jb.Dc;u=this.ya({Jb:u,Ib:u,tb:u,Db:u},2,e);if(o){x=(h+o)*2+n;y=(h+o)*2+m;z=x?o*2/x:0;B=y?o*2/y:0;if(o-h>n/2||o-h>m/2)for(h=4;h--;){r=p[h];E=r.charAt(0)==="b"; |
|||
D=r.charAt(1)==="r";r=a(i,r,q,s,t,o,u);v=r.fill;v.focusposition=(D?1-z:z)+","+(E?1-B:B);v.focussize="0,0";r.style.clip="rect("+((E?y/2:0)+k)+"px,"+(D?x:x/2)+"px,"+(E?y:y/2)+"px,"+((D?x/2:0)+k)+"px)"}else{r=a(i,"",q,s,t,o,u);v=r.fill;v.focusposition=z+","+B;v.focussize=1-z*2+","+(1-B*2)}}else{r=a(i,"",q,s,t,o,u);q=t.fa();if(q<1)r.fill.opacity=q}}}});f.Pc=f.u.R({N:6,Ya:"imgEl",Q:function(){var a=this.g;return this.e.src!==this.Xc||a.G.H()},i:function(){var a=this.g;return a.G.i()||a.C.qc()},V:function(){this.Xc= |
|||
j;this.Cd();var a=this.Aa("img","fill",this.I()),b=a.fill,c=this.s.o(),d=c.h;c=c.f;var e=this.g.w.j(),g=e&&e.J;e=this.e;var j=e.src,i=Math.round,h=e.currentStyle,k=f.n;if(!g||f.O<7){g=f.n("0");g={t:g,r:g,b:g,l:g}}a.stroked=false;b.type="frame";b.src=j;b.position=(d?0.5/d:0)+","+(c?0.5/c:0);a.coordsize=d*2+","+c*2;a.coordorigin="1,1";a.path=this.ya({Jb:i(g.t.a(e)+k(h.paddingTop).a(e)),Ib:i(g.r.a(e)+k(h.paddingRight).a(e)),tb:i(g.b.a(e)+k(h.paddingBottom).a(e)),Db:i(g.l.a(e)+k(h.paddingLeft).a(e))}, |
|||
2);a=a.style;a.width=d;a.height=c},Cd:function(){this.e.runtimeStyle.filter="alpha(opacity=0)"},m:function(){f.u.m.call(this);this.e.runtimeStyle.filter=""}});f.Oc=f.u.R({ib:f.aa,Mb:f.aa,Nb:f.aa,Lb:f.aa,Ld:/^,+|,+$/g,Fd:/,+/g,gb:function(a,b){(this.pb||(this.pb=[]))[a]=b||void 0},ab:function(){var a=this.pb,b;if(a&&(b=a.join(",").replace(this.Ld,"").replace(this.Fd,","))!==this.Wc)this.Wc=this.e.runtimeStyle.background=b},m:function(){this.e.runtimeStyle.background="";delete this.pb}});f.Mc=f.u.R({ua:1, |
|||
Q:function(){return this.g.C.H()},i:function(){var a=this.g;return a.C.i()||a.q.i()},V:function(){var a=this.g.C.j(),b,c,d=0,e,g;if(a){b=[];if(c=a.M)for(;e=c[d++];)if(e.P==="linear-gradient"){g=this.vd(e.Wa);g=(e.Xa||f.Ka.Kc).a(this.e,g.h,g.f,g.h,g.f);b.push("url(data:image/svg+xml,"+escape(this.xd(e,g.h,g.f))+") "+this.dd(e.$)+" / "+g.h+"px "+g.f+"px "+(e.bc||"")+" "+(e.Wa||"")+" "+(e.ub||""))}else b.push(e.Hb);a.color&&b.push(a.color.Y);this.parent.gb(this.ua,b.join(","))}},dd:function(a){return a? |
|||
a.X.map(function(b){return b.d}).join(" "):"0 0"},vd:function(a){var b=this.e,c=this.s.o(),d=c.h;c=c.f;var e;if(a!=="border-box")if((e=this.g.w.j())&&(e=e.J)){d-=e.l.a(b)+e.l.a(b);c-=e.t.a(b)+e.b.a(b)}if(a==="content-box"){a=f.n;e=b.currentStyle;d-=a(e.paddingLeft).a(b)+a(e.paddingRight).a(b);c-=a(e.paddingTop).a(b)+a(e.paddingBottom).a(b)}return{h:d,f:c}},xd:function(a,b,c){var d=this.e,e=a.ca,g=e.length,j=f.Na.gc(d,b,c,a);a=j.xc;var i=j.yc,h=j.td,k=j.ud;j=j.rc;var n,m,p,r,t;n=[];for(m=0;m<g;m++)n.push(e[m].db? |
|||
e[m].db.a(d,j):m===0?0:m===g-1?j:null);for(m=1;m<g;m++)if(n[m]===null){r=n[m-1];p=m;do t=n[++p];while(t===null);n[m]=r+(t-r)/(p-m+1)}b=['<svg width="'+b+'" height="'+c+'" xmlns="http://www.w3.org/2000/svg"><defs><linearGradient id="g" gradientUnits="userSpaceOnUse" x1="'+a/b*100+'%" y1="'+i/c*100+'%" x2="'+h/b*100+'%" y2="'+k/c*100+'%">'];for(m=0;m<g;m++)b.push('<stop offset="'+n[m]/j+'" stop-color="'+e[m].color.U(d)+'" stop-opacity="'+e[m].color.fa()+'"/>');b.push('</linearGradient></defs><rect width="100%" height="100%" fill="url(#g)"/></svg>'); |
|||
return b.join("")},m:function(){this.parent.gb(this.ua)}});f.Nc=f.u.R({T:"repeat",Sc:"stretch",Qc:"round",ua:0,Q:function(){return this.g.q.H()},i:function(){return this.g.q.i()},V:function(){var a=this,b=a.g.q.j(),c=a.g.w.j(),d=a.s.o(),e=b.repeat,g=e.f,j=e.Ob,i=a.e,h=0;f.p.Rb(b.src,function(k){function n(Q,R,U,V,W,Y,X,S,w,A){K.push('<pattern patternUnits="userSpaceOnUse" id="pattern'+G+'" x="'+(g===l?Q+U/2-w/2:Q)+'" y="'+(j===l?R+V/2-A/2:R)+'" width="'+w+'" height="'+A+'"><svg width="'+w+'" height="'+ |
|||
A+'" viewBox="'+W+" "+Y+" "+X+" "+S+'" preserveAspectRatio="none"><image xlink:href="'+v+'" x="0" y="0" width="'+r+'" height="'+t+'" /></svg></pattern>');J.push('<rect x="'+Q+'" y="'+R+'" width="'+U+'" height="'+V+'" fill="url(#pattern'+G+')" />');G++}var m=d.h,p=d.f,r=k.h,t=k.f,v=a.Dd(b.src,r,t),l=a.T,q=a.Sc;k=a.Qc;var s=Math.ceil,o=f.n("0"),u=b.J||(c?c.J:{t:o,r:o,b:o,l:o});o=u.t.a(i);var x=u.r.a(i),y=u.b.a(i);u=u.l.a(i);var z=b.slice,B=z.t.a(i),E=z.r.a(i),D=z.b.a(i);z=z.l.a(i);var C=m-u-x,F=p-o- |
|||
y,O=r-z-E,H=t-B-D,M=g===q?C:O*o/B,P=j===q?F:H*x/E,I=g===q?C:O*y/D;q=j===q?F:H*u/z;var K=[],J=[],G=0;if(g===k){M-=(M-(C%M||M))/s(C/M);I-=(I-(C%I||I))/s(C/I)}if(j===k){P-=(P-(F%P||P))/s(F/P);q-=(q-(F%q||q))/s(F/q)}k=['<svg width="'+m+'" height="'+p+'" xmlns="http://www.w3.org/2000/svg" xmlns:xlink="http://www.w3.org/1999/xlink">'];n(0,0,u,o,0,0,z,B,u,o);n(u,0,C,o,z,0,O,B,M,o);n(m-x,0,x,o,r-E,0,E,B,x,o);n(0,o,u,F,0,B,z,H,u,q);if(b.fill)n(u,o,C,F,z,B,O,H,M||I||O,q||P||H);n(m-x,o,x,F,r-E,B,E,H,x,P);n(0, |
|||
p-y,u,y,0,t-D,z,D,u,y);n(u,p-y,C,y,z,t-D,O,D,I,y);n(m-x,p-y,x,y,r-E,t-D,E,D,x,y);k.push("<defs>"+K.join("\n")+"</defs>"+J.join("\n")+"</svg>");a.parent.gb(a.ua,"url(data:image/svg+xml,"+escape(k.join(""))+") no-repeat border-box border-box");h&&a.parent.ab()},a);h=1},Dd:function(){var a={};return function(b,c,d){var e=a[b],g;if(!e){e=new Image;g=doc.createElement("canvas");e.src=b;g.width=c;g.height=d;g.getContext("2d").drawImage(e,0,0);e=a[b]=g.toDataURL()}return e}}(),Ea:f.Tb.prototype.Ea,m:function(){var a= |
|||
this.e.runtimeStyle;this.parent.gb(this.ua);a.borderColor=a.borderStyle=a.borderWidth=""}});f.kb=function(){function a(l,q){l.className+=" "+q}function b(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;)a(l,q[s])},0)}function c(l){var q=v.slice.call(arguments,1),s=q.length;setTimeout(function(){if(l)for(;s--;){var o=q[s];o=t[o]||(t[o]=new RegExp("\\b"+o+"\\b","g"));l.className=l.className.replace(o,"")}},0)}function d(l){function q(){if(!U){var w,A,L=f.ja,T=l.currentStyle, |
|||
N=T.getAttribute(g)==="true",da=T.getAttribute(i)!=="false",ea=T.getAttribute(h)!=="false";S=T.getAttribute(j);S=L>7?S!=="false":S==="true";if(!R){R=1;l.runtimeStyle.zoom=1;T=l;for(var fa=1;T=T.previousSibling;)if(T.nodeType===1){fa=0;break}fa&&a(l,p)}J.cb();if(N&&(A=J.o())&&(w=doc.documentElement||doc.body)&&(A.y>w.clientHeight||A.x>w.clientWidth||A.y+A.f<0||A.x+A.h<0)){if(!Y){Y=1;f.mb.ba(q)}}else{U=1;Y=R=0;f.mb.Ha(q);if(L===9){G={C:new f.Sb(l),q:new f.Ub(l),w:new f.Vb(l)};Q=[G.C,G.q];K=new f.Oc(l, |
|||
J,G);w=[new f.Mc(l,J,G,K),new f.Nc(l,J,G,K)]}else{G={C:new f.Sb(l),w:new f.Vb(l),q:new f.Ub(l),G:new f.jb(l),ga:new f.Ic(l),Pb:new f.Uc(l)};Q=[G.C,G.w,G.q,G.G,G.ga,G.Pb];K=new f.Rc(l,J,G);w=[new f.Hc(l,J,G,K),new f.Fc(l,J,G,K),new f.Gc(l,J,G,K),new f.Tb(l,J,G,K)];l.tagName==="IMG"&&w.push(new f.Pc(l,J,G,K));K.ed=w}I=[K].concat(w);if(w=l.currentStyle.getAttribute(f.F+"watch-ancestors")){w=parseInt(w,10);A=0;for(N=l.parentNode;N&&(w==="NaN"||A++<w);){H(N,"onpropertychange",C);H(N,"onmouseenter",x); |
|||
H(N,"onmouseleave",y);H(N,"onmousedown",z);if(N.tagName in f.fc){H(N,"onfocus",E);H(N,"onblur",D)}N=N.parentNode}}if(S){f.Oa.ba(o);f.Oa.Rd()}o(1)}if(!V){V=1;L<9&&H(l,"onmove",s);H(l,"onresize",s);H(l,"onpropertychange",u);ea&&H(l,"onmouseenter",x);if(ea||da)H(l,"onmouseleave",y);da&&H(l,"onmousedown",z);if(l.tagName in f.fc){H(l,"onfocus",E);H(l,"onblur",D)}f.Qa.ba(s);f.L.ba(M)}J.hb()}}function s(){J&&J.Ad()&&o()}function o(w){if(!X)if(U){var A,L=I.length;F();for(A=0;A<L;A++)I[A].Ea();if(w||J.Od())for(A= |
|||
0;A<L;A++)I[A].ib();if(w||J.Td())for(A=0;A<L;A++)I[A].Mb();K.ab();O()}else R||q()}function u(){var w,A=I.length,L;w=event;if(!X&&!(w&&w.propertyName in r))if(U){F();for(w=0;w<A;w++)I[w].Ea();for(w=0;w<A;w++){L=I[w];L.Cb||L.ib();L.Q()&&L.Lb()}K.ab();O()}else R||q()}function x(){b(l,k)}function y(){c(l,k,n)}function z(){b(l,n);f.lb.ba(B)}function B(){c(l,n);f.lb.Ha(B)}function E(){b(l,m)}function D(){c(l,m)}function C(){var w=event.propertyName;if(w==="className"||w==="id")u()}function F(){J.cb();for(var w= |
|||
Q.length;w--;)Q[w].cb()}function O(){for(var w=Q.length;w--;)Q[w].hb();J.hb()}function H(w,A,L){w.attachEvent(A,L);W.push([w,A,L])}function M(){if(V){for(var w=W.length,A;w--;){A=W[w];A[0].detachEvent(A[1],A[2])}f.L.Ha(M);V=0;W=[]}}function P(){if(!X){var w,A;M();X=1;if(I){w=0;for(A=I.length;w<A;w++){I[w].ec=1;I[w].m()}}S&&f.Oa.Ha(o);f.Qa.Ha(o);I=J=G=Q=l=null}}var I,K,J=new ha(l),G,Q,R,U,V,W=[],Y,X,S;this.Ed=q;this.update=o;this.m=P;this.qd=l}var e={},g=f.F+"lazy-init",j=f.F+"poll",i=f.F+"track-active", |
|||
h=f.F+"track-hover",k=f.La+"hover",n=f.La+"active",m=f.La+"focus",p=f.La+"first-child",r={background:1,bgColor:1,display:1},t={},v=[];d.yd=function(l){var q=f.p.Ba(l);return e[q]||(e[q]=new d(l))};d.m=function(l){l=f.p.Ba(l);var q=e[l];if(q){q.m();delete e[l]}};d.md=function(){var l=[],q;if(e){for(var s in e)if(e.hasOwnProperty(s)){q=e[s];l.push(q.qd);q.m()}e={}}return l};return d}();f.supportsVML=f.zc;f.attach=function(a){f.ja<10&&f.zc&&f.kb.yd(a).Ed()};f.detach=function(a){f.kb.m(a)}}; |
|||
})(); |
|||
@ -0,0 +1,600 @@ |
|||
//<!--
|
|||
// Ultimate client-side JavaScript client sniff. Version 3.03
|
|||
// (C) Netscape Communications 1999-2001. Permission granted to reuse and distribute.
|
|||
// Revised 17 May 99 to add is_nav5up and is_ie5up (see below).
|
|||
// Revised 20 Dec 00 to add is_gecko and change is_nav5up to is_nav6up
|
|||
// also added support for IE5.5 Opera4&5 HotJava3 AOLTV
|
|||
// Revised 22 Feb 01 to correct Javascript Detection for IE 5.x, Opera 4,
|
|||
// correct Opera 5 detection
|
|||
// add support for winME and win2k
|
|||
// synch with browser-type-oo.js
|
|||
// Revised 26 Mar 01 to correct Opera detection
|
|||
// Revised 02 Oct 01 to add IE6 detection
|
|||
|
|||
// Everything you always wanted to know about your JavaScript client
|
|||
// but were afraid to ask. Creates "is_" variables indicating:
|
|||
// (1) browser vendor:
|
|||
// is_nav, is_ie, is_opera, is_hotjava, is_webtv, is_TVNavigator, is_AOLTV
|
|||
// (2) browser version number:
|
|||
// is_major (integer indicating major version number: 2, 3, 4 ...)
|
|||
// is_minor (float indicating full version number: 2.02, 3.01, 4.04 ...)
|
|||
// (3) browser vendor AND major version number
|
|||
// is_nav2, is_nav3, is_nav4, is_nav4up, is_nav6, is_nav6up, is_gecko, is_ie3,
|
|||
// is_ie4, is_ie4up, is_ie5, is_ie5up, is_ie5_5, is_ie5_5up, is_ie6, is_ie6up, is_hotjava3, is_hotjava3up,
|
|||
// is_opera2, is_opera3, is_opera4, is_opera5, is_opera5up
|
|||
// (4) JavaScript version number:
|
|||
// is_js (float indicating full JavaScript version number: 1, 1.1, 1.2 ...)
|
|||
// (5) OS platform and version:
|
|||
// is_win, is_win16, is_win32, is_win31, is_win95, is_winnt, is_win98, is_winme, is_win2k
|
|||
// is_os2
|
|||
// is_mac, is_mac68k, is_macppc
|
|||
// is_unix
|
|||
// is_sun, is_sun4, is_sun5, is_suni86
|
|||
// is_irix, is_irix5, is_irix6
|
|||
// is_hpux, is_hpux9, is_hpux10
|
|||
// is_aix, is_aix1, is_aix2, is_aix3, is_aix4
|
|||
// is_linux, is_sco, is_unixware, is_mpras, is_reliant
|
|||
// is_dec, is_sinix, is_freebsd, is_bsd
|
|||
// is_vms
|
|||
//
|
|||
// See http://www.it97.de/JavaScript/JS_tutorial/bstat/navobj.html and
|
|||
// http://www.it97.de/JavaScript/JS_tutorial/bstat/Browseraol.html
|
|||
// for detailed lists of userAgent strings.
|
|||
//
|
|||
// Note: you don't want your Nav4 or IE4 code to "turn off" or
|
|||
// stop working when new versions of browsers are released, so
|
|||
// in conditional code forks, use is_ie5up ("IE 5.0 or greater")
|
|||
// is_opera5up ("Opera 5.0 or greater") instead of is_ie5 or is_opera5
|
|||
// to check version in code which you want to work on future
|
|||
// versions.
|
|||
|
|||
// convert all characters to lowercase to simplify testing
|
|||
var agt=navigator.userAgent.toLowerCase(); |
|||
|
|||
// *** BROWSER VERSION ***
|
|||
// Note: On IE5, these return 4, so use is_ie5up to detect IE5.
|
|||
var is_major = parseInt(navigator.appVersion); |
|||
var is_minor = parseFloat(navigator.appVersion); |
|||
|
|||
// Note: Opera and WebTV spoof Navigator. We do strict client detection.
|
|||
// If you want to allow spoofing, take out the tests for opera and webtv.
|
|||
var is_nav = ((agt.indexOf('mozilla')!=-1) && (agt.indexOf('spoofer')==-1) |
|||
&& (agt.indexOf('compatible') == -1) && (agt.indexOf('opera')==-1) |
|||
&& (agt.indexOf('webtv')==-1) && (agt.indexOf('hotjava')==-1)); |
|||
var is_nav2 = (is_nav && (is_major == 2)); |
|||
var is_nav3 = (is_nav && (is_major == 3)); |
|||
var is_nav4 = (is_nav && (is_major == 4)); |
|||
var is_nav4up = (is_nav && (is_major >= 4)); |
|||
var is_navonly = (is_nav && ((agt.indexOf(";nav") != -1) || |
|||
(agt.indexOf("; nav") != -1)) ); |
|||
var is_nav6 = (is_nav && (is_major == 5)); |
|||
var is_nav6up = (is_nav && (is_major >= 5)); |
|||
var is_gecko = (agt.indexOf('gecko') != -1); |
|||
|
|||
|
|||
var is_ie = ((agt.indexOf("msie") != -1) && (agt.indexOf("opera") == -1)); |
|||
var is_ie3 = (is_ie && (is_major < 4)); |
|||
var is_ie4 = (is_ie && (is_major == 4) && (agt.indexOf("msie 4")!=-1) ); |
|||
var is_ie4up = (is_ie && (is_major >= 4)); |
|||
var is_ie5 = (is_ie && (is_major == 4) && (agt.indexOf("msie 5.0")!=-1) ); |
|||
var is_ie5_5 = (is_ie && (is_major == 4) && (agt.indexOf("msie 5.5") !=-1)); |
|||
var is_ie5up = (is_ie && !is_ie3 && !is_ie4); |
|||
var is_ie5_5up =(is_ie && !is_ie3 && !is_ie4 && !is_ie5); |
|||
var is_ie6 = (is_ie && (is_major == 4) && (agt.indexOf("msie 6.")!=-1) ); |
|||
var is_ie6up = (is_ie && !is_ie3 && !is_ie4 && !is_ie5 && !is_ie5_5); |
|||
|
|||
// KNOWN BUG: On AOL4, returns false if IE3 is embedded browser
|
|||
// or if this is the first browser window opened. Thus the
|
|||
// variables is_aol, is_aol3, and is_aol4 aren't 100% reliable.
|
|||
var is_aol = (agt.indexOf("aol") != -1); |
|||
var is_aol3 = (is_aol && is_ie3); |
|||
var is_aol4 = (is_aol && is_ie4); |
|||
var is_aol5 = (agt.indexOf("aol 5") != -1); |
|||
var is_aol6 = (agt.indexOf("aol 6") != -1); |
|||
|
|||
var is_opera = (agt.indexOf("opera") != -1); |
|||
var is_opera2 = (agt.indexOf("opera 2") != -1 || agt.indexOf("opera/2") != -1); |
|||
var is_opera3 = (agt.indexOf("opera 3") != -1 || agt.indexOf("opera/3") != -1); |
|||
var is_opera4 = (agt.indexOf("opera 4") != -1 || agt.indexOf("opera/4") != -1); |
|||
var is_opera5 = (agt.indexOf("opera 5") != -1 || agt.indexOf("opera/5") != -1); |
|||
var is_opera5up = (is_opera && !is_opera2 && !is_opera3 && !is_opera4); |
|||
|
|||
var is_webtv = (agt.indexOf("webtv") != -1); |
|||
|
|||
var is_TVNavigator = ((agt.indexOf("navio") != -1) || (agt.indexOf("navio_aoltv") != -1)); |
|||
var is_AOLTV = is_TVNavigator; |
|||
|
|||
var is_hotjava = (agt.indexOf("hotjava") != -1); |
|||
var is_hotjava3 = (is_hotjava && (is_major == 3)); |
|||
var is_hotjava3up = (is_hotjava && (is_major >= 3)); |
|||
|
|||
// *** JAVASCRIPT VERSION CHECK ***
|
|||
var is_js; |
|||
if (is_nav2 || is_ie3) is_js = 1.0; |
|||
else if (is_nav3) is_js = 1.1; |
|||
else if (is_opera5up) is_js = 1.3; |
|||
else if (is_opera) is_js = 1.1; |
|||
else if ((is_nav4 && (is_minor <= 4.05)) || is_ie4) is_js = 1.2; |
|||
else if ((is_nav4 && (is_minor > 4.05)) || is_ie5) is_js = 1.3; |
|||
else if (is_hotjava3up) is_js = 1.4; |
|||
else if (is_nav6 || is_gecko) is_js = 1.5; |
|||
// NOTE: In the future, update this code when newer versions of JS
|
|||
// are released. For now, we try to provide some upward compatibility
|
|||
// so that future versions of Nav and IE will show they are at
|
|||
// *least* JS 1.x capable. Always check for JS version compatibility
|
|||
// with > or >=.
|
|||
else if (is_nav6up) is_js = 1.5; |
|||
// NOTE: ie5up on mac is 1.4
|
|||
else if (is_ie5up) is_js = 1.3 |
|||
|
|||
// HACK: no idea for other browsers; always check for JS version with > or >=
|
|||
else is_js = 0.0; |
|||
|
|||
// *** PLATFORM ***
|
|||
var is_win = ( (agt.indexOf("win")!=-1) || (agt.indexOf("16bit")!=-1) ); |
|||
// NOTE: On Opera 3.0, the userAgent string includes "Windows 95/NT4" on all
|
|||
// Win32, so you can't distinguish between Win95 and WinNT.
|
|||
var is_win95 = ((agt.indexOf("win95")!=-1) || (agt.indexOf("windows 95")!=-1)); |
|||
|
|||
// is this a 16 bit compiled version?
|
|||
var is_win16 = ((agt.indexOf("win16")!=-1) || |
|||
(agt.indexOf("16bit")!=-1) || (agt.indexOf("windows 3.1")!=-1) || |
|||
(agt.indexOf("windows 16-bit")!=-1) ); |
|||
|
|||
var is_win31 = ((agt.indexOf("windows 3.1")!=-1) || (agt.indexOf("win16")!=-1) || |
|||
(agt.indexOf("windows 16-bit")!=-1)); |
|||
|
|||
var is_winme = ((agt.indexOf("win 9x 4.90")!=-1)); |
|||
var is_win2k = ((agt.indexOf("windows nt 5.0")!=-1)); |
|||
|
|||
// NOTE: Reliable detection of Win98 may not be possible. It appears that:
|
|||
// - On Nav 4.x and before you'll get plain "Windows" in userAgent.
|
|||
// - On Mercury client, the 32-bit version will return "Win98", but
|
|||
// the 16-bit version running on Win98 will still return "Win95".
|
|||
var is_win98 = ((agt.indexOf("win98")!=-1) || (agt.indexOf("windows 98")!=-1)); |
|||
var is_winnt = ((agt.indexOf("winnt")!=-1) || (agt.indexOf("windows nt")!=-1)); |
|||
var is_win32 = (is_win95 || is_winnt || is_win98 || |
|||
((is_major >= 4) && (navigator.platform == "Win32")) || |
|||
(agt.indexOf("win32")!=-1) || (agt.indexOf("32bit")!=-1)); |
|||
|
|||
var is_os2 = ((agt.indexOf("os/2")!=-1) || |
|||
(navigator.appVersion.indexOf("OS/2")!=-1) || |
|||
(agt.indexOf("ibm-webexplorer")!=-1)); |
|||
|
|||
var is_mac = (agt.indexOf("mac")!=-1); |
|||
// hack ie5 js version for mac
|
|||
if (is_mac && is_ie5up) is_js = 1.4; |
|||
var is_mac68k = (is_mac && ((agt.indexOf("68k")!=-1) || |
|||
(agt.indexOf("68000")!=-1))); |
|||
var is_macppc = (is_mac && ((agt.indexOf("ppc")!=-1) || |
|||
(agt.indexOf("powerpc")!=-1))); |
|||
|
|||
var is_sun = (agt.indexOf("sunos")!=-1); |
|||
var is_sun4 = (agt.indexOf("sunos 4")!=-1); |
|||
var is_sun5 = (agt.indexOf("sunos 5")!=-1); |
|||
var is_suni86= (is_sun && (agt.indexOf("i86")!=-1)); |
|||
var is_irix = (agt.indexOf("irix") !=-1); // SGI
|
|||
var is_irix5 = (agt.indexOf("irix 5") !=-1); |
|||
var is_irix6 = ((agt.indexOf("irix 6") !=-1) || (agt.indexOf("irix6") !=-1)); |
|||
var is_hpux = (agt.indexOf("hp-ux")!=-1); |
|||
var is_hpux9 = (is_hpux && (agt.indexOf("09.")!=-1)); |
|||
var is_hpux10= (is_hpux && (agt.indexOf("10.")!=-1)); |
|||
var is_aix = (agt.indexOf("aix") !=-1); // IBM
|
|||
var is_aix1 = (agt.indexOf("aix 1") !=-1); |
|||
var is_aix2 = (agt.indexOf("aix 2") !=-1); |
|||
var is_aix3 = (agt.indexOf("aix 3") !=-1); |
|||
var is_aix4 = (agt.indexOf("aix 4") !=-1); |
|||
var is_linux = (agt.indexOf("inux")!=-1); |
|||
var is_sco = (agt.indexOf("sco")!=-1) || (agt.indexOf("unix_sv")!=-1); |
|||
var is_unixware = (agt.indexOf("unix_system_v")!=-1); |
|||
var is_mpras = (agt.indexOf("ncr")!=-1); |
|||
var is_reliant = (agt.indexOf("reliantunix")!=-1); |
|||
var is_dec = ((agt.indexOf("dec")!=-1) || (agt.indexOf("osf1")!=-1) || |
|||
(agt.indexOf("dec_alpha")!=-1) || (agt.indexOf("alphaserver")!=-1) || |
|||
(agt.indexOf("ultrix")!=-1) || (agt.indexOf("alphastation")!=-1)); |
|||
var is_sinix = (agt.indexOf("sinix")!=-1); |
|||
var is_freebsd = (agt.indexOf("freebsd")!=-1); |
|||
var is_bsd = (agt.indexOf("bsd")!=-1); |
|||
var is_unix = ((agt.indexOf("x11")!=-1) || is_sun || is_irix || is_hpux || |
|||
is_sco ||is_unixware || is_mpras || is_reliant || |
|||
is_dec || is_sinix || is_aix || is_linux || is_bsd || is_freebsd); |
|||
|
|||
var is_vms = ((agt.indexOf("vax")!=-1) || (agt.indexOf("openvms")!=-1)); |
|||
|
|||
//--> end hide JavaScript
|
|||
|
|||
var windowNumber = 0; |
|||
var windowFrame = {width:0,height:0}; |
|||
var sizeMainWindow = {width:0,height:0}; |
|||
var mediaWindow = {top:0,left:0}; |
|||
var currentParams = {}; |
|||
|
|||
/* |
|||
if (opener && opener.windowFrame) { |
|||
windowFrame = opener.windowFrame; |
|||
} |
|||
*/ |
|||
|
|||
|
|||
function WindowOpenMain( width, height, windowName, param ) { |
|||
sizeMainWindow.width = width; |
|||
sizeMainWindow.height = height; |
|||
|
|||
if (windowNumber == 0) { |
|||
var left = (screen.width - width) / 2; |
|||
var top = (screen.height - height) / 2; |
|||
} |
|||
else { |
|||
var tmp_left = (screen.width - width) / 2 + windowNumber * 20; |
|||
var tmp_top = (screen.height - height) / 2 + windowNumber * 20; |
|||
var left = Math.max(0, Math.min(tmp_left, screen.width - width)); |
|||
var top = Math.max(0, Math.min(tmp_top, screen.height - height)); |
|||
} |
|||
var keyword = param.keyword; |
|||
var pagecode = param.pagecode; |
|||
var sid = param.sid; |
|||
var paramStr = ""; |
|||
if(keyword){ |
|||
keyword = encodeURI(keyword); |
|||
paramStr = "?k=" + keyword; |
|||
}else{ |
|||
paramStr = "?"; |
|||
} |
|||
|
|||
if(sid){ |
|||
if(paramStr != "?"){ |
|||
paramStr = paramStr + "&"; |
|||
} |
|||
paramStr = paramStr + "sid=" + sid; |
|||
} |
|||
|
|||
if(pagecode){ |
|||
if(paramStr != "?"){ |
|||
paramStr = paramStr + "&"; |
|||
} |
|||
paramStr = paramStr + "pagecode=" + pagecode; |
|||
}else{ |
|||
if(paramStr == "?"){ |
|||
paramStr = ""; |
|||
} |
|||
} |
|||
var hwnd = window.open("_SWF_Window.html" + paramStr, windowName, "width=" + width + ",height=" + height + "," |
|||
+ "resizable=" + ((param.resizable)?param.resizable:'yes') + "," |
|||
+ "screenX=" + left + "," |
|||
+ "screenY=" + top + "," |
|||
+ "left=" + left + "," |
|||
+ "top=" + top + "," |
|||
+ "scrollbars=no" |
|||
); |
|||
windowNumber++; |
|||
if (is_ie) { |
|||
windowFrame.width = tmp_left - left; |
|||
windowFrame.height = tmp_top - top; |
|||
} |
|||
|
|||
} |
|||
|
|||
function WindowOpenSample( width, height, windowName, param ) { |
|||
sizeMainWindow.width = width; |
|||
sizeMainWindow.height = height; |
|||
|
|||
if (windowNumber == 0) { |
|||
var left = (screen.width - width) / 2; |
|||
var top = (screen.height - height) / 2; |
|||
} |
|||
else { |
|||
var tmp_left = (screen.width - width) / 2 + windowNumber * 20; |
|||
var tmp_top = (screen.height - height) / 2 + windowNumber * 20; |
|||
var left = Math.max(0, Math.min(tmp_left, screen.width - width)); |
|||
var top = Math.max(0, Math.min(tmp_top, screen.height - height)); |
|||
} |
|||
var hwnd = window.open("_SWF_Window.html?mode=1063", windowName, "width=" + width + ",height=" + height + "," |
|||
+ "resizable=" + ((param.resizable)?param.resizable:'yes') + "," |
|||
+ "screenX=" + left + "," |
|||
+ "screenY=" + top + "," |
|||
+ "left=" + left + "," |
|||
+ "top=" + top + "," |
|||
+ "scrollbars=no" |
|||
); |
|||
windowNumber++; |
|||
if (is_ie) { |
|||
windowFrame.width = tmp_left - left; |
|||
windowFrame.height = tmp_top - top; |
|||
} |
|||
|
|||
} |
|||
|
|||
function WindowOpenMedia( url, params ) { |
|||
var width_match = new String(params.match( /width=([0-9]+)/i )); |
|||
var height_match = new String(params.match( /height=([0-9]+)/i )); |
|||
var width = width_match.substring(width_match.indexOf(",")+1); |
|||
var height = height_match.substring(height_match.indexOf(",")+1); |
|||
var left = (screen.width - width) / 2; |
|||
var top = (screen.height - height) / 2; |
|||
|
|||
params = params + ((params == '')?'':',') |
|||
+ "resizable=yes," |
|||
+ "screenX=" + left + "," |
|||
+ "screenY=" + top + "," |
|||
+ "left=" + left + "," |
|||
+ "top=" + top + ""; |
|||
var hwnd = window.open( url, "MediaWindow", params ); |
|||
|
|||
} |
|||
|
|||
function getLeftMargin() { |
|||
if (is_ie) { |
|||
return windowFrame.width + 2; |
|||
} |
|||
if (is_gecko) { |
|||
return 3; |
|||
} |
|||
if (is_opera) { |
|||
return window.screenX; |
|||
} |
|||
return 0; |
|||
} |
|||
|
|||
function getTopMargin() { |
|||
if (is_ie) { |
|||
return windowFrame.height + 2; |
|||
} |
|||
if (is_gecko) { |
|||
return 23; |
|||
} |
|||
if (is_opera) { |
|||
return window.screenY; |
|||
} |
|||
return 0; |
|||
} |
|||
|
|||
function getWindowLeft() { |
|||
if (is_ie) { |
|||
return window.screenLeft; |
|||
} |
|||
if (is_gecko) { |
|||
return window.screenX; |
|||
} |
|||
if (is_opera) { |
|||
return window.screenX; |
|||
} |
|||
return (window.screenLeft | window.screenX); |
|||
} |
|||
|
|||
function getWindowTop() { |
|||
if (is_ie) { |
|||
return window.screenTop; |
|||
} |
|||
if (is_gecko) { |
|||
return window.screenY; |
|||
} |
|||
if (is_opera) { |
|||
return window.screenY; |
|||
} |
|||
return (window.screenTop | window.screenY); |
|||
} |
|||
|
|||
function getInnerWidth() { |
|||
if (is_ie) { |
|||
return document.body.clientWidth; |
|||
} |
|||
if (is_gecko) { |
|||
return window.innerWidth; |
|||
} |
|||
if (is_opera) { |
|||
return window.innerWidth; |
|||
} |
|||
return (window.innerWidth | document.body.clientWidth); |
|||
} |
|||
|
|||
function getInnerHeight() { |
|||
if (is_ie) { |
|||
return document.body.clientHeight; |
|||
} |
|||
if (is_gecko) { |
|||
return window.innerHeight; |
|||
} |
|||
if (is_opera) { |
|||
return window.innerHeight; |
|||
} |
|||
return (window.innerHeight | document.body.clientHeight); |
|||
} |
|||
|
|||
function getTopToolbarMargin() { |
|||
if (is_ie) { |
|||
return 0;//windowFrame.height + 2;
|
|||
} |
|||
if (is_gecko) { |
|||
return 67; |
|||
} |
|||
if (is_opera) { |
|||
return 0;//window.screenY;
|
|||
} |
|||
return 0; |
|||
} |
|||
|
|||
function _parseParamString( str ) { |
|||
var params = new Array; |
|||
var tmp = str.match( /[^=,&]+=[^=,&]+/ig ); |
|||
for ( var i = 0 ; i < tmp.length ; i++ ) { |
|||
var tmp2 = tmp[i].match( /([^=,&]+)=([^=,&]+)/i ); |
|||
params[tmp2[1]] = tmp2[2]; |
|||
} |
|||
|
|||
return params; |
|||
|
|||
} |
|||
|
|||
function _joinParamString( paramArray ) { |
|||
var retString = ""; |
|||
for ( key in paramArray ) { |
|||
|
|||
retString += key + "=" + paramArray[key] + ","; |
|||
|
|||
} |
|||
if (retString.length !== 0) { |
|||
retString = retString.substring(0, retString.length - 1); |
|||
} |
|||
return retString; |
|||
|
|||
} |
|||
|
|||
function getMediaType( url ) { |
|||
var ext = url.match( /(?:\.([^\/\.]+))?$/i ); |
|||
var type = "page"; |
|||
if (ext[1]) { |
|||
switch (ext[1].toLowerCase()) { |
|||
case "avi": |
|||
case "asf": |
|||
case "asx": |
|||
case "wmv": |
|||
type = "wmv"; |
|||
break; |
|||
case "mp3": |
|||
type = "mp3"; |
|||
break; |
|||
case "swf": |
|||
type = "swf"; |
|||
break; |
|||
case "flv": |
|||
type = "flv"; |
|||
break; |
|||
case "mov": |
|||
case "mpeg": |
|||
case "mpg": |
|||
case "mp4": |
|||
type = "quicktime"; |
|||
break; |
|||
case "jpg": |
|||
case "jpeg": |
|||
case "png": |
|||
case "gif": |
|||
type = "image"; |
|||
break; |
|||
} |
|||
} |
|||
return type; |
|||
|
|||
} |
|||
var typesProperty = { |
|||
"page":{ |
|||
"toolbar":"yes" |
|||
}, "wmv":{ |
|||
"toolbar":"no" |
|||
}, |
|||
"mp3":{ |
|||
"toolbar":"no" |
|||
}, |
|||
"swf":{ |
|||
"toolbar":"no" |
|||
}, |
|||
"quicktime":{ |
|||
"toolbar":"no" |
|||
}, |
|||
"image":{ |
|||
"toolbar":"no" |
|||
}, |
|||
"flv":{ |
|||
"toolbar":"no" |
|||
} |
|||
}; |
|||
|
|||
/** |
|||
* メディア用Windowオープン関数 |
|||
* |
|||
* @param string url URL |
|||
* @param string paramString パラメータをkey1=value1,key2=value2,...の形式で指定する |
|||
*/ |
|||
function WindowOpenRelative( url, paramString ) { |
|||
var params = _parseParamString(paramString); |
|||
this.currentParams = _parseParamString(paramString); |
|||
|
|||
var type = getMediaType(url); |
|||
|
|||
if (!params.toolbar) { |
|||
params.toolbar = typesProperty[type].toolbar; |
|||
} |
|||
if (opener && !opener.closed && opener.sizeMainWindow) { |
|||
var autoScaleX = (opener && opener.sizeMainWindow.width != 0)?getInnerWidth() / opener.sizeMainWindow.width:1.0; |
|||
var autoScaleY = (opener && opener.sizeMainWindow.height != 0)?getInnerHeight() / opener.sizeMainWindow.height:1.0; |
|||
} else { |
|||
var autoScaleX = getInnerWidth() / 1000; |
|||
var autoScaleY = getInnerHeight() / 670; |
|||
} |
|||
// 20120830
|
|||
|
|||
var scaleX = (params.scaleX)?Number(params.scaleX) / 100.0:autoScaleX; |
|||
var scaleY = (params.scaleY)?Number(params.scaleY) / 100.0:autoScaleY; |
|||
|
|||
var width = Number(params.width) * scaleX; |
|||
var height = Number(params.height) * scaleY; |
|||
var relleft = Number(params.relleft) * scaleX; |
|||
var reltop = Number(params.reltop) * scaleY; |
|||
var left = getWindowLeft() + relleft/* + getLeftMargin()*/; |
|||
var top = getWindowTop() + reltop - ((params.toolbar == "yes")?getTopToolbarMargin():0); |
|||
|
|||
// FullScreen
|
|||
if ((is_gecko || is_ie) && params.fullscreen == "yes") { |
|||
left = 0; |
|||
top = 0; |
|||
|
|||
width = screen.width - (windowFrame.width * 2); |
|||
height = screen.height - (windowFrame.height); |
|||
params.fullscreen = "no"; |
|||
} |
|||
params.resizable = "yes"; |
|||
params.screenX = left; |
|||
params.screenY = top; |
|||
params.left = left; |
|||
params.top = top; |
|||
params.width = width; |
|||
params.height = height; |
|||
params.allowscriptaccess = "always"; |
|||
|
|||
|
|||
mediaWindow.width = width; |
|||
mediaWindow.height = height; |
|||
mediaWindow.top = top; |
|||
mediaWindow.left = left; |
|||
mediaWindow.type = type; |
|||
if(type == "flv"){ |
|||
mediaWindow.type = "swf"; |
|||
mediaWindow.url = "FlvPlayer.swf"; |
|||
mediaWindow.swfpath = url; |
|||
}else{ |
|||
mediaWindow.url = url; |
|||
} |
|||
var paramString = _joinParamString(params); |
|||
|
|||
mediaWindow.params = paramString; |
|||
//var hwnd = window.open( "MediaTemplate.html", "_blank", paramString );
|
|||
document.getElementById("open").click(); |
|||
} |
|||
|
|||
function toBookLink(url){ |
|||
window.location = url; |
|||
} |
|||
|
|||
function openMediaWindow(paramString){ |
|||
window.open('MediaTemplate.html', "_blank", paramString); |
|||
} |
|||
|
|||
// 20120809
|
|||
function actimgrOpenMediaWindow(url,paramString){ |
|||
window.open(url+'MediaTemplate.html', "_blank", paramString); |
|||
} |
|||
function onLoadMediaWindow() { |
|||
if (is_ie) { |
|||
if (opener.currentParams.fullscreen != "yes") { |
|||
var moveRelX = -(getWindowLeft() - opener.mediaWindow.left); |
|||
var moveRelY = -(getWindowTop() - opener.mediaWindow.top); |
|||
//window.moveBy(moveRelX, moveRelY);
|
|||
} |
|||
} |
|||
|
|||
} |
|||
function putMediaTag() { |
|||
document.write("<script type=\"text/javascript\" src=\"./mediaModules/type_" + opener.mediaWindow.type + ".js\" charset=\"euc-jp\"></script>"); |
|||
|
|||
} |
|||
|
|||
9
themes/nipponalba/static/js/aws-sdk-2.1.10.min.js
File diff suppressed because it is too large
View File
File diff suppressed because it is too large
View File
@ -0,0 +1,9 @@ |
|||
/* |
|||
HTML5 Shiv v3.6.2pre | @afarkas @jdalton @jon_neal @rem | MIT/GPL2 Licensed |
|||
Uncompressed source: https://github.com/aFarkas/html5shiv
|
|||
*/ |
|||
(function(l,f){function m(){var a=e.elements;return"string"==typeof a?a.split(" "):a}function i(a){var b=n[a[o]];b||(b={},h++,a[o]=h,n[h]=b);return b}function p(a,b,c){b||(b=f);if(g)return b.createElement(a);c||(c=i(b));b=c.cache[a]?c.cache[a].cloneNode():r.test(a)?(c.cache[a]=c.createElem(a)).cloneNode():c.createElem(a);return b.canHaveChildren&&!s.test(a)?c.frag.appendChild(b):b}function t(a,b){if(!b.cache)b.cache={},b.createElem=a.createElement,b.createFrag=a.createDocumentFragment,b.frag=b.createFrag(); |
|||
a.createElement=function(c){return!e.shivMethods?b.createElem(c):p(c,a,b)};a.createDocumentFragment=Function("h,f","return function(){var n=f.cloneNode(),c=n.createElement;h.shivMethods&&("+m().join().replace(/\w+/g,function(a){b.createElem(a);b.frag.createElement(a);return'c("'+a+'")'})+");return n}")(e,b.frag)}function q(a){a||(a=f);var b=i(a);if(e.shivCSS&&!j&&!b.hasCSS){var c,d=a;c=d.createElement("p");d=d.getElementsByTagName("head")[0]||d.documentElement;c.innerHTML="x<style>article,aside,figcaption,figure,footer,header,hgroup,main,nav,section{display:block}mark{background:#FF0;color:#000}</style>"; |
|||
c=d.insertBefore(c.lastChild,d.firstChild);b.hasCSS=!!c}g||t(a,b);return a}var k=l.html5||{},s=/^<|^(?:button|map|select|textarea|object|iframe|option|optgroup)$/i,r=/^(?:a|b|code|div|fieldset|h1|h2|h3|h4|h5|h6|i|label|li|ol|p|q|span|strong|style|table|tbody|td|th|tr|ul)$/i,j,o="_html5shiv",h=0,n={},g;(function(){try{var a=f.createElement("a");a.innerHTML="<xyz></xyz>";j="hidden"in a;var b;if(!(b=1==a.childNodes.length)){f.createElement("a");var c=f.createDocumentFragment();b="undefined"==typeof c.cloneNode|| |
|||
"undefined"==typeof c.createDocumentFragment||"undefined"==typeof c.createElement}g=b}catch(d){g=j=!0}})();var e={elements:k.elements||"abbr article aside audio bdi canvas data datalist details figcaption figure footer header hgroup main mark meter nav output progress section summary time video",version:"3.6.2pre",shivCSS:!1!==k.shivCSS,supportsUnknownElements:g,shivMethods:!1!==k.shivMethods,type:"default",shivDocument:q,createElement:p,createDocumentFragment:function(a,b){a||(a=f);if(g)return a.createDocumentFragment(); |
|||
for(var b=b||i(a),c=b.frag.cloneNode(),d=0,e=m(),h=e.length;d<h;d++)c.createElement(e[d]);return c}};l.html5=e;q(f)})(this,document); |
|||
@ -0,0 +1,8 @@ |
|||
$(function(){ |
|||
//IE8以下に対して角丸やシャドウを適用したいクラスを記述
|
|||
$('.detail_text01,.list_txt01,.container,.btn_m,.app_download_box').each(function() |
|||
{ |
|||
PIE.attach(this); |
|||
$(this).css("position","relative"); |
|||
}); |
|||
}); |
|||
2
themes/nipponalba/static/js/jquery-1.8.3.min.js
File diff suppressed because it is too large
View File
File diff suppressed because it is too large
View File
@ -0,0 +1,12 @@ |
|||
var counter = 10; //当該電子ブックページに遷移するまでのカウントダウン秒数指定
|
|||
document.getElementById("PageJumpCountDown").innerHTML = counter; //初期値の表示
|
|||
var IntervalID = setInterval("CountDown()",1000); |
|||
|
|||
function CountDown(){ |
|||
counter--; |
|||
document.getElementById("PageJumpCountDown").innerHTML = counter; |
|||
if (counter <= 0){ |
|||
clearInterval(IntervalID); |
|||
location.href= "../_SWF_Window.html?pagecode=4"; |
|||
} |
|||
} |
|||
@ -0,0 +1,25 @@ |
|||
function MM_preloadImages() { //v3.0
|
|||
var d=document; if(d.images){ if(!d.MM_p) d.MM_p=new Array(); |
|||
var i,j=d.MM_p.length,a=MM_preloadImages.arguments; for(i=0; i<a.length; i++) |
|||
if (a[i].indexOf("#")!=0){ d.MM_p[j]=new Image; d.MM_p[j++].src=a[i];}} |
|||
} |
|||
|
|||
function MM_swapImgRestore() { //v3.0
|
|||
var i,x,a=document.MM_sr; for(i=0;a&&i<a.length&&(x=a[i])&&x.oSrc;i++) x.src=x.oSrc; |
|||
} |
|||
|
|||
function MM_findObj(n, d) { //v4.0
|
|||
var p,i,x; if(!d) d=document; if((p=n.indexOf("?"))>0&&parent.frames.length) { |
|||
d=parent.frames[n.substring(p+1)].document; n=n.substring(0,p);} |
|||
if(!(x=d[n])&&d.all) x=d.all[n]; for (i=0;!x&&i<d.forms.length;i++) x=d.forms[i][n]; |
|||
for(i=0;!x&&d.layers&&i<d.layers.length;i++) x=MM_findObj(n,d.layers[i].document); |
|||
if(!x && document.getElementById) x=document.getElementById(n); return x; |
|||
} |
|||
|
|||
function MM_swapImage() { //v3.0
|
|||
var i,j=0,x,a=MM_swapImage.arguments; document.MM_sr=new Array; for(i=0;i<(a.length-2);i+=3) |
|||
if ((x=MM_findObj(a[i]))!=null){document.MM_sr[j++]=x; if(!x.oSrc) x.oSrc=x.src; x.src=a[i+2];} |
|||
} |
|||
function MM_openBrWindow(theURL,winName,features) { //v2.0
|
|||
window.open(theURL,winName,features); |
|||
} |
|||
@ -0,0 +1,9 @@ |
|||
if (navigator.userAgent.indexOf('iPad') != -1) { |
|||
location.href = 'ipad.html' + paramStr; |
|||
}else if (navigator.userAgent.indexOf('iPhone') != -1) { |
|||
location.href = 'iphone.html' + paramStr; |
|||
}else if (navigator.userAgent.indexOf('iPod') != -1) { |
|||
location.href = 'iphone.html' + paramStr; |
|||
}else if (navigator.userAgent.indexOf('Android') != -1) { |
|||
location.href = 'android.html' + paramStr; |
|||
} |
|||
@ -0,0 +1,520 @@ |
|||
/** |
|||
* noty - jQuery Notification Plugin v2.0.3 |
|||
* Contributors: https://github.com/needim/noty/graphs/contributors
|
|||
* |
|||
* Examples and Documentation - http://needim.github.com/noty/
|
|||
* |
|||
* Licensed under the MIT licenses: |
|||
* http://www.opensource.org/licenses/mit-license.php
|
|||
* |
|||
**/ |
|||
|
|||
if (typeof Object.create !== 'function') { |
|||
Object.create = function (o) { |
|||
function F() { |
|||
} |
|||
|
|||
F.prototype = o; |
|||
return new F(); |
|||
}; |
|||
} |
|||
|
|||
(function ($) { |
|||
|
|||
var NotyObject = { |
|||
|
|||
init:function (options) { |
|||
|
|||
// Mix in the passed in options with the default options
|
|||
this.options = $.extend({}, $.noty.defaults, options); |
|||
|
|||
this.options.layout = (this.options.custom) ? $.noty.layouts['inline'] : $.noty.layouts[this.options.layout]; |
|||
this.options.theme = $.noty.themes[this.options.theme]; |
|||
|
|||
delete options.layout; |
|||
delete options.theme; |
|||
|
|||
this.options = $.extend({}, this.options, this.options.layout.options); |
|||
this.options.id = 'noty_' + (new Date().getTime() * Math.floor(Math.random() * 1000000)); |
|||
|
|||
this.options = $.extend({}, this.options, options); |
|||
|
|||
// Build the noty dom initial structure
|
|||
this._build(); |
|||
|
|||
// return this so we can chain/use the bridge with less code.
|
|||
return this; |
|||
}, // end init
|
|||
|
|||
_build:function () { |
|||
|
|||
// Generating noty bar
|
|||
var $bar = $('<div class="noty_bar"></div>').attr('id', this.options.id); |
|||
$bar.append(this.options.template).find('.noty_text').html(this.options.text); |
|||
|
|||
this.$bar = (this.options.layout.parent.object !== null) ? $(this.options.layout.parent.object).css(this.options.layout.parent.css).append($bar) : $bar; |
|||
|
|||
// Set buttons if available
|
|||
if (this.options.buttons) { |
|||
|
|||
// If we have button disable closeWith & timeout options
|
|||
this.options.closeWith = []; |
|||
this.options.timeout = false; |
|||
|
|||
var $buttons = $('<div/>').addClass('noty_buttons'); |
|||
|
|||
(this.options.layout.parent.object !== null) ? this.$bar.find('.noty_bar').append($buttons) : this.$bar.append($buttons); |
|||
|
|||
var self = this; |
|||
|
|||
$.each(this.options.buttons, function (i, button) { |
|||
var $button = $('<button/>').addClass((button.addClass) ? button.addClass : 'gray').html(button.text) |
|||
.appendTo(self.$bar.find('.noty_buttons')) |
|||
.bind('click', function () { |
|||
if ($.isFunction(button.onClick)) { |
|||
button.onClick.call($button, self); |
|||
} |
|||
}); |
|||
}); |
|||
} |
|||
|
|||
// For easy access
|
|||
this.$message = this.$bar.find('.noty_message'); |
|||
this.$closeButton = this.$bar.find('.noty_close'); |
|||
this.$buttons = this.$bar.find('.noty_buttons'); |
|||
|
|||
$.noty.store[this.options.id] = this; // store noty for api
|
|||
|
|||
}, // end _build
|
|||
|
|||
show:function () { |
|||
|
|||
var self = this; |
|||
|
|||
$(self.options.layout.container.selector).append(self.$bar); |
|||
|
|||
self.options.theme.style.apply(self); |
|||
|
|||
($.type(self.options.layout.css) === 'function') ? this.options.layout.css.apply(self.$bar) : self.$bar.css(this.options.layout.css || {}); |
|||
|
|||
self.$bar.addClass(self.options.layout.addClass); |
|||
|
|||
self.options.layout.container.style.apply($(self.options.layout.container.selector)); |
|||
|
|||
self.options.theme.callback.onShow.apply(this); |
|||
|
|||
if ($.inArray('click', self.options.closeWith) > -1) |
|||
self.$bar.css('cursor', 'pointer').one('click', function () { |
|||
self.close(); |
|||
}); |
|||
|
|||
if ($.inArray('hover', self.options.closeWith) > -1) |
|||
self.$bar.one('mouseenter', function () { |
|||
self.close(); |
|||
}); |
|||
|
|||
if ($.inArray('button', self.options.closeWith) > -1) |
|||
self.$closeButton.one('click', function () { |
|||
self.close(); |
|||
}); |
|||
|
|||
if ($.inArray('button', self.options.closeWith) == -1) |
|||
self.$closeButton.remove(); |
|||
|
|||
if (self.options.callback.onShow) |
|||
self.options.callback.onShow.apply(self); |
|||
|
|||
self.$bar.animate( |
|||
self.options.animation.open, |
|||
self.options.animation.speed, |
|||
self.options.animation.easing, |
|||
function () { |
|||
if (self.options.callback.afterShow) self.options.callback.afterShow.apply(self); |
|||
self.shown = true; |
|||
}); |
|||
|
|||
// If noty is have a timeout option
|
|||
if (self.options.timeout) |
|||
self.$bar.delay(self.options.timeout).promise().done(function () { |
|||
self.close(); |
|||
}); |
|||
|
|||
return this; |
|||
|
|||
}, // end show
|
|||
|
|||
close:function () { |
|||
|
|||
if (this.closed) return; |
|||
|
|||
var self = this; |
|||
|
|||
if (!this.shown) { // If we are still waiting in the queue just delete from queue
|
|||
var queue = []; |
|||
$.each($.noty.queue, function (i, n) { |
|||
if (n.options.id != self.options.id) { |
|||
queue.push(n); |
|||
} |
|||
}); |
|||
$.noty.queue = queue; |
|||
return; |
|||
} |
|||
|
|||
self.$bar.addClass('i-am-closing-now'); |
|||
|
|||
if (self.options.callback.onClose) { |
|||
self.options.callback.onClose.apply(self); |
|||
} |
|||
|
|||
self.$bar.clearQueue().stop().animate( |
|||
self.options.animation.close, |
|||
self.options.animation.speed, |
|||
self.options.animation.easing, |
|||
function () { |
|||
if (self.options.callback.afterClose) self.options.callback.afterClose.apply(self); |
|||
}) |
|||
.promise().done(function () { |
|||
|
|||
// Modal Cleaning
|
|||
if (self.options.modal) { |
|||
$.notyRenderer.setModalCount(-1); |
|||
if ($.notyRenderer.getModalCount() == 0) $('.noty_modal').fadeOut('fast', function () { |
|||
$(this).remove(); |
|||
}); |
|||
} |
|||
|
|||
// Layout Cleaning
|
|||
$.notyRenderer.setLayoutCountFor(self, -1); |
|||
if ($.notyRenderer.getLayoutCountFor(self) == 0) $(self.options.layout.container.selector).remove(); |
|||
|
|||
// Make sure self.$bar has not been removed before attempting to remove it
|
|||
if (typeof self.$bar !== 'undefined' && self.$bar !== null ) { |
|||
self.$bar.remove(); |
|||
self.$bar = null; |
|||
self.closed = true; |
|||
} |
|||
|
|||
delete $.noty.store[self.options.id]; // deleting noty from store
|
|||
|
|||
self.options.theme.callback.onClose.apply(self); |
|||
|
|||
if (!self.options.dismissQueue) { |
|||
// Queue render
|
|||
$.noty.ontap = true; |
|||
|
|||
$.notyRenderer.render(); |
|||
} |
|||
|
|||
}); |
|||
|
|||
}, // end close
|
|||
|
|||
setText:function (text) { |
|||
if (!this.closed) { |
|||
this.options.text = text; |
|||
this.$bar.find('.noty_text').html(text); |
|||
} |
|||
return this; |
|||
}, |
|||
|
|||
setType:function (type) { |
|||
if (!this.closed) { |
|||
this.options.type = type; |
|||
this.options.theme.style.apply(this); |
|||
this.options.theme.callback.onShow.apply(this); |
|||
} |
|||
return this; |
|||
}, |
|||
|
|||
setTimeout:function (time) { |
|||
if (!this.closed) { |
|||
var self = this; |
|||
this.options.timeout = time; |
|||
self.$bar.delay(self.options.timeout).promise().done(function () { |
|||
self.close(); |
|||
}); |
|||
} |
|||
return this; |
|||
}, |
|||
|
|||
closed:false, |
|||
shown:false |
|||
|
|||
}; // end NotyObject
|
|||
|
|||
$.notyRenderer = {}; |
|||
|
|||
$.notyRenderer.init = function (options) { |
|||
|
|||
// Renderer creates a new noty
|
|||
var notification = Object.create(NotyObject).init(options); |
|||
|
|||
(notification.options.force) ? $.noty.queue.unshift(notification) : $.noty.queue.push(notification); |
|||
|
|||
$.notyRenderer.render(); |
|||
|
|||
return ($.noty.returns == 'object') ? notification : notification.options.id; |
|||
}; |
|||
|
|||
$.notyRenderer.render = function () { |
|||
|
|||
var instance = $.noty.queue[0]; |
|||
|
|||
if ($.type(instance) === 'object') { |
|||
if (instance.options.dismissQueue) { |
|||
$.notyRenderer.show($.noty.queue.shift()); |
|||
} else { |
|||
if ($.noty.ontap) { |
|||
$.notyRenderer.show($.noty.queue.shift()); |
|||
$.noty.ontap = false; |
|||
} |
|||
} |
|||
} else { |
|||
$.noty.ontap = true; // Queue is over
|
|||
} |
|||
|
|||
}; |
|||
|
|||
$.notyRenderer.show = function (notification) { |
|||
|
|||
if (notification.options.modal) { |
|||
$.notyRenderer.createModalFor(notification); |
|||
$.notyRenderer.setModalCount(+1); |
|||
} |
|||
|
|||
// Where is the container?
|
|||
if ($(notification.options.layout.container.selector).length == 0) { |
|||
if (notification.options.custom) { |
|||
notification.options.custom.append($(notification.options.layout.container.object).addClass('i-am-new')); |
|||
} else { |
|||
$('body').append($(notification.options.layout.container.object).addClass('i-am-new')); |
|||
} |
|||
} else { |
|||
$(notification.options.layout.container.selector).removeClass('i-am-new'); |
|||
} |
|||
|
|||
$.notyRenderer.setLayoutCountFor(notification, +1); |
|||
|
|||
notification.show(); |
|||
}; |
|||
|
|||
$.notyRenderer.createModalFor = function (notification) { |
|||
if ($('.noty_modal').length == 0) |
|||
$('<div/>').addClass('noty_modal').data('noty_modal_count', 0).css(notification.options.theme.modal.css).prependTo($('body')).fadeIn('fast'); |
|||
}; |
|||
|
|||
$.notyRenderer.getLayoutCountFor = function (notification) { |
|||
return $(notification.options.layout.container.selector).data('noty_layout_count') || 0; |
|||
}; |
|||
|
|||
$.notyRenderer.setLayoutCountFor = function (notification, arg) { |
|||
return $(notification.options.layout.container.selector).data('noty_layout_count', $.notyRenderer.getLayoutCountFor(notification) + arg); |
|||
}; |
|||
|
|||
$.notyRenderer.getModalCount = function () { |
|||
return $('.noty_modal').data('noty_modal_count') || 0; |
|||
}; |
|||
|
|||
$.notyRenderer.setModalCount = function (arg) { |
|||
return $('.noty_modal').data('noty_modal_count', $.notyRenderer.getModalCount() + arg); |
|||
}; |
|||
|
|||
// This is for custom container
|
|||
$.fn.noty = function (options) { |
|||
options.custom = $(this); |
|||
return $.notyRenderer.init(options); |
|||
}; |
|||
|
|||
$.noty = {}; |
|||
$.noty.queue = []; |
|||
$.noty.ontap = true; |
|||
$.noty.layouts = {}; |
|||
$.noty.themes = {}; |
|||
$.noty.returns = 'object'; |
|||
$.noty.store = {}; |
|||
|
|||
$.noty.get = function (id) { |
|||
return $.noty.store.hasOwnProperty(id) ? $.noty.store[id] : false; |
|||
}; |
|||
|
|||
$.noty.close = function (id) { |
|||
return $.noty.get(id) ? $.noty.get(id).close() : false; |
|||
}; |
|||
|
|||
$.noty.setText = function (id, text) { |
|||
return $.noty.get(id) ? $.noty.get(id).setText(text) : false; |
|||
}; |
|||
|
|||
$.noty.setType = function (id, type) { |
|||
return $.noty.get(id) ? $.noty.get(id).setType(type) : false; |
|||
}; |
|||
|
|||
$.noty.clearQueue = function () { |
|||
$.noty.queue = []; |
|||
}; |
|||
|
|||
$.noty.closeAll = function () { |
|||
$.noty.clearQueue(); |
|||
$.each($.noty.store, function (id, noty) { |
|||
noty.close(); |
|||
}); |
|||
}; |
|||
|
|||
var windowAlert = window.alert; |
|||
|
|||
$.noty.consumeAlert = function (options) { |
|||
window.alert = function (text) { |
|||
if (options) |
|||
options.text = text; |
|||
else |
|||
options = {text:text}; |
|||
|
|||
$.notyRenderer.init(options); |
|||
}; |
|||
}; |
|||
|
|||
$.noty.stopConsumeAlert = function () { |
|||
window.alert = windowAlert; |
|||
}; |
|||
|
|||
$.noty.defaults = { |
|||
layout:'top', |
|||
theme:'defaultTheme', |
|||
type:'alert', |
|||
text:'', |
|||
dismissQueue:true, |
|||
template:'<div class="noty_message"><span class="noty_text"></span><div class="noty_close"></div></div>', |
|||
animation:{ |
|||
open:{height:'toggle'}, |
|||
close:{height:'toggle'}, |
|||
easing:'swing', |
|||
speed:500 |
|||
}, |
|||
timeout:false, |
|||
force:false, |
|||
modal:false, |
|||
closeWith:['click'], |
|||
callback:{ |
|||
onShow:function () { |
|||
}, |
|||
afterShow:function () { |
|||
}, |
|||
onClose:function () { |
|||
}, |
|||
afterClose:function () { |
|||
} |
|||
}, |
|||
buttons:false |
|||
}; |
|||
|
|||
$(window).resize(function () { |
|||
$.each($.noty.layouts, function (index, layout) { |
|||
layout.container.style.apply($(layout.container.selector)); |
|||
}); |
|||
}); |
|||
|
|||
})(jQuery); |
|||
|
|||
// Helpers
|
|||
function noty(options) { |
|||
|
|||
// This is for BC - Will be deleted on v2.2.0
|
|||
var using_old = 0 |
|||
, old_to_new = { |
|||
'animateOpen':'animation.open', |
|||
'animateClose':'animation.close', |
|||
'easing':'animation.easing', |
|||
'speed':'animation.speed', |
|||
'onShow':'callback.onShow', |
|||
'onShown':'callback.afterShow', |
|||
'onClose':'callback.onClose', |
|||
'onClosed':'callback.afterClose' |
|||
}; |
|||
|
|||
jQuery.each(options, function (key, value) { |
|||
if (old_to_new[key]) { |
|||
using_old++; |
|||
var _new = old_to_new[key].split('.'); |
|||
|
|||
if (!options[_new[0]]) options[_new[0]] = {}; |
|||
|
|||
options[_new[0]][_new[1]] = (value) ? value : function () { |
|||
}; |
|||
delete options[key]; |
|||
} |
|||
}); |
|||
|
|||
if (!options.closeWith) { |
|||
options.closeWith = jQuery.noty.defaults.closeWith; |
|||
} |
|||
|
|||
if (options.hasOwnProperty('closeButton')) { |
|||
using_old++; |
|||
if (options.closeButton) options.closeWith.push('button'); |
|||
delete options.closeButton; |
|||
} |
|||
|
|||
if (options.hasOwnProperty('closeOnSelfClick')) { |
|||
using_old++; |
|||
if (options.closeOnSelfClick) options.closeWith.push('click'); |
|||
delete options.closeOnSelfClick; |
|||
} |
|||
|
|||
if (options.hasOwnProperty('closeOnSelfOver')) { |
|||
using_old++; |
|||
if (options.closeOnSelfOver) options.closeWith.push('hover'); |
|||
delete options.closeOnSelfOver; |
|||
} |
|||
|
|||
if (options.hasOwnProperty('custom')) { |
|||
using_old++; |
|||
if (options.custom.container != 'null') options.custom = options.custom.container; |
|||
} |
|||
|
|||
if (options.hasOwnProperty('cssPrefix')) { |
|||
using_old++; |
|||
delete options.cssPrefix; |
|||
} |
|||
|
|||
if (options.theme == 'noty_theme_default') { |
|||
using_old++; |
|||
options.theme = 'defaultTheme'; |
|||
} |
|||
|
|||
if (!options.hasOwnProperty('dismissQueue')) { |
|||
if (options.layout == 'topLeft' |
|||
|| options.layout == 'topRight' |
|||
|| options.layout == 'bottomLeft' |
|||
|| options.layout == 'bottomRight') { |
|||
options.dismissQueue = true; |
|||
} else { |
|||
options.dismissQueue = false; |
|||
} |
|||
} |
|||
|
|||
if (options.buttons) { |
|||
jQuery.each(options.buttons, function (i, button) { |
|||
if (button.click) { |
|||
using_old++; |
|||
button.onClick = button.click; |
|||
delete button.click; |
|||
} |
|||
if (button.type) { |
|||
using_old++; |
|||
button.addClass = button.type; |
|||
delete button.type; |
|||
} |
|||
}); |
|||
} |
|||
|
|||
if (using_old) { |
|||
if (typeof console !== "undefined" && console.warn) { |
|||
console.warn('You are using noty v2 with v1.x.x options. @deprecated until v2.2.0 - Please update your options.'); |
|||
} |
|||
} |
|||
|
|||
// console.log(options);
|
|||
// End of the BC
|
|||
|
|||
return jQuery.notyRenderer.init(options); |
|||
} |
|||
@ -0,0 +1,34 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.bottom = { |
|||
name: 'bottom', |
|||
options: {}, |
|||
container: { |
|||
object: '<ul id="noty_bottom_layout_container" />', |
|||
selector: 'ul#noty_bottom_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
bottom: 0, |
|||
left: '5%', |
|||
position: 'fixed', |
|||
width: '90%', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 9999999 |
|||
}); |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,41 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.bottomCenter = { |
|||
name: 'bottomCenter', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_bottomCenter_layout_container" />', |
|||
selector: 'ul#noty_bottomCenter_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
bottom: 20, |
|||
left: 0, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
$(this).css({ |
|||
left: ($(window).width() - $(this).outerWidth(false)) / 2 + 'px' |
|||
}); |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,43 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.bottomLeft = { |
|||
name: 'bottomLeft', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_bottomLeft_layout_container" />', |
|||
selector: 'ul#noty_bottomLeft_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
bottom: 20, |
|||
left: 20, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
if (window.innerWidth < 600) { |
|||
$(this).css({ |
|||
left: 5 |
|||
}); |
|||
} |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,43 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.bottomRight = { |
|||
name: 'bottomRight', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_bottomRight_layout_container" />', |
|||
selector: 'ul#noty_bottomRight_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
bottom: 20, |
|||
right: 20, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
if (window.innerWidth < 600) { |
|||
$(this).css({ |
|||
right: 5 |
|||
}); |
|||
} |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,56 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.center = { |
|||
name: 'center', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_center_layout_container" />', |
|||
selector: 'ul#noty_center_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
// getting hidden height
|
|||
var dupe = $(this).clone().css({visibility:"hidden", display:"block", position:"absolute", top: 0, left: 0}).attr('id', 'dupe'); |
|||
$("body").append(dupe); |
|||
dupe.find('.i-am-closing-now').remove(); |
|||
dupe.find('li').css('display', 'block'); |
|||
var actual_height = dupe.height(); |
|||
dupe.remove(); |
|||
|
|||
if ($(this).hasClass('i-am-new')) { |
|||
$(this).css({ |
|||
left: ($(window).width() - $(this).outerWidth(false)) / 2 + 'px', |
|||
top: ($(window).height() - actual_height) / 2 + 'px' |
|||
}); |
|||
} else { |
|||
$(this).animate({ |
|||
left: ($(window).width() - $(this).outerWidth(false)) / 2 + 'px', |
|||
top: ($(window).height() - actual_height) / 2 + 'px' |
|||
}, 500); |
|||
} |
|||
|
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,61 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.centerLeft = { |
|||
name: 'centerLeft', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_centerLeft_layout_container" />', |
|||
selector: 'ul#noty_centerLeft_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
left: 20, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
// getting hidden height
|
|||
var dupe = $(this).clone().css({visibility:"hidden", display:"block", position:"absolute", top: 0, left: 0}).attr('id', 'dupe'); |
|||
$("body").append(dupe); |
|||
dupe.find('.i-am-closing-now').remove(); |
|||
dupe.find('li').css('display', 'block'); |
|||
var actual_height = dupe.height(); |
|||
dupe.remove(); |
|||
|
|||
if ($(this).hasClass('i-am-new')) { |
|||
$(this).css({ |
|||
top: ($(window).height() - actual_height) / 2 + 'px' |
|||
}); |
|||
} else { |
|||
$(this).animate({ |
|||
top: ($(window).height() - actual_height) / 2 + 'px' |
|||
}, 500); |
|||
} |
|||
|
|||
if (window.innerWidth < 600) { |
|||
$(this).css({ |
|||
left: 5 |
|||
}); |
|||
} |
|||
|
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,61 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.centerRight = { |
|||
name: 'centerRight', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_centerRight_layout_container" />', |
|||
selector: 'ul#noty_centerRight_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
right: 20, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
// getting hidden height
|
|||
var dupe = $(this).clone().css({visibility:"hidden", display:"block", position:"absolute", top: 0, left: 0}).attr('id', 'dupe'); |
|||
$("body").append(dupe); |
|||
dupe.find('.i-am-closing-now').remove(); |
|||
dupe.find('li').css('display', 'block'); |
|||
var actual_height = dupe.height(); |
|||
dupe.remove(); |
|||
|
|||
if ($(this).hasClass('i-am-new')) { |
|||
$(this).css({ |
|||
top: ($(window).height() - actual_height) / 2 + 'px' |
|||
}); |
|||
} else { |
|||
$(this).animate({ |
|||
top: ($(window).height() - actual_height) / 2 + 'px' |
|||
}, 500); |
|||
} |
|||
|
|||
if (window.innerWidth < 600) { |
|||
$(this).css({ |
|||
right: 5 |
|||
}); |
|||
} |
|||
|
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,31 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.inline = { |
|||
name: 'inline', |
|||
options: {}, |
|||
container: { |
|||
object: '<ul id="noty_inline_layout_container" />', |
|||
selector: 'ul#noty_inline_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
width: '100%', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 9999999 |
|||
}); |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,34 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.top = { |
|||
name: 'top', |
|||
options: {}, |
|||
container: { |
|||
object: '<ul id="noty_top_layout_container" />', |
|||
selector: 'ul#noty_top_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
top: 0, |
|||
left: '5%', |
|||
position: 'fixed', |
|||
width: '90%', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 9999999 |
|||
}); |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,41 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.topCenter = { |
|||
name: 'topCenter', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_topCenter_layout_container" />', |
|||
selector: 'ul#noty_topCenter_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
top: 20, |
|||
left: 0, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
$(this).css({ |
|||
left: ($(window).width() - $(this).outerWidth(false)) / 2 + 'px' |
|||
}); |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,43 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.topLeft = { |
|||
name: 'topLeft', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_topLeft_layout_container" />', |
|||
selector: 'ul#noty_topLeft_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
top: 20, |
|||
left: 20, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
if (window.innerWidth < 600) { |
|||
$(this).css({ |
|||
left: 5 |
|||
}); |
|||
} |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,43 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.layouts.topRight = { |
|||
name: 'topRight', |
|||
options: { // overrides options
|
|||
|
|||
}, |
|||
container: { |
|||
object: '<ul id="noty_topRight_layout_container" />', |
|||
selector: 'ul#noty_topRight_layout_container', |
|||
style: function() { |
|||
$(this).css({ |
|||
top: 20, |
|||
right: 20, |
|||
position: 'fixed', |
|||
width: '310px', |
|||
height: 'auto', |
|||
margin: 0, |
|||
padding: 0, |
|||
listStyleType: 'none', |
|||
zIndex: 10000000 |
|||
}); |
|||
|
|||
if (window.innerWidth < 600) { |
|||
$(this).css({ |
|||
right: 5 |
|||
}); |
|||
} |
|||
} |
|||
}, |
|||
parent: { |
|||
object: '<li />', |
|||
selector: 'li', |
|||
css: {} |
|||
}, |
|||
css: { |
|||
display: 'none', |
|||
width: '310px' |
|||
}, |
|||
addClass: '' |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,432 @@ |
|||
/*! |
|||
* Noty Helpers Javascript From JQuery Javascript Library |
|||
* |
|||
* Ported by Maksim Pecherskiy. Original Licensing: |
|||
* |
|||
* http://jquery.com/
|
|||
* |
|||
* Copyright 2011, John Resig |
|||
* Dual licensed under the MIT or GPL Version 2 licenses. |
|||
* http://jquery.org/license
|
|||
* |
|||
* Includes Sizzle.js |
|||
* http://sizzlejs.com/
|
|||
* Copyright 2011, The Dojo Foundation |
|||
* Released under the MIT, BSD, and GPL Licenses. |
|||
* |
|||
* Date: Mon Nov 21 21:11:03 2011 -0500 |
|||
*/ |
|||
|
|||
|
|||
(function(){ |
|||
|
|||
// String to Object flags format cache
|
|||
var flagsCache = {}; |
|||
|
|||
// Convert String-formatted flags into Object-formatted ones and store in cache
|
|||
function createFlags( flags ) { |
|||
var object = flagsCache[ flags ] = {}, |
|||
i, length; |
|||
flags = flags.split( /\s+/ ); |
|||
for ( i = 0, length = flags.length; i < length; i++ ) { |
|||
object[ flags[i] ] = true; |
|||
} |
|||
return object; |
|||
} |
|||
|
|||
jQuery.extend({ |
|||
|
|||
_mark: function( elem, type ) { |
|||
if ( elem ) { |
|||
type = (type || "fx") + "mark"; |
|||
jQuery.data( elem, type, (jQuery.data(elem,type,undefined,true) || 0) + 1, true ); |
|||
} |
|||
}, |
|||
|
|||
_unmark: function( force, elem, type ) { |
|||
if ( force !== true ) { |
|||
type = elem; |
|||
elem = force; |
|||
force = false; |
|||
} |
|||
if ( elem ) { |
|||
type = type || "fx"; |
|||
var key = type + "mark", |
|||
count = force ? 0 : ( (jQuery.data( elem, key, undefined, true) || 1 ) - 1 ); |
|||
if ( count ) { |
|||
jQuery.data( elem, key, count, true ); |
|||
} else { |
|||
jQuery.removeData( elem, key, true ); |
|||
handleQueueMarkDefer( elem, type, "mark" ); |
|||
} |
|||
} |
|||
}, |
|||
|
|||
queue: function( elem, type, data ) { |
|||
if ( elem ) { |
|||
type = (type || "fx") + "queue"; |
|||
var q = jQuery.data( elem, type, undefined, true ); |
|||
// Speed up dequeue by getting out quickly if this is just a lookup
|
|||
if ( data ) { |
|||
if ( !q || jQuery.isArray(data) ) { |
|||
q = jQuery.data( elem, type, jQuery.makeArray(data), true ); |
|||
} else { |
|||
q.push( data ); |
|||
} |
|||
} |
|||
return q || []; |
|||
} |
|||
}, |
|||
|
|||
dequeue: function( elem, type ) { |
|||
type = type || "fx"; |
|||
|
|||
var queue = jQuery.queue( elem, type ), |
|||
fn = queue.shift(), |
|||
defer; |
|||
|
|||
// If the fx queue is dequeued, always remove the progress sentinel
|
|||
if ( fn === "inprogress" ) { |
|||
fn = queue.shift(); |
|||
} |
|||
|
|||
if ( fn ) { |
|||
// Add a progress sentinel to prevent the fx queue from being
|
|||
// automatically dequeued
|
|||
if ( type === "fx" ) { |
|||
queue.unshift("inprogress"); |
|||
} |
|||
|
|||
fn.call(elem, function() { |
|||
jQuery.dequeue(elem, type); |
|||
}); |
|||
} |
|||
|
|||
if ( !queue.length ) { |
|||
jQuery.removeData( elem, type + "queue", true ); |
|||
handleQueueMarkDefer( elem, type, "queue" ); |
|||
} |
|||
} |
|||
}); |
|||
|
|||
jQuery.fn.extend({ |
|||
queue: function( type, data ) { |
|||
if ( typeof type !== "string" ) { |
|||
data = type; |
|||
type = "fx"; |
|||
} |
|||
|
|||
if ( data === undefined ) { |
|||
return jQuery.queue( this[0], type ); |
|||
} |
|||
return this.each(function() { |
|||
var queue = jQuery.queue( this, type, data ); |
|||
|
|||
if ( type === "fx" && queue[0] !== "inprogress" ) { |
|||
jQuery.dequeue( this, type ); |
|||
} |
|||
}); |
|||
}, |
|||
dequeue: function( type ) { |
|||
return this.each(function() { |
|||
jQuery.dequeue( this, type ); |
|||
}); |
|||
}, |
|||
// Based off of the plugin by Clint Helfers, with permission.
|
|||
// http://blindsignals.com/index.php/2009/07/jquery-delay/
|
|||
delay: function( time, type ) { |
|||
time = jQuery.fx ? jQuery.fx.speeds[time] || time : time; |
|||
type = type || "fx"; |
|||
|
|||
return this.queue( type, function() { |
|||
var elem = this; |
|||
setTimeout(function() { |
|||
jQuery.dequeue( elem, type ); |
|||
}, time ); |
|||
}); |
|||
}, |
|||
clearQueue: function( type ) { |
|||
return this.queue( type || "fx", [] ); |
|||
}, |
|||
// Get a promise resolved when queues of a certain type
|
|||
// are emptied (fx is the type by default)
|
|||
promise: function( type, object ) { |
|||
if ( typeof type !== "string" ) { |
|||
object = type; |
|||
type = undefined; |
|||
} |
|||
type = type || "fx"; |
|||
var defer = jQuery.Deferred(), |
|||
elements = this, |
|||
i = elements.length, |
|||
count = 1, |
|||
deferDataKey = type + "defer", |
|||
queueDataKey = type + "queue", |
|||
markDataKey = type + "mark", |
|||
tmp; |
|||
function resolve() { |
|||
if ( !( --count ) ) { |
|||
defer.resolveWith( elements, [ elements ] ); |
|||
} |
|||
} |
|||
while( i-- ) { |
|||
if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || |
|||
( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || |
|||
jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && |
|||
jQuery.data( elements[ i ], deferDataKey, jQuery._Deferred(), true ) )) { |
|||
count++; |
|||
tmp.done( resolve ); |
|||
} |
|||
} |
|||
resolve(); |
|||
return defer.promise(); |
|||
} |
|||
}); |
|||
|
|||
function handleQueueMarkDefer( elem, type, src ) { |
|||
var deferDataKey = type + "defer", |
|||
queueDataKey = type + "queue", |
|||
markDataKey = type + "mark", |
|||
defer = jQuery._data( elem, deferDataKey ); |
|||
if ( defer && |
|||
( src === "queue" || !jQuery._data(elem, queueDataKey) ) && |
|||
( src === "mark" || !jQuery._data(elem, markDataKey) ) ) { |
|||
// Give room for hard-coded callbacks to fire first
|
|||
// and eventually mark/queue something else on the element
|
|||
setTimeout( function() { |
|||
if ( !jQuery._data( elem, queueDataKey ) && |
|||
!jQuery._data( elem, markDataKey ) ) { |
|||
jQuery.removeData( elem, deferDataKey, true ); |
|||
defer.fire(); |
|||
} |
|||
}, 0 ); |
|||
} |
|||
} |
|||
|
|||
|
|||
|
|||
jQuery.Callbacks = function( flags ) { |
|||
|
|||
// Convert flags from String-formatted to Object-formatted
|
|||
// (we check in cache first)
|
|||
flags = flags ? ( /*flagsCache[ flags ] || */createFlags( flags ) ) : {}; |
|||
|
|||
var // Actual callback list
|
|||
list = [], |
|||
// Stack of fire calls for repeatable lists
|
|||
stack = [], |
|||
// Last fire value (for non-forgettable lists)
|
|||
memory, |
|||
// Flag to know if list is currently firing
|
|||
firing, |
|||
// First callback to fire (used internally by add and fireWith)
|
|||
firingStart, |
|||
// End of the loop when firing
|
|||
firingLength, |
|||
// Index of currently firing callback (modified by remove if needed)
|
|||
firingIndex, |
|||
// Add one or several callbacks to the list
|
|||
add = function( args ) { |
|||
var i, |
|||
length, |
|||
elem, |
|||
type, |
|||
actual; |
|||
for ( i = 0, length = args.length; i < length; i++ ) { |
|||
elem = args[ i ]; |
|||
type = jQuery.type( elem ); |
|||
if ( type === "array" ) { |
|||
// Inspect recursively
|
|||
add( elem ); |
|||
} else if ( type === "function" ) { |
|||
// Add if not in unique mode and callback is not in
|
|||
if ( !flags.unique || !self.has( elem ) ) { |
|||
list.push( elem ); |
|||
} |
|||
} |
|||
} |
|||
}, |
|||
// Fire callbacks
|
|||
fire = function( context, args ) { |
|||
args = args || []; |
|||
memory = !flags.memory || [ context, args ]; |
|||
firing = true; |
|||
firingIndex = firingStart || 0; |
|||
firingStart = 0; |
|||
firingLength = list.length; |
|||
for ( ; list && firingIndex < firingLength; firingIndex++ ) { |
|||
if ( list[ firingIndex ].apply( context, args ) === false && flags.stopOnFalse ) { |
|||
memory = true; // Mark as halted
|
|||
break; |
|||
} |
|||
} |
|||
firing = false; |
|||
if ( list ) { |
|||
if ( !flags.once ) { |
|||
if ( stack && stack.length ) { |
|||
memory = stack.shift(); |
|||
self.fireWith( memory[ 0 ], memory[ 1 ] ); |
|||
} |
|||
} else if ( memory === true ) { |
|||
self.disable(); |
|||
} else { |
|||
list = []; |
|||
} |
|||
} |
|||
}, |
|||
// Actual Callbacks object
|
|||
self = { |
|||
// Add a callback or a collection of callbacks to the list
|
|||
add: function() { |
|||
if ( list ) { |
|||
var length = list.length; |
|||
add( arguments ); |
|||
// Do we need to add the callbacks to the
|
|||
// current firing batch?
|
|||
if ( firing ) { |
|||
firingLength = list.length; |
|||
// With memory, if we're not firing then
|
|||
// we should call right away, unless previous
|
|||
// firing was halted (stopOnFalse)
|
|||
} else if ( memory && memory !== true ) { |
|||
firingStart = length; |
|||
fire( memory[ 0 ], memory[ 1 ] ); |
|||
} |
|||
} |
|||
return this; |
|||
}, |
|||
// Remove a callback from the list
|
|||
remove: function() { |
|||
if ( list ) { |
|||
var args = arguments, |
|||
argIndex = 0, |
|||
argLength = args.length; |
|||
for ( ; argIndex < argLength ; argIndex++ ) { |
|||
for ( var i = 0; i < list.length; i++ ) { |
|||
if ( args[ argIndex ] === list[ i ] ) { |
|||
// Handle firingIndex and firingLength
|
|||
if ( firing ) { |
|||
if ( i <= firingLength ) { |
|||
firingLength--; |
|||
if ( i <= firingIndex ) { |
|||
firingIndex--; |
|||
} |
|||
} |
|||
} |
|||
// Remove the element
|
|||
list.splice( i--, 1 ); |
|||
// If we have some unicity property then
|
|||
// we only need to do this once
|
|||
if ( flags.unique ) { |
|||
break; |
|||
} |
|||
} |
|||
} |
|||
} |
|||
} |
|||
return this; |
|||
}, |
|||
// Control if a given callback is in the list
|
|||
has: function( fn ) { |
|||
if ( list ) { |
|||
var i = 0, |
|||
length = list.length; |
|||
for ( ; i < length; i++ ) { |
|||
if ( fn === list[ i ] ) { |
|||
return true; |
|||
} |
|||
} |
|||
} |
|||
return false; |
|||
}, |
|||
// Remove all callbacks from the list
|
|||
empty: function() { |
|||
list = []; |
|||
return this; |
|||
}, |
|||
// Have the list do nothing anymore
|
|||
disable: function() { |
|||
list = stack = memory = undefined; |
|||
return this; |
|||
}, |
|||
// Is it disabled?
|
|||
disabled: function() { |
|||
return !list; |
|||
}, |
|||
// Lock the list in its current state
|
|||
lock: function() { |
|||
stack = undefined; |
|||
if ( !memory || memory === true ) { |
|||
self.disable(); |
|||
} |
|||
return this; |
|||
}, |
|||
// Is it locked?
|
|||
locked: function() { |
|||
return !stack; |
|||
}, |
|||
// Call all callbacks with the given context and arguments
|
|||
fireWith: function( context, args ) { |
|||
if ( stack ) { |
|||
if ( firing ) { |
|||
if ( !flags.once ) { |
|||
stack.push( [ context, args ] ); |
|||
} |
|||
} else if ( !( flags.once && memory ) ) { |
|||
fire( context, args ); |
|||
} |
|||
} |
|||
return this; |
|||
}, |
|||
// Call all the callbacks with the given arguments
|
|||
fire: function() { |
|||
self.fireWith( this, arguments ); |
|||
return this; |
|||
}, |
|||
// To know if the callbacks have already been called at least once
|
|||
fired: function() { |
|||
return !!memory; |
|||
} |
|||
}; |
|||
|
|||
return self; |
|||
}; |
|||
|
|||
|
|||
|
|||
jQuery.fn.extend({ |
|||
// Get a promise resolved when queues of a certain type
|
|||
// are emptied (fx is the type by default)
|
|||
promise: function( type, object ) { |
|||
if ( typeof type !== "string" ) { |
|||
object = type; |
|||
type = undefined; |
|||
} |
|||
type = type || "fx"; |
|||
var defer = jQuery.Deferred(), |
|||
elements = this, |
|||
i = elements.length, |
|||
count = 1, |
|||
deferDataKey = type + "defer", |
|||
queueDataKey = type + "queue", |
|||
markDataKey = type + "mark", |
|||
tmp; |
|||
function resolve() { |
|||
if ( !( --count ) ) { |
|||
defer.resolveWith( elements, [ elements ] ); |
|||
} |
|||
} |
|||
while( i-- ) { |
|||
if (( tmp = jQuery.data( elements[ i ], deferDataKey, undefined, true ) || |
|||
( jQuery.data( elements[ i ], queueDataKey, undefined, true ) || |
|||
jQuery.data( elements[ i ], markDataKey, undefined, true ) ) && |
|||
jQuery.data( elements[ i ], deferDataKey, jQuery.Callbacks( "once memory" ), true ) )) { |
|||
count++; |
|||
tmp.add( resolve ); |
|||
} |
|||
} |
|||
resolve(); |
|||
return defer.promise(); |
|||
} |
|||
}); |
|||
})(); |
|||
@ -0,0 +1,156 @@ |
|||
;(function($) { |
|||
|
|||
$.noty.themes.defaultTheme = { |
|||
name: 'defaultTheme', |
|||
helpers: { |
|||
borderFix: function() { |
|||
if (this.options.dismissQueue) { |
|||
var selector = this.options.layout.container.selector + ' ' + this.options.layout.parent.selector; |
|||
switch (this.options.layout.name) { |
|||
case 'top': |
|||
$(selector).css({borderRadius: '0px 0px 0px 0px'}); |
|||
$(selector).last().css({borderRadius: '0px 0px 5px 5px'}); break; |
|||
case 'topCenter': case 'topLeft': case 'topRight': |
|||
case 'bottomCenter': case 'bottomLeft': case 'bottomRight': |
|||
case 'center': case 'centerLeft': case 'centerRight': case 'inline': |
|||
$(selector).css({borderRadius: '0px 0px 0px 0px'}); |
|||
$(selector).first().css({'border-top-left-radius': '5px', 'border-top-right-radius': '5px'}); |
|||
$(selector).last().css({'border-bottom-left-radius': '5px', 'border-bottom-right-radius': '5px'}); break; |
|||
case 'bottom': |
|||
$(selector).css({borderRadius: '0px 0px 0px 0px'}); |
|||
$(selector).first().css({borderRadius: '5px 5px 0px 0px'}); break; |
|||
default: break; |
|||
} |
|||
} |
|||
} |
|||
}, |
|||
modal: { |
|||
css: { |
|||
position: 'fixed', |
|||
width: '100%', |
|||
height: '100%', |
|||
backgroundColor: '#000', |
|||
zIndex: 10000, |
|||
opacity: 0.6, |
|||
display: 'none', |
|||
left: 0, |
|||
top: 0 |
|||
} |
|||
}, |
|||
style: function() { |
|||
|
|||
this.$bar.css({ |
|||
overflow: 'hidden', |
|||
background: "url('data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAABsAAAAoCAYAAAAPOoFWAAAAGXRFWHRTb2Z0d2FyZQBBZG9iZSBJbWFnZVJlYWR5ccllPAAAAPZJREFUeNq81tsOgjAMANB2ov7/7ypaN7IlIwi9rGuT8QSc9EIDAsAznxvY4pXPKr05RUE5MEVB+TyWfCEl9LZApYopCmo9C4FKSMtYoI8Bwv79aQJU4l6hXXCZrQbokJEksxHo9KMOgc6w1atHXM8K9DVC7FQnJ0i8iK3QooGgbnyKgMDygBWyYFZoqx4qS27KqLZJjA1D0jK6QJcYEQEiWv9PGkTsbqxQ8oT+ZtZB6AkdsJnQDnMoHXHLGKOgDYuCWmYhEERCI5gaamW0bnHdA3k2ltlIN+2qKRyCND0bhqSYCyTB3CAOc4WusBEIpkeBuPgJMAAX8Hs1NfqHRgAAAABJRU5ErkJggg==') repeat-x scroll left top #fff" |
|||
}); |
|||
|
|||
this.$message.css({ |
|||
fontSize: '13px', |
|||
lineHeight: '16px', |
|||
textAlign: 'center', |
|||
padding: '8px 10px 9px', |
|||
width: 'auto', |
|||
position: 'relative' |
|||
}); |
|||
|
|||
this.$closeButton.css({ |
|||
position: 'absolute', |
|||
top: 4, right: 4, |
|||
width: 10, height: 10, |
|||
background: "url(data:image/png;base64,iVBORw0KGgoAAAANSUhEUgAAAAoAAAAKCAYAAACNMs+9AAAACXBIWXMAAAsTAAALEwEAmpwYAAAKT2lDQ1BQaG90b3Nob3AgSUNDIHByb2ZpbGUAAHjanVNnVFPpFj333vRCS4iAlEtvUhUIIFJCi4AUkSYqIQkQSoghodkVUcERRUUEG8igiAOOjoCMFVEsDIoK2AfkIaKOg6OIisr74Xuja9a89+bN/rXXPues852zzwfACAyWSDNRNYAMqUIeEeCDx8TG4eQuQIEKJHAAEAizZCFz/SMBAPh+PDwrIsAHvgABeNMLCADATZvAMByH/w/qQplcAYCEAcB0kThLCIAUAEB6jkKmAEBGAYCdmCZTAKAEAGDLY2LjAFAtAGAnf+bTAICd+Jl7AQBblCEVAaCRACATZYhEAGg7AKzPVopFAFgwABRmS8Q5ANgtADBJV2ZIALC3AMDOEAuyAAgMADBRiIUpAAR7AGDIIyN4AISZABRG8lc88SuuEOcqAAB4mbI8uSQ5RYFbCC1xB1dXLh4ozkkXKxQ2YQJhmkAuwnmZGTKBNA/g88wAAKCRFRHgg/P9eM4Ors7ONo62Dl8t6r8G/yJiYuP+5c+rcEAAAOF0ftH+LC+zGoA7BoBt/qIl7gRoXgugdfeLZrIPQLUAoOnaV/Nw+H48PEWhkLnZ2eXk5NhKxEJbYcpXff5nwl/AV/1s+X48/Pf14L7iJIEyXYFHBPjgwsz0TKUcz5IJhGLc5o9H/LcL//wd0yLESWK5WCoU41EScY5EmozzMqUiiUKSKcUl0v9k4t8s+wM+3zUAsGo+AXuRLahdYwP2SycQWHTA4vcAAPK7b8HUKAgDgGiD4c93/+8//UegJQCAZkmScQAAXkQkLlTKsz/HCAAARKCBKrBBG/TBGCzABhzBBdzBC/xgNoRCJMTCQhBCCmSAHHJgKayCQiiGzbAdKmAv1EAdNMBRaIaTcA4uwlW4Dj1wD/phCJ7BKLyBCQRByAgTYSHaiAFiilgjjggXmYX4IcFIBBKLJCDJiBRRIkuRNUgxUopUIFVIHfI9cgI5h1xGupE7yAAygvyGvEcxlIGyUT3UDLVDuag3GoRGogvQZHQxmo8WoJvQcrQaPYw2oefQq2gP2o8+Q8cwwOgYBzPEbDAuxsNCsTgsCZNjy7EirAyrxhqwVqwDu4n1Y8+xdwQSgUXACTYEd0IgYR5BSFhMWE7YSKggHCQ0EdoJNwkDhFHCJyKTqEu0JroR+cQYYjIxh1hILCPWEo8TLxB7iEPENyQSiUMyJ7mQAkmxpFTSEtJG0m5SI+ksqZs0SBojk8naZGuyBzmULCAryIXkneTD5DPkG+Qh8lsKnWJAcaT4U+IoUspqShnlEOU05QZlmDJBVaOaUt2ooVQRNY9aQq2htlKvUYeoEzR1mjnNgxZJS6WtopXTGmgXaPdpr+h0uhHdlR5Ol9BX0svpR+iX6AP0dwwNhhWDx4hnKBmbGAcYZxl3GK+YTKYZ04sZx1QwNzHrmOeZD5lvVVgqtip8FZHKCpVKlSaVGyovVKmqpqreqgtV81XLVI+pXlN9rkZVM1PjqQnUlqtVqp1Q61MbU2epO6iHqmeob1Q/pH5Z/YkGWcNMw09DpFGgsV/jvMYgC2MZs3gsIWsNq4Z1gTXEJrHN2Xx2KruY/R27iz2qqaE5QzNKM1ezUvOUZj8H45hx+Jx0TgnnKKeX836K3hTvKeIpG6Y0TLkxZVxrqpaXllirSKtRq0frvTau7aedpr1Fu1n7gQ5Bx0onXCdHZ4/OBZ3nU9lT3acKpxZNPTr1ri6qa6UbobtEd79up+6Ynr5egJ5Mb6feeb3n+hx9L/1U/W36p/VHDFgGswwkBtsMzhg8xTVxbzwdL8fb8VFDXcNAQ6VhlWGX4YSRudE8o9VGjUYPjGnGXOMk423GbcajJgYmISZLTepN7ppSTbmmKaY7TDtMx83MzaLN1pk1mz0x1zLnm+eb15vft2BaeFostqi2uGVJsuRaplnutrxuhVo5WaVYVVpds0atna0l1rutu6cRp7lOk06rntZnw7Dxtsm2qbcZsOXYBtuutm22fWFnYhdnt8Wuw+6TvZN9un2N/T0HDYfZDqsdWh1+c7RyFDpWOt6azpzuP33F9JbpL2dYzxDP2DPjthPLKcRpnVOb00dnF2e5c4PziIuJS4LLLpc+Lpsbxt3IveRKdPVxXeF60vWdm7Obwu2o26/uNu5p7ofcn8w0nymeWTNz0MPIQ+BR5dE/C5+VMGvfrH5PQ0+BZ7XnIy9jL5FXrdewt6V3qvdh7xc+9j5yn+M+4zw33jLeWV/MN8C3yLfLT8Nvnl+F30N/I/9k/3r/0QCngCUBZwOJgUGBWwL7+Hp8Ib+OPzrbZfay2e1BjKC5QRVBj4KtguXBrSFoyOyQrSH355jOkc5pDoVQfujW0Adh5mGLw34MJ4WHhVeGP45wiFga0TGXNXfR3ENz30T6RJZE3ptnMU85ry1KNSo+qi5qPNo3ujS6P8YuZlnM1VidWElsSxw5LiquNm5svt/87fOH4p3iC+N7F5gvyF1weaHOwvSFpxapLhIsOpZATIhOOJTwQRAqqBaMJfITdyWOCnnCHcJnIi/RNtGI2ENcKh5O8kgqTXqS7JG8NXkkxTOlLOW5hCepkLxMDUzdmzqeFpp2IG0yPTq9MYOSkZBxQqohTZO2Z+pn5mZ2y6xlhbL+xW6Lty8elQfJa7OQrAVZLQq2QqboVFoo1yoHsmdlV2a/zYnKOZarnivN7cyzytuQN5zvn//tEsIS4ZK2pYZLVy0dWOa9rGo5sjxxedsK4xUFK4ZWBqw8uIq2Km3VT6vtV5eufr0mek1rgV7ByoLBtQFr6wtVCuWFfevc1+1dT1gvWd+1YfqGnRs+FYmKrhTbF5cVf9go3HjlG4dvyr+Z3JS0qavEuWTPZtJm6ebeLZ5bDpaql+aXDm4N2dq0Dd9WtO319kXbL5fNKNu7g7ZDuaO/PLi8ZafJzs07P1SkVPRU+lQ27tLdtWHX+G7R7ht7vPY07NXbW7z3/T7JvttVAVVN1WbVZftJ+7P3P66Jqun4lvttXa1ObXHtxwPSA/0HIw6217nU1R3SPVRSj9Yr60cOxx++/p3vdy0NNg1VjZzG4iNwRHnk6fcJ3/ceDTradox7rOEH0x92HWcdL2pCmvKaRptTmvtbYlu6T8w+0dbq3nr8R9sfD5w0PFl5SvNUyWna6YLTk2fyz4ydlZ19fi753GDborZ752PO32oPb++6EHTh0kX/i+c7vDvOXPK4dPKy2+UTV7hXmq86X23qdOo8/pPTT8e7nLuarrlca7nuer21e2b36RueN87d9L158Rb/1tWeOT3dvfN6b/fF9/XfFt1+cif9zsu72Xcn7q28T7xf9EDtQdlD3YfVP1v+3Njv3H9qwHeg89HcR/cGhYPP/pH1jw9DBY+Zj8uGDYbrnjg+OTniP3L96fynQ89kzyaeF/6i/suuFxYvfvjV69fO0ZjRoZfyl5O/bXyl/erA6xmv28bCxh6+yXgzMV70VvvtwXfcdx3vo98PT+R8IH8o/2j5sfVT0Kf7kxmTk/8EA5jz/GMzLdsAAAAgY0hSTQAAeiUAAICDAAD5/wAAgOkAAHUwAADqYAAAOpgAABdvkl/FRgAAATpJREFUeNoszrFqVFEUheG19zlz7sQ7ijMQBAvfYBqbpJCoZSAQbOwEE1IHGytbLQUJ8SUktW8gCCFJMSGSNxCmFBJO7j5rpXD6n5/P5vM53H3b3T9LOiB5AQDuDjM7BnA7DMPHDGBH0nuSzwHsRcRVRNRSysuU0i6AOwA/02w2+9Fae00SEbEh6SGAR5K+k3zWWptKepCm0+kpyRoRGyRBcpPkDsn1iEBr7drdP2VJZyQXERGSPpiZAViTBACXKaV9kqd5uVzCzO5KKb/d/UZSDwD/eyxqree1VqSu6zKAF2Z2RPJJaw0rAkjOJT0m+SuT/AbgDcmnkmBmfwAsJL1dXQ8lWY6IGwB1ZbrOOb8zs8thGP4COFwx/mE8Ho9Go9ErMzvJOW/1fY/JZIJSypqZfXX3L13X9fcDAKJct1sx3OiuAAAAAElFTkSuQmCC)", |
|||
display: 'none', |
|||
cursor: 'pointer' |
|||
}); |
|||
|
|||
this.$buttons.css({ |
|||
padding: 5, |
|||
textAlign: 'right', |
|||
borderTop: '1px solid #ccc', |
|||
backgroundColor: '#fff' |
|||
}); |
|||
|
|||
this.$buttons.find('button').css({ |
|||
marginLeft: 5 |
|||
}); |
|||
|
|||
this.$buttons.find('button:first').css({ |
|||
marginLeft: 0 |
|||
}); |
|||
|
|||
this.$bar.bind({ |
|||
mouseenter: function() { $(this).find('.noty_close').fadeIn(); }, |
|||
mouseleave: function() { $(this).find('.noty_close').fadeOut(); } |
|||
}); |
|||
|
|||
switch (this.options.layout.name) { |
|||
case 'top': |
|||
this.$bar.css({ |
|||
borderRadius: '0px 0px 5px 5px', |
|||
borderBottom: '2px solid #eee', |
|||
borderLeft: '2px solid #eee', |
|||
borderRight: '2px solid #eee', |
|||
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)" |
|||
}); |
|||
break; |
|||
case 'topCenter': case 'center': case 'bottomCenter': case 'inline': |
|||
this.$bar.css({ |
|||
borderRadius: '5px', |
|||
border: '1px solid #eee', |
|||
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)" |
|||
}); |
|||
this.$message.css({fontSize: '13px', textAlign: 'center'}); |
|||
break; |
|||
case 'topLeft': case 'topRight': |
|||
case 'bottomLeft': case 'bottomRight': |
|||
case 'centerLeft': case 'centerRight': |
|||
this.$bar.css({ |
|||
borderRadius: '5px', |
|||
border: '1px solid #eee', |
|||
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)" |
|||
}); |
|||
this.$message.css({fontSize: '13px', textAlign: 'left'}); |
|||
break; |
|||
case 'bottom': |
|||
this.$bar.css({ |
|||
borderRadius: '5px 5px 0px 0px', |
|||
borderTop: '2px solid #eee', |
|||
borderLeft: '2px solid #eee', |
|||
borderRight: '2px solid #eee', |
|||
boxShadow: "0 -2px 4px rgba(0, 0, 0, 0.1)" |
|||
}); |
|||
break; |
|||
default: |
|||
this.$bar.css({ |
|||
border: '2px solid #eee', |
|||
boxShadow: "0 2px 4px rgba(0, 0, 0, 0.1)" |
|||
}); |
|||
break; |
|||
} |
|||
|
|||
switch (this.options.type) { |
|||
case 'alert': case 'notification': |
|||
this.$bar.css({backgroundColor: '#FFF', borderColor: '#CCC', color: '#444'}); break; |
|||
case 'warning': |
|||
this.$bar.css({backgroundColor: '#FFFFCC', borderColor: '#FFC237', color: '#826200'}); |
|||
this.$buttons.css({borderTop: '1px solid #FFC237'}); break; |
|||
case 'error': |
|||
this.$bar.css({backgroundColor: 'red', borderColor: 'darkred', color: '#FFF'}); |
|||
this.$message.css({fontWeight: 'bold'}); |
|||
this.$buttons.css({borderTop: '1px solid darkred'}); break; |
|||
case 'information': |
|||
this.$bar.css({backgroundColor: '#57B7E2', borderColor: '#0B90C4', color: '#FFF'}); |
|||
this.$buttons.css({borderTop: '1px solid #0B90C4'}); break; |
|||
case 'success': |
|||
this.$bar.css({backgroundColor: 'lightgreen', borderColor: '#50C24E', color: 'darkgreen'}); |
|||
this.$buttons.css({borderTop: '1px solid #50C24E'});break; |
|||
default: |
|||
this.$bar.css({backgroundColor: '#FFF', borderColor: '#CCC', color: '#444'}); break; |
|||
} |
|||
}, |
|||
callback: { |
|||
onShow: function() { $.noty.themes.defaultTheme.helpers.borderFix.apply(this); }, |
|||
onClose: function() { $.noty.themes.defaultTheme.helpers.borderFix.apply(this); } |
|||
} |
|||
}; |
|||
|
|||
})(jQuery); |
|||
@ -0,0 +1,52 @@ |
|||
//ページ指定クエリ付きのアクセスが有った時にアプリを開くボタンにクエリを適用を定義
|
|||
var prmStr = window.location.search; |
|||
var pagecode = -1; |
|||
var sid = -1; |
|||
var encrypted = 0; |
|||
|
|||
if(prmStr != ""){ |
|||
prmStr = prmStr.substring(1); |
|||
var prmArr = prmStr.split("&"); |
|||
for(var i=0; i < prmArr.length; i++){ |
|||
var prmKey = prmArr[i].split("=")[0]; |
|||
switch(prmKey){ |
|||
case "pagecode": |
|||
pagecode = prmArr[i].split("=")[1]; |
|||
break; |
|||
case "sid": |
|||
sid = prmArr[i].split("=")[1]; |
|||
break; |
|||
} |
|||
} |
|||
var hrefStr = ""; |
|||
if(pagecode != -1){ |
|||
hrefStr += "&pageno="+pagecode; |
|||
} |
|||
if(sid != -1){ |
|||
hrefStr += "&sid="+sid; |
|||
} |
|||
|
|||
var objAppLink = document.getElementById("applink"); |
|||
var objAppLink02 = document.getElementById("applink02"); |
|||
if(objAppLink != null && objAppLink.href.indexOf('actibook:///') != -1){ |
|||
objAppLink.href += hrefStr; |
|||
|
|||
} |
|||
if(objAppLink02 != null && objAppLink02.href.indexOf('actibook:///') != -1){ |
|||
objAppLink02.href += hrefStr; |
|||
|
|||
} |
|||
} |
|||
|
|||
|
|||
function preOpenMain(){ |
|||
if(pagecode != -1 && sid != -1){ |
|||
WindowOpenMain(1000,670,'_blank',{'resizable':'yes','pagecode':pagecode,'sid':sid}); |
|||
}else if(pagecode == -1 && sid != -1){ |
|||
WindowOpenMain(1000,670,'_blank',{'resizable':'yes','sid':sid}); |
|||
}else if(pagecode != -1 && sid == -1){ |
|||
WindowOpenMain(1000,670,'_blank',{'resizable':'yes','pagecode':pagecode}); |
|||
}else{ |
|||
WindowOpenMain(1000,670,'_blank',{'resizable':'yes'}); |
|||
} |
|||
} |
|||
@ -0,0 +1,172 @@ |
|||
|
|||
var isIE = (navigator.appVersion.indexOf("MSIE") != -1) ? true : false; |
|||
var isWin = (navigator.appVersion.toLowerCase().indexOf("win") != -1) ? true : false; |
|||
var isOpera = (navigator.userAgent.indexOf("Opera") != -1) ? true : false; |
|||
|
|||
function ControlVersion() |
|||
{ |
|||
var version; |
|||
var axo; |
|||
var e; |
|||
// NOTE : new ActiveXObject(strFoo) throws an exception if strFoo isn't in the registry
|
|||
try { |
|||
// version will be set for 7.X or greater players
|
|||
axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash.7"); |
|||
version = axo.GetVariable("$version"); |
|||
} catch (e) { |
|||
} |
|||
if (!version) |
|||
{ |
|||
try { |
|||
// version will be set for 6.X players only
|
|||
axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash.6"); |
|||
|
|||
// installed player is some revision of 6.0
|
|||
// GetVariable("$version") crashes for versions 6.0.22 through 6.0.29,
|
|||
// so we have to be careful.
|
|||
|
|||
// default to the first public version
|
|||
version = "WIN 6,0,21,0"; |
|||
// throws if AllowScripAccess does not exist (introduced in 6.0r47)
|
|||
axo.AllowScriptAccess = "always"; |
|||
// safe to call for 6.0r47 or greater
|
|||
version = axo.GetVariable("$version"); |
|||
} catch (e) { |
|||
} |
|||
} |
|||
if (!version) |
|||
{ |
|||
try { |
|||
// version will be set for 4.X or 5.X player
|
|||
axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash.3"); |
|||
version = axo.GetVariable("$version"); |
|||
} catch (e) { |
|||
} |
|||
} |
|||
if (!version) |
|||
{ |
|||
try { |
|||
// version will be set for 3.X player
|
|||
axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash.3"); |
|||
version = "WIN 3,0,18,0"; |
|||
} catch (e) { |
|||
} |
|||
} |
|||
if (!version) |
|||
{ |
|||
try { |
|||
// version will be set for 2.X player
|
|||
axo = new ActiveXObject("ShockwaveFlash.ShockwaveFlash"); |
|||
version = "WIN 2,0,0,11"; |
|||
} catch (e) { |
|||
version = -1; |
|||
} |
|||
} |
|||
|
|||
return version; |
|||
} |
|||
// JavaScript helper required to detect Flash Player PlugIn version information
|
|||
function GetSwfVer(){ |
|||
// NS/Opera version >= 3 check for Flash plugin in plugin array
|
|||
var flashVer = -1; |
|||
|
|||
if (navigator.plugins != null && navigator.plugins.length > 0) { |
|||
if (navigator.plugins["Shockwave Flash 2.0"] || navigator.plugins["Shockwave Flash"]) { |
|||
var swVer2 = navigator.plugins["Shockwave Flash 2.0"] ? " 2.0" : ""; |
|||
var flashDescription = navigator.plugins["Shockwave Flash" + swVer2].description; |
|||
var descArray = flashDescription.split(" "); |
|||
var tempArrayMajor = descArray[2].split("."); |
|||
var versionMajor = tempArrayMajor[0]; |
|||
var versionMinor = tempArrayMajor[1]; |
|||
var versionRevision = descArray[3]; |
|||
if (versionRevision == "") { |
|||
versionRevision = descArray[4]; |
|||
} |
|||
if (versionRevision[0] == "d") { |
|||
versionRevision = versionRevision.substring(1); |
|||
} else if (versionRevision[0] == "r") { |
|||
versionRevision = versionRevision.substring(1); |
|||
if (versionRevision.indexOf("d") > 0) { |
|||
versionRevision = versionRevision.substring(0, versionRevision.indexOf("d")); |
|||
} |
|||
} |
|||
var flashVer = versionMajor + "." + versionMinor + "." + versionRevision; |
|||
} |
|||
} |
|||
// MSN/WebTV 2.6 supports Flash 4
|
|||
else if (navigator.userAgent.toLowerCase().indexOf("webtv/2.6") != -1) flashVer = 4; |
|||
// WebTV 2.5 supports Flash 3
|
|||
else if (navigator.userAgent.toLowerCase().indexOf("webtv/2.5") != -1) flashVer = 3; |
|||
// older WebTV supports Flash 2
|
|||
else if (navigator.userAgent.toLowerCase().indexOf("webtv") != -1) flashVer = 2; |
|||
else if ( isIE && isWin && !isOpera ) { |
|||
flashVer = ControlVersion(); |
|||
} |
|||
return flashVer; |
|||
} |
|||
// When called with reqMajorVer, reqMinorVer, reqRevision returns true if that version or greater is available
|
|||
function DetectFlashVer(reqMajorVer, reqMinorVer, reqRevision) |
|||
{ |
|||
versionStr = GetSwfVer(); |
|||
|
|||
if (versionStr == -1 ) { |
|||
return false; |
|||
} else if (versionStr != 0) { |
|||
if(isIE && isWin && !isOpera) { |
|||
// Given "WIN 2,0,0,11"
|
|||
tempArray = versionStr.split(" "); // ["WIN", "2,0,0,11"]
|
|||
tempString = tempArray[1]; // "2,0,0,11"
|
|||
versionArray = tempString.split(","); // ['2', '0', '0', '11']
|
|||
} else { |
|||
versionArray = versionStr.split("."); |
|||
} |
|||
var versionMajor = versionArray[0]; |
|||
var versionMinor = versionArray[1]; |
|||
var versionRevision = versionArray[2]; |
|||
// is the major.revision >= requested major.revision AND the minor version >= requested minor
|
|||
if (versionMajor > parseFloat(reqMajorVer)) { |
|||
return true; |
|||
} else if (versionMajor == parseFloat(reqMajorVer)) { |
|||
if (versionMinor > parseFloat(reqMinorVer)) |
|||
return true; |
|||
else if (versionMinor == parseFloat(reqMinorVer)) { |
|||
if (versionRevision >= parseFloat(reqRevision)) |
|||
return true; |
|||
} |
|||
} |
|||
return false; |
|||
} |
|||
} |
|||
|
|||
function doProtect() |
|||
{ |
|||
if(isIE){ |
|||
if(DetectFlashVer(10, 0, 0)){ |
|||
document.write('<object classid="clsid:d27cdb6e-ae6d-11cf-96b8-444553540000" codebase="http://download.macromedia.com/pub/shockwave/cabs/flash/swflash.cab#version=10,0,0,0" width="0" height="0" id="protector" align="middle">'); |
|||
document.write('<param name="allowScriptAccess" value="sameDomain" />'); |
|||
document.write('<param name="allowFullScreen" value="false" />'); |
|||
document.write('<param name="movie" value="protector.swf" />'); |
|||
document.write('<param name="quality" value="high" />'); |
|||
document.write('<param name="bgcolor" value="#ffffff" />'); |
|||
document.write('</object>'); |
|||
} |
|||
}else{ |
|||
if(DetectFlashVer(10, 0, 0)){ |
|||
document.write('<embed id="protector"'); |
|||
document.write(' pluginspage="http://www.macromedia.com/go/getflashplayer"'); |
|||
document.write(' allowScriptAccess="sameDomain"'); |
|||
document.write(' width="0"'); |
|||
document.write(' height="0"'); |
|||
document.write(' align="middle"'); |
|||
document.write(' type="application/x-shockwave-flash"'); |
|||
document.write(' src="protector.swf"'); |
|||
document.write(' bgcolor="#E1E1E1"'); |
|||
document.write(' scale="exactfit"'); |
|||
document.write(' wmode="Window"'); |
|||
document.write('></embed>'); |
|||
} |
|||
} |
|||
} |
|||
|
|||
doProtect(); |
|||
|
|||
@ -0,0 +1,5 @@ |
|||
/*! |
|||
* selectivizr v1.0.2 - (c) Keith Clark, freely distributable under the terms of the MIT license. |
|||
* selectivizr.com |
|||
*/ |
|||
(function(j){function A(a){return a.replace(B,h).replace(C,function(a,d,b){for(var a=b.split(","),b=0,e=a.length;b<e;b++){var s=D(a[b].replace(E,h).replace(F,h))+o,l=[];a[b]=s.replace(G,function(a,b,c,d,e){if(b){if(l.length>0){var a=l,f,e=s.substring(0,e).replace(H,i);if(e==i||e.charAt(e.length-1)==o)e+="*";try{f=t(e)}catch(k){}if(f){e=0;for(c=f.length;e<c;e++){for(var d=f[e],h=d.className,j=0,m=a.length;j<m;j++){var g=a[j];if(!RegExp("(^|\\s)"+g.className+"(\\s|$)").test(d.className)&&g.b&&(g.b===!0||g.b(d)===!0))h=u(h,g.className,!0)}d.className=h}}l=[]}return b}else{if(b=c?I(c):!v||v.test(d)?{className:w(d),b:!0}:null)return l.push(b),"."+b.className;return a}})}return d+a.join(",")})}function I(a){var c=!0,d=w(a.slice(1)),b=a.substring(0,5)==":not(",e,f;b&&(a=a.slice(5,-1));var l=a.indexOf("(");l>-1&&(a=a.substring(0,l));if(a.charAt(0)==":")switch(a.slice(1)){case "root":c=function(a){return b?a!=p:a==p};break;case "target":if(m==8){c=function(a){function c(){var d=location.hash,e=d.slice(1);return b?d==i||a.id!=e:d!=i&&a.id==e}k(j,"hashchange",function(){g(a,d,c())});return c()};break}return!1;case "checked":c=function(a){J.test(a.type)&&k(a,"propertychange",function(){event.propertyName=="checked"&&g(a,d,a.checked!==b)});return a.checked!==b};break;case "disabled":b=!b;case "enabled":c=function(c){if(K.test(c.tagName))return k(c,"propertychange",function(){event.propertyName=="$disabled"&&g(c,d,c.a===b)}),q.push(c),c.a=c.disabled,c.disabled===b;return a==":enabled"?b:!b};break;case "focus":e="focus",f="blur";case "hover":e||(e="mouseenter",f="mouseleave");c=function(a){k(a,b?f:e,function(){g(a,d,!0)});k(a,b?e:f,function(){g(a,d,!1)});return b};break;default:if(!L.test(a))return!1}return{className:d,b:c}}function w(a){return M+"-"+(m==6&&N?O++:a.replace(P,function(a){return a.charCodeAt(0)}))}function D(a){return a.replace(x,h).replace(Q,o)}function g(a,c,d){var b=a.className,c=u(b,c,d);if(c!=b)a.className=c,a.parentNode.className+=i}function u(a,c,d){var b=RegExp("(^|\\s)"+c+"(\\s|$)"),e=b.test(a);return d?e?a:a+o+c:e?a.replace(b,h).replace(x,h):a}function k(a,c,d){a.attachEvent("on"+c,d)}function r(a,c){if(/^https?:\/\//i.test(a))return c.substring(0,c.indexOf("/",8))==a.substring(0,a.indexOf("/",8))?a:null;if(a.charAt(0)=="/")return c.substring(0,c.indexOf("/",8))+a;var d=c.split(/[?#]/)[0];a.charAt(0)!="?"&&d.charAt(d.length-1)!="/"&&(d=d.substring(0,d.lastIndexOf("/")+1));return d+a}function y(a){if(a)return n.open("GET",a,!1),n.send(),(n.status==200?n.responseText:i).replace(R,i).replace(S,function(c,d,b,e,f){return y(r(b||f,a))}).replace(T,function(c,d,b){d=d||i;return" url("+d+r(b,a)+d+") "});return i}function U(){var a,c;a=f.getElementsByTagName("BASE");for(var d=a.length>0?a[0].href:f.location.href,b=0;b<f.styleSheets.length;b++)if(c=f.styleSheets[b],c.href!=i&&(a=r(c.href,d)))c.cssText=A(y(a));q.length>0&&setInterval(function(){for(var a=0,c=q.length;a<c;a++){var b=q[a];if(b.disabled!==b.a)b.disabled?(b.disabled=!1,b.a=!0,b.disabled=!0):b.a=b.disabled}},250)}if(!/*@cc_on!@*/true){var f=document,p=f.documentElement,n=function(){if(j.XMLHttpRequest)return new XMLHttpRequest;try{return new ActiveXObject("Microsoft.XMLHTTP")}catch(a){return null}}(),m=/MSIE (\d+)/.exec(navigator.userAgent)[1];if(!(f.compatMode!="CSS1Compat"||m<6||m>8||!n)){var z={NW:"*.Dom.select",MooTools:"$$",DOMAssistant:"*.$",Prototype:"$$",YAHOO:"*.util.Selector.query",Sizzle:"*",jQuery:"*",dojo:"*.query"},t,q=[],O=0,N=!0,M="slvzr",R=/(\/\*[^*]*\*+([^\/][^*]*\*+)*\/)\s*/g,S=/@import\s*(?:(?:(?:url\(\s*(['"]?)(.*)\1)\s*\))|(?:(['"])(.*)\3))[^;]*;/g,T=/\burl\(\s*(["']?)(?!data:)([^"')]+)\1\s*\)/g,L=/^:(empty|(first|last|only|nth(-last)?)-(child|of-type))$/,B=/:(:first-(?:line|letter))/g,C=/(^|})\s*([^\{]*?[\[:][^{]+)/g,G=/([ +~>])|(:[a-z-]+(?:\(.*?\)+)?)|(\[.*?\])/g,H=/(:not\()?:(hover|enabled|disabled|focus|checked|target|active|visited|first-line|first-letter)\)?/g,P=/[^\w-]/g,K=/^(INPUT|SELECT|TEXTAREA|BUTTON)$/,J=/^(checkbox|radio)$/,v=m>6?/[\$\^*]=(['"])\1/:null,E=/([(\[+~])\s+/g,F=/\s+([)\]+~])/g,Q=/\s+/g,x=/^\s*((?:[\S\s]*\S)?)\s*$/,i="",o=" ",h="$1";(function(a,c){function d(){try{p.doScroll("left")}catch(a){setTimeout(d,50);return}b("poll")}function b(d){if(!(d.type=="readystatechange"&&f.readyState!="complete")&&((d.type=="load"?a:f).detachEvent("on"+d.type,b,!1),!e&&(e=!0)))c.call(a,d.type||d)}var e=!1,g=!0;if(f.readyState=="complete")c.call(a,i);else{if(f.createEventObject&&p.doScroll){try{g=!a.frameElement}catch(h){}g&&d()}k(f,"readystatechange",b);k(a,"load",b)}})(j,function(){for(var a in z){var c,d,b=j;if(j[a]){for(c=z[a].replace("*",a).split(".");(d=c.shift())&&(b=b[d]););if(typeof b=="function"){t=b;U();break}}}})}}})(this); |
|||
@ -0,0 +1,144 @@ |
|||
/* Smooth scrolling |
|||
Changes links that link to other parts of this page to scroll |
|||
smoothly to those links rather than jump to them directly, which |
|||
can be a little disorienting. |
|||
|
|||
sil, http://www.kryogenix.org/
|
|||
|
|||
v1.0 2003-11-11 |
|||
v1.1 2005-06-16 wrap it up in an object |
|||
*/ |
|||
|
|||
var ss = { |
|||
fixAllLinks: function() { |
|||
// Get a list of all links in the page
|
|||
var allLinks = document.getElementsByTagName('a'); |
|||
// Walk through the list
|
|||
for (var i=0;i<allLinks.length;i++) { |
|||
var lnk = allLinks[i]; |
|||
if ((lnk.href && lnk.href.indexOf('#') != -1) && |
|||
( (lnk.pathname == location.pathname) || |
|||
('/'+lnk.pathname == location.pathname) ) && |
|||
(lnk.search == location.search)) { |
|||
// If the link is internal to the page (begins in #)
|
|||
// then attach the smoothScroll function as an onclick
|
|||
// event handler
|
|||
ss.addEvent(lnk,'click',ss.smoothScroll); |
|||
} |
|||
} |
|||
}, |
|||
|
|||
smoothScroll: function(e) { |
|||
// This is an event handler; get the clicked on element,
|
|||
// in a cross-browser fashion
|
|||
if (window.event) { |
|||
target = window.event.srcElement; |
|||
} else if (e) { |
|||
target = e.target; |
|||
} else return; |
|||
|
|||
// Make sure that the target is an element, not a text node
|
|||
// within an element
|
|||
if (target.nodeName.toLowerCase() != 'a') { |
|||
target = target.parentNode; |
|||
} |
|||
|
|||
// Paranoia; check this is an A tag
|
|||
if (target.nodeName.toLowerCase() != 'a') return; |
|||
|
|||
// Find the <a name> tag corresponding to this href
|
|||
// First strip off the hash (first character)
|
|||
anchor = target.hash.substr(1); |
|||
// Now loop all A tags until we find one with that name
|
|||
var allLinks = document.getElementsByTagName('a'); |
|||
var destinationLink = null; |
|||
for (var i=0;i<allLinks.length;i++) { |
|||
var lnk = allLinks[i]; |
|||
if (lnk.name && (lnk.name == anchor)) { |
|||
destinationLink = lnk; |
|||
break; |
|||
} |
|||
} |
|||
|
|||
// If we didn't find a destination, give up and let the browser do
|
|||
// its thing
|
|||
if (!destinationLink) return true; |
|||
|
|||
// Find the destination's position
|
|||
var destx = destinationLink.offsetLeft; |
|||
var desty = destinationLink.offsetTop; |
|||
var thisNode = destinationLink; |
|||
while (thisNode.offsetParent && |
|||
(thisNode.offsetParent != document.body)) { |
|||
thisNode = thisNode.offsetParent; |
|||
destx += thisNode.offsetLeft; |
|||
desty += thisNode.offsetTop; |
|||
} |
|||
|
|||
// Stop any current scrolling
|
|||
clearInterval(ss.INTERVAL); |
|||
|
|||
cypos = ss.getCurrentYPos(); |
|||
|
|||
ss_stepsize = parseInt((desty-cypos)/ss.STEPS); |
|||
ss.INTERVAL = |
|||
setInterval('ss.scrollWindow('+ss_stepsize+','+desty+',"'+anchor+'")',10); |
|||
|
|||
// And stop the actual click happening
|
|||
if (window.event) { |
|||
window.event.cancelBubble = true; |
|||
window.event.returnValue = false; |
|||
} |
|||
if (e && e.preventDefault && e.stopPropagation) { |
|||
e.preventDefault(); |
|||
e.stopPropagation(); |
|||
} |
|||
}, |
|||
|
|||
scrollWindow: function(scramount,dest,anchor) { |
|||
wascypos = ss.getCurrentYPos(); |
|||
isAbove = (wascypos < dest); |
|||
window.scrollTo(0,wascypos + scramount); |
|||
iscypos = ss.getCurrentYPos(); |
|||
isAboveNow = (iscypos < dest); |
|||
if ((isAbove != isAboveNow) || (wascypos == iscypos)) { |
|||
// if we've just scrolled past the destination, or
|
|||
// we haven't moved from the last scroll (i.e., we're at the
|
|||
// bottom of the page) then scroll exactly to the link
|
|||
window.scrollTo(0,dest); |
|||
// cancel the repeating timer
|
|||
clearInterval(ss.INTERVAL); |
|||
// and jump to the link directly so the URL's right
|
|||
location.hash = anchor; |
|||
} |
|||
}, |
|||
|
|||
getCurrentYPos: function() { |
|||
if (document.body && document.body.scrollTop) |
|||
return document.body.scrollTop; |
|||
if (document.documentElement && document.documentElement.scrollTop) |
|||
return document.documentElement.scrollTop; |
|||
if (window.pageYOffset) |
|||
return window.pageYOffset; |
|||
return 0; |
|||
}, |
|||
|
|||
addEvent: function(elm, evType, fn, useCapture) { |
|||
// addEvent and removeEvent
|
|||
// cross-browser event handling for IE5+, NS6 and Mozilla
|
|||
// By Scott Andrew
|
|||
if (elm.addEventListener){ |
|||
elm.addEventListener(evType, fn, useCapture); |
|||
return true; |
|||
} else if (elm.attachEvent){ |
|||
var r = elm.attachEvent("on"+evType, fn); |
|||
return r; |
|||
} else { |
|||
alert("Handler could not be removed"); |
|||
} |
|||
} |
|||
} |
|||
|
|||
ss.STEPS = 25; |
|||
|
|||
ss.addEvent(window,"load",ss.fixAllLinks); |
|||
@ -0,0 +1,68 @@ |
|||
//通知ボックスを定義
|
|||
function generate(layout,alerttype,alerttext) { |
|||
var n = noty({ |
|||
text: alerttext, |
|||
type: alerttype, |
|||
dismissQueue: true, |
|||
layout: layout, |
|||
theme: 'defaultTheme' |
|||
}); |
|||
} |
|||
|
|||
//通知ボックスのテキスト
|
|||
function generateNotify() { |
|||
generate('top','warning','お使いのブラウザのFlashplayerが最新ではありません<br /><a target="_blank" href="http://get.adobe.com/jp/flashplayer/">アップデートしてください</a>'); |
|||
} |
|||
|
|||
//Flashplayer version判定
|
|||
function getFlashPlayerVersion() { |
|||
|
|||
// var flashplayer_ver = 0;
|
|||
// //IE以外の場合
|
|||
// if(navigator.plugins && navigator.mimeTypes['application/x-shockwave-flash']){
|
|||
// var plugin = navigator.mimeTypes["application/x-shockwave-flash"].enabledPlugin;
|
|||
// //Flash Playerがインストールされている場合
|
|||
// if(plugin){flashplayer_ver = parseInt(plugin.description.match(/\d+\.\d+/));}
|
|||
// }
|
|||
// //IEの場合、もしくはFlash Playerがインストールされていない場合
|
|||
// else{
|
|||
// //IEでFlash Playerがインストールされている場合
|
|||
// try{
|
|||
// var flashOCX = new ActiveXObject("ShockwaveFlash.ShockwaveFlash").GetVariable("$version").match(/([0-9]+)/);
|
|||
// if(flashOCX){flashplayer_ver = parseInt(flashOCX[0]);}
|
|||
// }catch(e){}
|
|||
// }
|
|||
// //Flash Playerがインストールされていない、もしくはバージョンが6以下の場合
|
|||
// if(flashplayer_ver <= 6){
|
|||
// flashplayer_ver = 0; //6以下の場合ブラウザクラッシュ防止の為
|
|||
// }
|
|||
// if(flashplayer_ver <= 10){
|
|||
// generateNotify(); //通知ボックスを実行
|
|||
// }
|
|||
} |
|||
|
|||
//ユーザーエージェントごとにクラス分けやFlashplayer version判定を実行
|
|||
|
|||
var strUA = ""; |
|||
strUA = navigator.userAgent; |
|||
|
|||
if(strUA.indexOf("Android") != -1){ |
|||
document.getElementsByTagName("body")[0].setAttribute("class","android"); |
|||
|
|||
}else if(strUA.indexOf("iPad") != -1){ |
|||
document.getElementsByTagName("body")[0].setAttribute("class","ios"); |
|||
|
|||
}else if(strUA.indexOf("iPhone") != -1){ |
|||
|
|||
document.getElementsByTagName("body")[0].setAttribute("class","ios"); |
|||
|
|||
}else if(strUA.indexOf("iPod") != -1){ |
|||
|
|||
document.getElementsByTagName("body")[0].setAttribute("class","ios"); |
|||
|
|||
}else{ |
|||
document.getElementsByTagName("body")[0].setAttribute("class","pc"); |
|||
getFlashPlayerVersion();//Flashplayer version判定
|
|||
|
|||
} |
|||
|
|||
@ -0,0 +1,56 @@ |
|||
$(function(){ |
|||
//PC サムネイル Flash 用のダイレクトリンクを出力
|
|||
$(".pc .ua_thumlink").click(function(){ |
|||
html5_load() |
|||
}); |
|||
|
|||
//iOS サムネイル SD用のダイレクトリンクを出力 flash版のみの時はios androidはリンクなし
|
|||
$(".ios .ua_thumlink").click(function(){ |
|||
html5_load() |
|||
}); |
|||
|
|||
//Android サムネイル SD用のダイレクトリンクを出力 flash版のみの時はios androidはリンクなし
|
|||
$(".android .ua_thumlink").click(function(){ |
|||
html5_load() |
|||
}); |
|||
|
|||
|
|||
var prmStr = window.location.search; |
|||
var pagecode = -1; |
|||
var sid = -1; |
|||
var encrypted = 0; |
|||
|
|||
|
|||
prmStr = prmStr.substring(1); |
|||
var prmArr = prmStr.split("&"); |
|||
for(var i=0; i < prmArr.length; i++){ |
|||
var prmKey = prmArr[i].split("=")[0]; |
|||
switch(prmKey){ |
|||
case "pagecode": |
|||
pagecode = prmArr[i].split("=")[1]; |
|||
break; |
|||
case "sid": |
|||
sid = prmArr[i].split("=")[1]; |
|||
break; |
|||
} |
|||
} |
|||
var hrefStr = ""; |
|||
if(pagecode != -1){ |
|||
hrefStr += "&pageno="+pagecode; |
|||
} |
|||
if(sid != -1){ |
|||
hrefStr += "&sid="+sid; |
|||
} |
|||
|
|||
var objAppLink = document.getElementById("applink"); |
|||
var objAppLink02 = document.getElementById("applink02"); |
|||
if(objAppLink != null && objAppLink.href.indexOf('actibook:///') != -1){ |
|||
objAppLink.href += hrefStr; |
|||
} |
|||
if(objAppLink02 != null && objAppLink02.href.indexOf('actibook:///') != -1){ |
|||
objAppLink02.href += hrefStr; |
|||
} |
|||
|
|||
|
|||
|
|||
}); |
|||
@ -0,0 +1,22 @@ |
|||
var strUA = ""; |
|||
strUA = navigator.userAgent; |
|||
|
|||
if(strUA.indexOf("Android") != -1){ |
|||
window.document.write('<meta name="viewport" content="width=device-width, initial-scale=1.0?">'); |
|||
|
|||
}else if(strUA.indexOf("iPad") != -1){ |
|||
|
|||
}else if(strUA.indexOf("iPhone") != -1){ |
|||
window.document.write('<meta name="viewport" content="width=device-width, initial-scale=1.0?">'); |
|||
|
|||
}else if(strUA.indexOf("iPod") != -1){ |
|||
window.document.write('<meta name="viewport" content="width=device-width, initial-scale=1.0?">'); |
|||
|
|||
}else if(strUA.indexOf("MSIE") != -1){ |
|||
if(strUA.indexOf("10") != -1){ |
|||
|
|||
} |
|||
|
|||
}else{ |
|||
|
|||
} |
|||
Write
Preview
Loading…
Cancel
Save
Reference in new issue